{"version":3,"file":"select_othercities_animation-D7aZDD2T.js","sources":["../../../node_modules/unpoly/unpoly.js","../../../node_modules/choices.js/public/assets/scripts/choices.mjs","../../../node_modules/alpinejs/dist/module.esm.js","../../../app/frontend/custom_js/toastify.js","../../../app/frontend/up_compiler/up_toast.js","../../../app/frontend/up_compiler/select_city_animation.js","../../../app/frontend/up_compiler/select_othercities_animation.js"],"sourcesContent":["/******/ (() => { // webpackBootstrap\n/******/ \tvar __webpack_modules__ = ([\n/* 0 */,\n/* 1 */\n/***/ (() => {\n\nwindow.up = {\n version: '3.10.2'\n};\n\n\n/***/ }),\n/* 2 */\n/***/ (() => {\n\nup.mockable = function (originalFn) {\n if (window.jasmine) {\n let name = originalFn.name;\n let obj = { [name]: originalFn };\n let mockableFn = function () {\n return obj[name].apply(this, arguments);\n };\n mockableFn.mock = () => spyOn(obj, name);\n return mockableFn;\n }\n else {\n return originalFn;\n }\n};\n\n\n/***/ }),\n/* 3 */\n/***/ (() => {\n\nup.util = (function () {\n function noop() {\n }\n function asyncNoop() {\n return Promise.resolve();\n }\n function memoize(func) {\n let cachedValue, cached;\n return function (...args) {\n if (cached) {\n return cachedValue;\n }\n else {\n cached = true;\n return cachedValue = func.apply(this, args);\n }\n };\n }\n function normalizeURL(url, options) {\n options = newOptions(options, { host: 'cross-domain' });\n const parts = parseURL(url);\n let normalized = '';\n if (options.host === 'cross-domain') {\n options.host = isCrossOrigin(parts);\n }\n if (options.host) {\n normalized += parts.protocol + \"//\" + parts.host;\n }\n let { pathname } = parts;\n if (options.trailingSlash === false && pathname !== '/') {\n pathname = pathname.replace(/\\/$/, '');\n }\n normalized += pathname;\n if (options.search !== false) {\n normalized += parts.search;\n }\n if (options.hash !== false) {\n normalized += parts.hash;\n }\n return normalized;\n }\n function matchURLs(leftURL, rightURL, options) {\n return matchableURL(leftURL, options) === matchableURL(rightURL, options);\n }\n function matchableURL(url, options) {\n if (!url)\n return;\n return normalizeURL(url, { hash: false, trailingSlash: false, ...options });\n }\n function matchableURLPatternAtom(patternAtom) {\n if (patternAtom.endsWith('/'))\n return [patternAtom, patternAtom.slice(0, -1)];\n if (patternAtom.includes('/?'))\n return [patternAtom, patternAtom.replace('/?', '?')];\n if (patternAtom.endsWith('/*'))\n return [patternAtom, patternAtom.slice(0, -2), patternAtom.slice(0, -2) + '?*'];\n return patternAtom;\n }\n const APP_PROTOCOL = location.protocol;\n const APP_HOSTNAME = location.hostname;\n function isCrossOrigin(urlOrAnchor) {\n if (isString(urlOrAnchor) && (urlOrAnchor.indexOf('//') === -1)) {\n return false;\n }\n const parts = parseURL(urlOrAnchor);\n return (APP_HOSTNAME !== parts.hostname) || (APP_PROTOCOL !== parts.protocol);\n }\n function parseURL(url) {\n if (url.pathname) {\n return url;\n }\n let link = document.createElement('a');\n link.href = url;\n return link;\n }\n function normalizeMethod(method) {\n return method ? method.toUpperCase() : 'GET';\n }\n function methodAllowsPayload(method) {\n return (method !== 'GET') && (method !== 'HEAD');\n }\n function iteratee(block) {\n if (isString(block)) {\n return item => item[block];\n }\n else {\n return block;\n }\n }\n function map(list, block) {\n if (list.length === 0) {\n return [];\n }\n block = iteratee(block);\n let mapped = [];\n let i = 0;\n for (let item of list) {\n mapped.push(block(item, i++));\n }\n return mapped;\n }\n function mapObject(array, pairer) {\n const merger = function (object, pair) {\n object[pair[0]] = pair[1];\n return object;\n };\n return map(array, pairer).reduce(merger, {});\n }\n function each(array, block) {\n let i = 0;\n for (let item of array) {\n block(item, i++);\n }\n }\n function isNull(object) {\n return object === null;\n }\n function isUndefined(object) {\n return object === undefined;\n }\n const isDefined = negate(isUndefined);\n function isMissing(object) {\n return isUndefined(object) || isNull(object);\n }\n const isGiven = negate(isMissing);\n function isBlank(value) {\n if (isMissing(value)) {\n return true;\n }\n if (isObject(value) && value[isBlank.key]) {\n return value[isBlank.key]();\n }\n if (isString(value) || isList(value)) {\n return value.length === 0;\n }\n if (isOptions(value)) {\n return Object.keys(value).length === 0;\n }\n return false;\n }\n isBlank.key = 'up.util.isBlank';\n function presence(value, tester = isPresent) {\n if (tester(value)) {\n return value;\n }\n }\n const isPresent = negate(isBlank);\n function isFunction(object) {\n return typeof (object) === 'function';\n }\n function isString(object) {\n return (typeof (object) === 'string') || object instanceof String;\n }\n function isBoolean(object) {\n return (typeof (object) === 'boolean') || object instanceof Boolean;\n }\n function isNumber(object) {\n return (typeof (object) === 'number') || object instanceof Number;\n }\n function isOptions(object) {\n return (typeof (object) === 'object') && !isNull(object) && (isUndefined(object.constructor) || (object.constructor === Object));\n }\n function isObject(object) {\n const typeOfResult = typeof (object);\n return ((typeOfResult === 'object') && !isNull(object)) || (typeOfResult === 'function');\n }\n function isElement(object) {\n return object instanceof Element;\n }\n function isTextNode(object) {\n return object instanceof Text;\n }\n function isRegExp(object) {\n return object instanceof RegExp;\n }\n function isError(object) {\n return object instanceof Error;\n }\n function isJQuery(object) {\n return up.browser.canJQuery() && object instanceof jQuery;\n }\n function isElementLike(object) {\n return !!(object && (object.addEventListener || (isJQuery(object) && object[0]?.addEventListener)));\n }\n function isPromise(object) {\n return isObject(object) && isFunction(object.then);\n }\n const { isArray } = Array;\n function isFormData(object) {\n return object instanceof FormData;\n }\n function toArray(value) {\n return isArray(value) ? value : copyArrayLike(value);\n }\n function isList(value) {\n return isArray(value) ||\n isNodeList(value) ||\n isArguments(value) ||\n isJQuery(value) ||\n isHTMLCollection(value);\n }\n function isNodeList(value) {\n return value instanceof NodeList;\n }\n function isHTMLCollection(value) {\n return value instanceof HTMLCollection;\n }\n function isArguments(value) {\n return Object.prototype.toString.call(value) === '[object Arguments]';\n }\n function isAdjacentPosition(value) {\n return /^(before|after)/.test(value);\n }\n function wrapList(value) {\n if (isList(value)) {\n return value;\n }\n else if (isMissing(value)) {\n return [];\n }\n else {\n return [value];\n }\n }\n function copy(value) {\n if (isObject(value) && value[copy.key]) {\n value = value[copy.key]();\n }\n else if (isList(value)) {\n value = copyArrayLike(value);\n }\n else if (isOptions(value)) {\n value = Object.assign({}, value);\n }\n return value;\n }\n function copyArrayLike(arrayLike) {\n return Array.prototype.slice.call(arrayLike);\n }\n copy.key = 'up.util.copy';\n Date.prototype[copy.key] = function () { return new Date(+this); };\n function merge(...sources) {\n return Object.assign({}, ...sources);\n }\n function mergeDefined(...sources) {\n const result = {};\n for (let source of sources) {\n if (source) {\n for (let key in source) {\n const value = source[key];\n if (isDefined(value)) {\n result[key] = value;\n }\n }\n }\n }\n return result;\n }\n function newOptions(object, defaults) {\n if (defaults) {\n return merge(defaults, object);\n }\n else if (object) {\n return copy(object);\n }\n else {\n return {};\n }\n }\n function parseArgIntoOptions(args, argKey) {\n let [positionalArg, options] = parseArgs(args, 'val', 'options');\n if (isDefined(positionalArg)) {\n options[argKey] = positionalArg;\n }\n return options;\n }\n function findInList(list, tester) {\n tester = iteratee(tester);\n let match;\n for (let element of list) {\n if (tester(element)) {\n match = element;\n break;\n }\n }\n return match;\n }\n function some(list, tester) {\n return !!findResult(list, tester);\n }\n function findResult(list, tester) {\n tester = iteratee(tester);\n let i = 0;\n for (let item of list) {\n const result = tester(item, i++);\n if (result) {\n return result;\n }\n }\n }\n function every(list, tester) {\n tester = iteratee(tester);\n let match = true;\n let i = 0;\n for (let item of list) {\n if (!tester(item, i++)) {\n match = false;\n break;\n }\n }\n return match;\n }\n function compact(array) {\n return filterList(array, isGiven);\n }\n function compactObject(object) {\n return pickBy(object, isGiven);\n }\n function uniq(array) {\n if (array.length < 2) {\n return array;\n }\n return Array.from(new Set(array));\n }\n function uniqBy(array, mapper) {\n if (array.length < 2) {\n return array;\n }\n mapper = iteratee(mapper);\n const seenElements = new Set();\n return filterList(array, function (elem, index) {\n const mapped = mapper(elem, index);\n if (seenElements.has(mapped)) {\n return false;\n }\n else {\n seenElements.add(mapped);\n return true;\n }\n });\n }\n function filterList(list, tester) {\n tester = iteratee(tester);\n const matches = [];\n each(list, function (element, index) {\n if (tester(element, index)) {\n return matches.push(element);\n }\n });\n return matches;\n }\n function reject(list, tester) {\n tester = negate(iteratee(tester));\n return filterList(list, tester);\n }\n function intersect(array1, array2) {\n return filterList(array1, element => contains(array2, element));\n }\n function scheduleTimer(millis, callback) {\n return setTimeout(callback, millis);\n }\n function queueTask(task) {\n return setTimeout(task);\n }\n function last(value) {\n return value[value.length - 1];\n }\n function contains(value, subValue) {\n let indexOf = value.indexOf || Array.prototype.indexOf;\n return indexOf.call(value, subValue) >= 0;\n }\n function containsAll(values, subValues) {\n return every(subValues, (subValue) => contains(values, subValue));\n }\n function objectContains(object, subObject) {\n const reducedValue = pick(object, Object.keys(subObject));\n return isEqual(subObject, reducedValue);\n }\n function pick(object, keys) {\n const filtered = {};\n for (let key of keys) {\n if (key in object) {\n filtered[key] = object[key];\n }\n }\n return filtered;\n }\n function pickBy(object, tester) {\n tester = iteratee(tester);\n const filtered = {};\n for (let key in object) {\n const value = object[key];\n if (tester(value, key, object)) {\n filtered[key] = object[key];\n }\n }\n return filtered;\n }\n function omit(object, keys) {\n return pickBy(object, (_value, key) => !contains(keys, key));\n }\n function unresolvablePromise() {\n return new Promise(noop);\n }\n function remove(array, element) {\n const index = array.indexOf(element);\n if (index >= 0) {\n array.splice(index, 1);\n return element;\n }\n }\n function evalOption(value, ...args) {\n return isFunction(value) ? value(...args) : value;\n }\n function evalAutoOption(value, autoMeans, ...args) {\n value = evalOption(value, ...args);\n if (value === 'auto') {\n value = evalOption(autoMeans, ...args);\n }\n return value;\n }\n const ESCAPE_HTML_ENTITY_MAP = {\n \"&\": \"&\",\n \"<\": \"<\",\n \">\": \">\",\n '\"': '"',\n \"'\": '''\n };\n function escapeHTML(string) {\n return string.replace(/[&<>\"']/g, char => ESCAPE_HTML_ENTITY_MAP[char]);\n }\n function escapeRegExp(string) {\n return string.replace(/[\\\\^$*+?.()|[\\]{}]/g, '\\\\$&');\n }\n function pluckKey(object, key) {\n const value = object[key];\n delete object[key];\n return value;\n }\n function renameKey(object, oldKey, newKey) {\n if (oldKey in object) {\n object[newKey] = pluckKey(object, oldKey);\n }\n }\n function extractLastArg(args, tester) {\n if (tester(last(args))) {\n return args.pop();\n }\n }\n function extractCallback(args) {\n return extractLastArg(args, isFunction);\n }\n function extractOptions(args) {\n return extractLastArg(args, isOptions) || {};\n }\n function identity(arg) {\n return arg;\n }\n function sequence(functions) {\n functions = compact(functions);\n return (...args) => map(functions, fn => fn(...args));\n }\n function flatten(array) {\n const flattened = [];\n for (let object of array) {\n if (isList(object)) {\n flattened.push(...object);\n }\n else {\n flattened.push(object);\n }\n }\n return flattened;\n }\n function flatMap(array, block) {\n return flatten(map(array, block));\n }\n function always(promise, callback = identity) {\n return promise.then(callback, callback);\n }\n function newDeferred() {\n let resolveFn;\n let rejectFn;\n const nativePromise = new Promise(function (givenResolve, givenReject) {\n resolveFn = givenResolve;\n rejectFn = givenReject;\n });\n nativePromise.resolve = resolveFn;\n nativePromise.reject = rejectFn;\n return nativePromise;\n }\n function isBasicObjectProperty(k) {\n return Object.prototype.hasOwnProperty(k);\n }\n function isEqual(a, b) {\n if (a?.valueOf) {\n a = a.valueOf();\n }\n if (b?.valueOf) {\n b = b.valueOf();\n }\n if (typeof (a) !== typeof (b)) {\n return false;\n }\n else if (isList(a) && isList(b)) {\n return isEqualList(a, b);\n }\n else if (isObject(a) && a[isEqual.key]) {\n return a[isEqual.key](b);\n }\n else if (isOptions(a) && isOptions(b)) {\n const aKeys = Object.keys(a);\n const bKeys = Object.keys(b);\n if (isEqualList(aKeys, bKeys)) {\n return every(aKeys, aKey => isEqual(a[aKey], b[aKey]));\n }\n else {\n return false;\n }\n }\n else {\n return a === b;\n }\n }\n isEqual.key = 'up.util.isEqual';\n function isEqualList(a, b) {\n return (a.length === b.length) && every(a, (elem, index) => isEqual(elem, b[index]));\n }\n function getSimpleTokens(value, { json = false, separator = /[,\\s]/ } = {}) {\n if (!isString(value)) {\n return wrapList(value);\n }\n else if (json && /^\\[.*]$/.test(value)) {\n return parseRelaxedJSON(value);\n }\n else {\n return splitSimpleTokenString(value, separator);\n }\n }\n function splitSimpleTokenString(value, separator) {\n let parts = up.migrate.splitAtOr?.(value) || value.split(separator);\n return parts.map((s) => s.trim()).filter(identity);\n }\n function getComplexTokens(value) {\n if (!isString(value)) {\n return wrapList(value);\n }\n else {\n let { maskedTokens, restore } = complexTokenOutlines(value);\n return maskedTokens.map((token) => restore(token));\n }\n }\n function complexTokenOutlines(string) {\n let { masked, restore } = expressionOutline(string);\n let maskedTokens = splitSimpleTokenString(masked, ',');\n return { maskedTokens, restore };\n }\n function wrapValue(constructor, ...args) {\n return (args[0] instanceof constructor) ? args[0] : new constructor(...args);\n }\n let nextUid = 0;\n function uid() {\n return nextUid++;\n }\n function reverse(list) {\n return copy(list).reverse();\n }\n function withRenamedKeys(object, renameKeyFn) {\n const renamed = {};\n for (let key in object) {\n let transformed = renameKeyFn(key);\n if (isGiven(transformed)) {\n renamed[transformed] = object[key];\n }\n }\n return renamed;\n }\n function camelToKebabCase(str) {\n return str.replace(/[A-Z]/g, char => '-' + char.toLowerCase());\n }\n function lowerCaseFirst(str) {\n return str[0].toLowerCase() + str.slice(1);\n }\n function upperCaseFirst(str) {\n return str[0].toUpperCase() + str.slice(1);\n }\n function defineDelegates(object, props, targetProvider) {\n for (let prop of props) {\n Object.defineProperty(object, prop, {\n get() {\n const target = targetProvider.call(this);\n let value = target[prop];\n if (isFunction(value)) {\n value = value.bind(target);\n }\n return value;\n },\n set(newValue) {\n const target = targetProvider.call(this);\n target[prop] = newValue;\n }\n });\n }\n }\n function delegatePromise(object, targetProvider) {\n return defineDelegates(object, ['then', 'catch', 'finally'], targetProvider);\n }\n function stringifyArg(arg, placeholder = '%o') {\n let string;\n const maxLength = 200;\n if (placeholder === '%c') {\n return '';\n }\n if (placeholder === '%s' && isGiven(arg)) {\n arg = arg.toString();\n }\n if (isString(arg)) {\n string = arg.trim().replace(/[\\n\\r\\t ]+/g, ' ');\n if (placeholder === '%o') {\n string = JSON.stringify(string);\n }\n }\n else if (isUndefined(arg)) {\n string = 'undefined';\n }\n else if (isNumber(arg) || isFunction(arg)) {\n string = arg.toString();\n }\n else if (isArray(arg)) {\n string = `[${map(arg, stringifyArg).join(', ')}]`;\n }\n else if (isJQuery(arg)) {\n string = `$(${map(arg, stringifyArg).join(', ')})`;\n }\n else if (isElement(arg)) {\n string = `<${arg.tagName.toLowerCase()}`;\n for (let attr of ['id', 'up-id', 'name', 'class']) {\n let value = arg.getAttribute(attr);\n if (value) {\n string += ` ${attr}=\"${value}\"`;\n }\n }\n string += \">\";\n }\n else if (isRegExp(arg) || isError(arg)) {\n string = arg.toString();\n }\n else {\n try {\n string = JSON.stringify(arg);\n }\n catch (error) {\n if (error.name === 'TypeError') {\n string = '(circular structure)';\n }\n else {\n throw error;\n }\n }\n }\n if (string.length > maxLength) {\n string = `${string.substr(0, maxLength)}…${last(string)}`;\n }\n return string;\n }\n const SPRINTF_PLACEHOLDERS = /%[oOdisfc]/g;\n function sprintf(message, ...args) {\n return message.replace(SPRINTF_PLACEHOLDERS, (placeholder) => stringifyArg(args.shift(), placeholder));\n }\n function negate(fn) {\n return function (...args) {\n return !fn(...args);\n };\n }\n function useMemoizeCacheEntry(cacheEntry) {\n if (cacheEntry.error) {\n throw cacheEntry.error;\n }\n else {\n return cacheEntry.value;\n }\n }\n function buildMemoizeCacheEntry(oldImpl, self, args) {\n try {\n return { value: oldImpl.apply(self, args) };\n }\n catch (e) {\n return { error: e };\n }\n }\n function memoizeMethod(object, propLiteral) {\n for (let prop in propLiteral) {\n let originalDescriptor = Object.getOwnPropertyDescriptor(object, prop);\n let oldImpl = originalDescriptor.value;\n let cachingImpl = function (...args) {\n let cache = this[`__${prop}MemoizeCache`] ||= {};\n let cacheKey = JSON.stringify(args);\n cache[cacheKey] ||= buildMemoizeCacheEntry(oldImpl, this, args);\n return useMemoizeCacheEntry(cache[cacheKey]);\n };\n object[prop] = cachingImpl;\n }\n }\n function safeStringifyJSON(value) {\n let json = JSON.stringify(value);\n return escapeHighASCII(json);\n }\n function escapeHighASCII(string) {\n let unicodeEscape = (char) => \"\\\\u\" + char.charCodeAt(0).toString(16).padStart(4, '0');\n return string.replace(/[^\\x00-\\x7F]/g, unicodeEscape);\n }\n function variant(source, changes = {}) {\n let variant = Object.create(source);\n Object.assign(variant, changes);\n return variant;\n }\n function parseArgs(args, ...specs) {\n let results = [];\n while (specs.length) {\n let lastSpec = specs.pop();\n if (lastSpec === 'options') {\n results.unshift(extractOptions(args));\n }\n else if (lastSpec === 'callback') {\n results.unshift(extractCallback(args));\n }\n else if (lastSpec === 'val') {\n results.unshift(args.pop());\n }\n else if (isFunction(lastSpec)) {\n let value = lastSpec(last(args)) ? args.pop() : undefined;\n results.unshift(value);\n }\n }\n return results;\n }\n function scanFunctions(...values) {\n return values.flat().filter(isFunction);\n }\n function cleaner() {\n let fns = [];\n let track = function (values, transform) {\n values = scanFunctions(...values).map(transform);\n fns.push(...scanFunctions(...values));\n };\n let api = function (...values) {\n track(values, identity);\n };\n api.guard = function (...values) {\n track(values, up.error.guardFn);\n };\n api.clean = function (...args) {\n let { length } = fns;\n for (let i = length - 1; i >= 0; i--)\n fns[i](...args);\n fns = [];\n };\n return api;\n }\n function maskPattern(str, patterns, { keepDelimiters = false } = {}) {\n let maskCount = 0;\n let maskPattern = /§(\\d+)/g;\n let matches = [];\n let replaceLayers = 0;\n let replace = (replacePattern) => {\n let didReplace = false;\n str = str.replaceAll(replacePattern, function (match) {\n didReplace = true;\n let glyph = '§' + (maskCount++);\n let mask;\n let masked;\n if (keepDelimiters) {\n let startDelimiter = match[0];\n let endDelimiter = match.slice(-1);\n masked = match.slice(1, -1);\n mask = startDelimiter + glyph + endDelimiter;\n }\n else {\n masked = match;\n mask = glyph;\n }\n matches.push(masked);\n return mask;\n });\n if (didReplace)\n replaceLayers++;\n };\n [maskPattern, ...patterns].forEach(replace);\n let restore = (s, transform = identity) => {\n for (let i = 0; i < replaceLayers; i++) {\n s = s.replace(maskPattern, (match, placeholderIndex) => transform(matches[placeholderIndex]));\n }\n return s;\n };\n return { masked: str, restore };\n }\n const QUOTED_STRING_PATTERN = /'(?:\\\\\\\\|\\\\'|[^'])*'|\"(?:\\\\\\\\|\\\\\"|[^\"])*\"/g;\n const NESTED_GROUP_PATTERN = /{(?:[^{}]|{[^{}]*})*}|\\((?:[^\\(\\)]|\\([^\\(\\)]*\\))*\\)|\\[(?:[^\\[\\]]|\\[[^\\[\\]]*\\])*\\]/g;\n function expressionOutline(str) {\n return maskPattern(str, [QUOTED_STRING_PATTERN, NESTED_GROUP_PATTERN], { keepDelimiters: true });\n }\n function ensureDoubleQuotes(str) {\n if (str[0] === '\"')\n return str;\n str = str.slice(1, -1);\n let transformed = str.replace(/(\\\\\\\\)|(\\\\')|(\\\\\")|(\")/g, function (_match, escapedBackslash, escapedSingleQuote, _doubleQuote) {\n return escapedBackslash\n || (escapedSingleQuote && \"'\")\n || '\\\\\"';\n });\n return '\"' + transformed + '\"';\n }\n function parseString(value) {\n return JSON.parse(ensureDoubleQuotes(value));\n }\n function parseRelaxedJSON(str) {\n let { masked, restore } = maskPattern(str, [QUOTED_STRING_PATTERN]);\n masked = masked.replace(/([a-z_$][\\w$]*:)/gi, (unquotedProperty) => ('\"' + unquotedProperty.slice(0, -1) + '\":'));\n masked = masked.replace(/,\\s*([}\\]])/g, '$1');\n masked = restore(masked, ensureDoubleQuotes);\n return JSON.parse(masked);\n }\n function parseScalarJSONPairs(str) {\n let { maskedTokens, restore } = complexTokenOutlines(str);\n return maskedTokens.map((maskedToken) => {\n let [_match, string, json] = maskedToken.match(/([^{]+)({[^}]*})?/);\n return [\n restore(string.trim()),\n json && parseRelaxedJSON(restore(json))\n ];\n });\n }\n return {\n parseURL,\n normalizeURL,\n matchableURL,\n matchableURLPatternAtom,\n matchURLs,\n normalizeMethod,\n methodAllowsPayload,\n copy,\n merge,\n mergeDefined,\n options: newOptions,\n parseArgIntoOptions,\n each,\n map,\n flatMap,\n mapObject,\n findResult,\n some,\n every,\n find: findInList,\n filter: filterList,\n reject,\n intersect,\n compact,\n compactObject,\n uniq,\n uniqBy,\n last,\n isNull,\n isDefined,\n isUndefined,\n isGiven,\n isMissing,\n isPresent,\n isBlank,\n presence,\n isObject,\n isFunction,\n isString,\n isBoolean,\n isNumber,\n isElement,\n isTextNode,\n isJQuery,\n isElementLike,\n isPromise,\n isOptions,\n isArray,\n isFormData,\n isList,\n isRegExp,\n isAdjacentPosition,\n timer: scheduleTimer,\n contains,\n containsAll,\n objectContains,\n toArray,\n pick,\n pickBy,\n omit,\n unresolvablePromise,\n remove,\n memoize,\n pluckKey,\n renameKey,\n extractOptions,\n extractCallback,\n noop,\n asyncNoop,\n identity,\n escapeHTML,\n escapeRegExp,\n sequence,\n evalOption,\n evalAutoOption,\n flatten,\n newDeferred,\n always,\n isBasicObjectProperty,\n isCrossOrigin,\n task: queueTask,\n isEqual,\n getSimpleTokens,\n getComplexTokens,\n wrapList,\n wrapValue,\n uid,\n upperCaseFirst,\n lowerCaseFirst,\n delegate: defineDelegates,\n delegatePromise,\n reverse,\n camelToKebabCase,\n sprintf,\n withRenamedKeys,\n memoizeMethod,\n safeStringifyJSON,\n variant,\n cleaner,\n scanFunctions,\n args: parseArgs,\n parseRelaxedJSON,\n parseScalarJSONPairs,\n maskPattern,\n expressionOutline,\n parseString,\n };\n})();\n\n\n/***/ }),\n/* 4 */\n/***/ (() => {\n\nup.error = (function () {\n function fail(...args) {\n throw new up.Error(args);\n }\n function isCritical(error) {\n return (typeof error !== 'object') || ((error.name !== 'AbortError') && !(error instanceof up.RenderResult) && !(error instanceof up.Response));\n }\n function muteUncriticalRejection(promise) {\n return promise.catch(throwCritical);\n }\n function muteUncriticalSync(block) {\n try {\n return block();\n }\n catch (e) {\n throwCritical(e);\n }\n }\n function throwCritical(value) {\n if (isCritical(value)) {\n throw value;\n }\n }\n function guard(fn, ...args) {\n try {\n return fn(...args);\n }\n catch (error) {\n reportError(error);\n }\n }\n function guardFn(fn) {\n return (...args) => guard(() => fn(...args));\n }\n return {\n fail,\n throwCritical,\n muteUncriticalRejection,\n muteUncriticalSync,\n guard,\n guardFn,\n };\n})();\nup.fail = up.error.fail;\n\n\n/***/ }),\n/* 5 */\n/***/ (() => {\n\nup.migrate = {\n config: {},\n};\n\n\n/***/ }),\n/* 6 */\n/***/ (() => {\n\nup.browser = (function () {\n function submitForm(form) {\n form.submit();\n }\n function canPushState() {\n return up.protocol.initialRequestMethod() === 'GET';\n }\n function canJQuery() {\n return !!window.jQuery;\n }\n function popCookie(name) {\n let value = document.cookie.match(new RegExp(name + \"=(\\\\w+)\"))?.[1];\n if (value) {\n document.cookie = name + '=;Max-Age=0;Path=/';\n return value;\n }\n }\n function assertConfirmed(options) {\n const confirmed = !options.confirm || window.confirm(options.confirm);\n if (!confirmed) {\n throw new up.Aborted('User canceled action');\n }\n return true;\n }\n return {\n submitForm,\n canPushState,\n canJQuery,\n assertConfirmed,\n popCookie,\n };\n})();\n\n\n/***/ }),\n/* 7 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(8);\nup.element = (function () {\n const u = up.util;\n function first(...args) {\n let [root = document, selector] = u.args(args, 'val', 'val');\n return root.querySelector(selector);\n }\n function subtree(root, selector) {\n const results = [];\n if (elementLikeMatches(root, selector)) {\n results.push(root);\n }\n results.push(...root.querySelectorAll(selector));\n return results;\n }\n function subtreeFirst(root, selector) {\n return elementLikeMatches(root, selector) ? root : root.querySelector(selector);\n }\n function elementLikeMatches(elementLike, selector) {\n return u.isElement(elementLike) && elementLike.matches(selector);\n }\n function contains(root, selectorOrElement) {\n const element = getOne(selectorOrElement);\n return Node.prototype.contains.call(root, element);\n }\n function ancestor(element, selector) {\n return element.parentNode?.closest(selector);\n }\n function around(element, selector) {\n return getList(element.closest(selector), subtree(element, selector));\n }\n function getOne(...args) {\n const value = args.pop();\n if (u.isElement(value)) {\n return value;\n }\n else if (u.isString(value)) {\n return first(...args, value);\n }\n else if (u.isList(value)) {\n if (value.length > 1) {\n up.fail('up.element.get(): Cannot cast multiple elements (%o) to a single element', value);\n }\n return value[0];\n }\n else {\n return value;\n }\n }\n function getList(...args) {\n return u.flatMap(args, valueToList);\n }\n function valueToList(value) {\n if (u.isString(value)) {\n return document.querySelectorAll(value);\n }\n else {\n return u.wrapList(value);\n }\n }\n function hide(element) {\n setVisible(element, false);\n }\n function show(element) {\n setVisible(element, true);\n }\n function showTemp(element) {\n return setVisibleTemp(element, true);\n }\n function hideTemp(element) {\n return setVisibleTemp(element, false);\n }\n function setVisibleTemp(element, newVisible) {\n if (newVisible === isVisible(element))\n return u.noop;\n setVisible(element, newVisible);\n return () => setVisible(element, !newVisible);\n }\n function setVisible(element, newVisible) {\n if (newVisible) {\n element.removeAttribute('hidden');\n if (element.style.display === 'none') {\n element.style.display = '';\n }\n }\n else {\n element.setAttribute('hidden', '');\n }\n }\n function toggle(element, newVisible = !isVisible(element)) {\n setVisible(element, newVisible);\n }\n function setAttrPresence(element, attr, value, newPresent) {\n if (newPresent) {\n return element.setAttribute(attr, value);\n }\n else {\n return element.removeAttribute(attr);\n }\n }\n function setAttrs(element, attrs) {\n for (let key in attrs) {\n const value = attrs[key];\n if (u.isGiven(value)) {\n element.setAttribute(key, value);\n }\n else {\n element.removeAttribute(key);\n }\n }\n }\n function setAttrsTemp(element, attrs) {\n let keys = Object.keys(attrs);\n let oldAttrs = pickAttrs(element, keys);\n setAttrs(element, attrs);\n return () => setAttrs(element, oldAttrs);\n }\n function metaContent(name) {\n const selector = \"meta\" + attrSelector('name', name);\n return first(selector)?.getAttribute('content');\n }\n function insertBefore(existingNode, newNode) {\n existingNode.parentNode.insertBefore(newNode, existingNode);\n }\n function createFromSelector(selector, attrs = {}) {\n let { includePath } = parseSelector(selector);\n let rootElement;\n let depthElement;\n let previousElement;\n for (let includeSegment of includePath) {\n let { tagName } = includeSegment;\n if (!tagName || tagName === '*') {\n tagName = 'div';\n }\n depthElement = document.createElement(tagName);\n if (!rootElement) {\n rootElement = depthElement;\n }\n makeVariation(depthElement, includeSegment);\n previousElement?.appendChild(depthElement);\n previousElement = depthElement;\n }\n for (let key in attrs) {\n let value = attrs[key];\n if (key === 'class') {\n addClasses(rootElement, u.wrapList(value));\n }\n else if (key === 'style') {\n setInlineStyle(rootElement, value);\n }\n else if (key === 'text') {\n rootElement.textContent = value;\n }\n else if (key === 'content') {\n if (u.isString(value)) {\n rootElement.innerHTML = value;\n }\n else {\n rootElement.append(...u.wrapList(value));\n }\n }\n else {\n rootElement.setAttribute(key, value);\n }\n }\n return rootElement;\n }\n function makeVariation(element, { id, classNames, attributes }) {\n if (id) {\n element.id = id;\n }\n for (let [name, value] of Object.entries(attributes)) {\n element.setAttribute(name, value);\n }\n addClasses(element, classNames);\n }\n function parseSelector(rawSelector) {\n let excludeRaw;\n const { masked: selectorOutline, restore: restoreSelectorLiterals, } = u.expressionOutline(rawSelector);\n const includeWithoutAttrs = selectorOutline.replace(/:not\\([^)]*\\)/, function (match) {\n excludeRaw = restoreSelectorLiterals(match);\n return '';\n });\n let includeRaw = restoreSelectorLiterals(includeWithoutAttrs);\n const includeSegments = includeWithoutAttrs.split(/[ >]+/);\n let includePath = includeSegments.map(function (depthSelector) {\n let parsed = {\n tagName: null,\n classNames: [],\n id: null,\n attributes: {}\n };\n depthSelector = depthSelector.replace(/^[\\w-*]+/, function (match) {\n parsed.tagName = match;\n return '';\n });\n depthSelector = depthSelector.replace(/#([\\w-]+)/, function (_match, id) {\n parsed.id = id;\n return '';\n });\n depthSelector = depthSelector.replace(/\\.([\\w-]+)/g, function (_match, className) {\n parsed.classNames.push(className);\n return '';\n });\n depthSelector = depthSelector.replace(/\\[[^\\]]*]/g, function (attr) {\n attr = restoreSelectorLiterals(attr);\n let [_raw, name, _operator, quote, value] = attr.match(/\\[([\\w-]+)(?:([~|^$*]?=)([\"'])?([^\\3\\]]*?)\\3)?]/);\n quote ||= '\"';\n parsed.attributes[name] = value ? u.parseString(quote + value + quote) : '';\n return '';\n });\n if (depthSelector) {\n up.fail('Cannot parse selector: ' + rawSelector);\n }\n return parsed;\n });\n return {\n includePath,\n includeRaw,\n excludeRaw,\n };\n }\n function affix(...args) {\n let [parent, position = 'beforeend', selector, attributes] = u.args(args, 'val', u.isAdjacentPosition, 'val', 'options');\n const element = createFromSelector(selector, attributes);\n parent.insertAdjacentElement(position, element);\n return element;\n }\n const SINGLETON_TAG_NAMES = ['HTML', 'BODY', 'HEAD', 'TITLE'];\n const isSingleton = up.mockable(element => element.matches(SINGLETON_TAG_NAMES.join()));\n function elementTagName(element) {\n return element.tagName.toLowerCase();\n }\n function attrSelector(attribute, value) {\n if (u.isGiven(value)) {\n value = value.replace(/\"/g, '\\\\\"');\n return `[${attribute}=\"${value}\"]`;\n }\n else {\n return `[${attribute}]`;\n }\n }\n function idSelector(id) {\n if (id.match(/^[a-z][a-z0-9\\-_]*$/i)) {\n return `#${id}`;\n }\n else {\n return attrSelector('id', id);\n }\n }\n function classSelector(klass) {\n klass = klass.replace(/[^\\w-]/g, '\\\\$&');\n return `.${klass}`;\n }\n function createBrokenDocumentFromHTML(html) {\n return new DOMParser().parseFromString(html, 'text/html');\n }\n function fixParserDamage(scriptish) {\n let clone = createFromHTML(scriptish.outerHTML);\n scriptish.replaceWith(clone);\n }\n function createFromHTML(html) {\n return extractSingular(createNodesFromHTML(html));\n }\n function extractSingular(nodes) {\n if (nodes.length === 1 && u.isElementLike(nodes[0])) {\n return nodes[0];\n }\n else {\n up.fail('Expected a single element, but got %d elements', nodes.length);\n }\n }\n function createNodesFromHTML(html) {\n html = html.trim();\n const range = document.createRange();\n range.setStart(document.body, 0);\n const fragment = range.createContextualFragment(html);\n return fragment.childNodes;\n }\n function getRoot() {\n return document.documentElement;\n }\n function paint(element) {\n element.offsetHeight;\n }\n function concludeCSSTransition(element) {\n const undo = setStyleTemp(element, { transition: 'none' });\n paint(element);\n return undo;\n }\n function hasCSSTransition(styleHash) {\n const prop = styleHash['transition-property'];\n const duration = styleHash['transition-duration'];\n const noTransition = ((prop === 'none') || ((prop === 'all') && (duration === 0)));\n return !noTransition;\n }\n function fixedToAbsolute(element) {\n const elementRectAsFixed = element.getBoundingClientRect();\n element.style.position = 'absolute';\n const offsetParentRect = element.offsetParent.getBoundingClientRect();\n setInlineStyle(element, {\n left: (elementRectAsFixed.left - computedStyleNumber(element, 'margin-left') - offsetParentRect.left) + 'px',\n top: (elementRectAsFixed.top - computedStyleNumber(element, 'margin-top') - offsetParentRect.top) + 'px',\n right: '',\n bottom: ''\n });\n }\n function setMissingAttrs(element, attrs) {\n for (let key in attrs) {\n setMissingAttr(element, key, attrs[key]);\n }\n }\n function setMissingAttr(element, key, value) {\n if (u.isMissing(element.getAttribute(key))) {\n element.setAttribute(key, value);\n }\n }\n function unwrap(wrapper) {\n preservingFocus(function () {\n let childNodes = [...wrapper.childNodes];\n for (let child of childNodes)\n insertBefore(wrapper, child);\n wrapper.remove();\n });\n }\n function wrapNodes(nodeOrNodes) {\n const wrapper = document.createElement('up-wrapper');\n wrapper.append(...u.wrapList(nodeOrNodes));\n return wrapper;\n }\n function wrapIfRequired(nodes) {\n if (nodes.length === 1 && u.isElement(nodes[0])) {\n return nodes[0];\n }\n else {\n return wrapNodes(nodes);\n }\n }\n function wrapChildren(element) {\n const wrapper = wrapNodes(element.childNodes);\n element.append(wrapper);\n return wrapper;\n }\n function preservingFocus(fn) {\n const oldFocusElement = document.activeElement;\n try {\n return fn();\n }\n finally {\n if (oldFocusElement && oldFocusElement !== document.activeElement) {\n oldFocusElement.focus({ preventScroll: true });\n }\n }\n }\n function parseAttr(element, attribute, ...parsers) {\n if (!element.hasAttribute?.(attribute))\n return undefined;\n let rawValue = element.getAttribute(attribute);\n for (let parser of parsers) {\n let parserResult = parser(rawValue, attribute, element);\n if (u.isDefined(parserResult))\n return parserResult;\n }\n }\n function stringAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseString);\n }\n let tryParseString = u.identity;\n function booleanAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseBoolean);\n }\n function tryParseBoolean(value, attribute) {\n switch (value) {\n case 'false': {\n return false;\n }\n case 'true':\n case '':\n case attribute:\n {\n return true;\n }\n }\n }\n function booleanOrStringAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseBoolean, tryParseString);\n }\n function booleanOrNumberAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseBoolean, tryParseNumber);\n }\n function numberAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseNumber);\n }\n function tryParseNumber(value) {\n value = value.replaceAll('_', '');\n if (value.match(/^-?[\\d.]+$/)) {\n return parseFloat(value);\n }\n }\n function jsonAttr(element, attribute) {\n return parseAttr(element, attribute, tryParseJSON);\n }\n function tryParseJSON(value) {\n if (value?.trim()) {\n return u.parseRelaxedJSON(value);\n }\n }\n function callbackAttr(link, attr, callbackOptions) {\n return parseAttr(link, attr, (value) => tryParseCallback(value, link, callbackOptions));\n }\n function tryParseCallback(code, link, { exposedKeys = [], mainKey = 'event' } = {}) {\n const callback = up.NonceableCallback.fromString(code).toFunction(mainKey, ...exposedKeys);\n return function (event) {\n const exposedValues = Object.values(u.pick(event, exposedKeys));\n return callback.call(link, event, ...exposedValues);\n };\n }\n function closestAttr(element, attr, readAttrFn = stringAttr) {\n let match = element.closest('[' + attr + ']');\n if (match) {\n return readAttrFn(match, attr);\n }\n }\n function addClasses(element, classes) {\n for (let klass of classes)\n element.classList.add(klass);\n }\n function addClassTemp(element, klass) {\n return setClassStateTemp(element, klass, true);\n }\n function removeClassTemp(element, klass) {\n return setClassStateTemp(element, klass, false);\n }\n function setClassStateTemp(element, klass, targetState) {\n if (element.classList.contains(klass) === targetState)\n return u.noop;\n element.classList.toggle(klass, targetState);\n return () => element.classList.toggle(klass, !targetState);\n }\n function computedStyle(element, props) {\n const style = window.getComputedStyle(element);\n return extractFromStyleObject(style, props);\n }\n function computedStyleNumber(element, prop) {\n const rawValue = computedStyle(element, prop);\n if (u.isPresent(rawValue)) {\n return parseFloat(rawValue);\n }\n }\n function inlineStyle(element, props) {\n const { style } = element;\n return extractFromStyleObject(style, props);\n }\n function extractFromStyleObject(style, keyOrKeys) {\n if (up.migrate.loaded)\n keyOrKeys = up.migrate.fixStyleProps(keyOrKeys);\n if (u.isString(keyOrKeys)) {\n return style.getPropertyValue(keyOrKeys);\n }\n else {\n return u.mapObject(keyOrKeys, (key) => [key, style.getPropertyValue(key)]);\n }\n }\n function setInlineStyle(element, props, unit = '') {\n if (up.migrate.loaded)\n props = up.migrate.fixStyleProps(props, unit);\n if (u.isString(props)) {\n element.setAttribute('style', props);\n }\n else {\n const { style } = element;\n for (let key in props) {\n let value = props[key];\n style.setProperty(key, value + unit);\n }\n }\n }\n function setStyleTemp(element, newStyles) {\n const oldStyles = inlineStyle(element, Object.keys(newStyles));\n setInlineStyle(element, newStyles);\n return () => setInlineStyle(element, oldStyles);\n }\n function isVisible(element) {\n return !!(element.offsetWidth || element.offsetHeight || element.getClientRects().length);\n }\n function isUpPrefixed(string) {\n return /^up-/.test(string);\n }\n function pickAttrs(element, attrNames) {\n return u.mapObject(attrNames, (name) => [name, element.getAttribute(name)]);\n }\n function upAttrs(element) {\n let attrNames = element.getAttributeNames().filter(isUpPrefixed);\n return pickAttrs(element, attrNames);\n }\n function upClasses(element) {\n return u.filter(element.classList.values(), isUpPrefixed);\n }\n function cleanJQuery(element) {\n if (up.browser.canJQuery()) {\n jQuery(element).remove();\n }\n }\n function isEmpty(element) {\n return !element.children.length > 0 && !element.innerText.trim();\n }\n function crossOriginSelector(attr) {\n return `[${attr}*=\"//\"]:not([${attr}*=\"//${location.host}/\"])`;\n }\n function isIntersectingWindow(element, { margin = 0 } = {}) {\n const rect = up.Rect.fromElement(element);\n rect.grow(margin);\n return (rect.bottom > 0) && (rect.top < window.innerHeight) &&\n (rect.right > 0) && (rect.left < window.innerWidth);\n }\n function unionSelector(includes, excludes) {\n let selector = `:is(${includes.join()})`;\n if (u.isPresent(excludes))\n selector += `:not(${excludes.join()})`;\n return selector;\n }\n function matchSelectorMap(selectorMap, element) {\n let matches = [];\n if (selectorMap) {\n for (let [selector, value] of Object.entries(selectorMap)) {\n if (u.isDefined(value) && element.matches(selector)) {\n matches.push(value);\n }\n }\n }\n return matches;\n }\n function documentPosition(element) {\n let nextSibling = element.nextElementSibling;\n if (nextSibling) {\n return [nextSibling, 'beforebegin'];\n }\n else {\n return [element.parentElement, 'beforeend'];\n }\n }\n return {\n subtree,\n subtreeFirst,\n contains,\n closestAttr,\n ancestor,\n around,\n get: getOne,\n list: getList,\n toggle,\n hide,\n hideTemp,\n show,\n showTemp,\n metaContent,\n insertBefore,\n createFromSelector,\n setAttrs,\n setAttrsTemp,\n affix,\n idSelector,\n classSelector,\n isSingleton,\n attrSelector,\n tagName: elementTagName,\n createBrokenDocumentFromHTML,\n fixParserDamage,\n createNodesFromHTML,\n createFromHTML,\n extractSingular,\n get root() { return getRoot(); },\n paint,\n concludeCSSTransition,\n hasCSSTransition,\n fixedToAbsolute,\n setMissingAttrs,\n setMissingAttr,\n unwrap,\n wrapChildren,\n wrapIfRequired,\n attr: stringAttr,\n booleanAttr,\n numberAttr,\n jsonAttr,\n callbackAttr,\n booleanOrStringAttr,\n booleanOrNumberAttr,\n setStyleTemp,\n style: computedStyle,\n styleNumber: computedStyleNumber,\n inlineStyle,\n setStyle: setInlineStyle,\n isVisible,\n upAttrs,\n upClasses,\n setAttrPresence,\n addClasses,\n addClassTemp,\n removeClassTemp,\n cleanJQuery,\n parseSelector,\n isEmpty,\n crossOriginSelector,\n isIntersectingWindow,\n unionSelector,\n matchSelectorMap,\n elementLikeMatches,\n documentPosition,\n };\n})();\n\n\n/***/ }),\n/* 8 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 9 */\n/***/ (() => {\n\nup.Error = class Error extends window.Error {\n constructor(message, props = {}) {\n if (Array.isArray(message)) {\n message = up.util.sprintf(...message);\n }\n super(message);\n let name = 'up.' + this.constructor.name;\n Object.assign(this, { name }, props);\n }\n};\n\n\n/***/ }),\n/* 10 */\n/***/ (() => {\n\nup.NotImplemented = class NotImplemented extends up.Error {\n};\n\n\n/***/ }),\n/* 11 */\n/***/ (() => {\n\nup.Aborted = class Aborted extends up.Error {\n constructor(message) {\n super(message, { name: 'AbortError' });\n }\n};\n\n\n/***/ }),\n/* 12 */\n/***/ (() => {\n\nup.CannotMatch = class CannotMatch extends up.Error {\n};\n\n\n/***/ }),\n/* 13 */\n/***/ (() => {\n\nup.CannotParse = class CannotParse extends up.Error {\n};\n\n\n/***/ }),\n/* 14 */\n/***/ (() => {\n\nup.CannotTarget = class CannotTarget extends up.Error {\n};\n\n\n/***/ }),\n/* 15 */\n/***/ (() => {\n\nup.Offline = class Offline extends up.Error {\n};\n\n\n/***/ }),\n/* 16 */\n/***/ (() => {\n\nconst u = up.util;\nup.Record = class Record {\n keys() {\n throw 'Return an array of keys';\n }\n defaults(_options) {\n return {};\n }\n constructor(options) {\n Object.assign(this, this.defaults(options), this.attributes(options));\n }\n attributes(source = this) {\n return u.pick(source, this.keys());\n }\n [u.copy.key]() {\n return u.variant(this);\n }\n [u.isEqual.key](other) {\n return (this.constructor === other.constructor) && u.isEqual(this.attributes(), other.attributes());\n }\n};\n\n\n/***/ }),\n/* 17 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Config = class Config {\n constructor(blueprintFn = (() => ({}))) {\n this._blueprintFn = blueprintFn;\n this.reset();\n document.addEventListener('up:framework:reset', () => this.reset());\n }\n reset() {\n Object.assign(this, this._blueprintFn());\n }\n matches(element, prop) {\n return element.matches(this.selector(prop));\n }\n selector(prop) {\n let includes = this[prop];\n let excludes = this['no' + u.upperCaseFirst(prop)];\n return e.unionSelector(includes, excludes);\n }\n selectorFn(prop) {\n return () => this.selector(prop);\n }\n};\n\n\n/***/ }),\n/* 18 */\n/***/ (() => {\n\nlet enabledKey = 'up.log.enabled';\nlet enabled = false;\ntry {\n enabled = !!sessionStorage?.getItem(enabledKey);\n}\ncatch {\n}\nup.LogConfig = class LogConfig extends up.Config {\n constructor() {\n super(() => ({\n banner: true,\n format: true,\n }));\n }\n get enabled() {\n return enabled;\n }\n set enabled(newEnabled) {\n enabled = newEnabled;\n try {\n sessionStorage?.setItem(enabledKey, newEnabled ? '1' : '');\n }\n catch {\n }\n }\n};\n\n\n/***/ }),\n/* 19 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.OptionsParser = class OptionsParser {\n constructor(element, options, parserOptions = {}) {\n this._options = options;\n this._element = element;\n this._parserOptions = parserOptions;\n this._fail = parserOptions.fail;\n this._closest = parserOptions.closest;\n this._attrPrefix = parserOptions.attrPrefix || 'up-';\n this._defaults = parserOptions.defaults || {};\n }\n string(key, keyOptions) {\n this.parse(e.attr, key, keyOptions);\n }\n boolean(key, keyOptions) {\n this.parse(e.booleanAttr, key, keyOptions);\n }\n number(key, keyOptions) {\n this.parse(e.numberAttr, key, keyOptions);\n }\n booleanOrString(key, keyOptions) {\n this.parse(e.booleanOrStringAttr, key, keyOptions);\n }\n booleanOrNumber(key, keyOptions) {\n this.parse(e.booleanOrNumberAttr, key, keyOptions);\n }\n json(key, keyOptions) {\n this.parse(e.jsonAttr, key, keyOptions);\n }\n callback(key, keyOptions = {}) {\n let parser = (link, attr) => e.callbackAttr(link, attr, keyOptions);\n this.parse(parser, key, keyOptions);\n }\n parse(attrValueFn, key, keyOptions = {}) {\n const attrNames = u.wrapList(keyOptions.attr ?? this._attrNameForKey(key));\n let value = this._options[key];\n for (let attrName of attrNames) {\n value ??= this._parseFromAttr(attrValueFn, this._element, attrName);\n }\n value ??= keyOptions.default ?? this._defaults[key];\n let normalizeFn = keyOptions.normalize;\n if (normalizeFn) {\n value = normalizeFn(value);\n }\n if (u.isDefined(value)) {\n this._options[key] = value;\n }\n let failKey;\n if (this._fail && (failKey = up.fragment.failKey(key))) {\n const failAttrNames = u.compact(u.map(attrNames, (attrName) => this._deriveFailAttrName(attrName)));\n this.parse(attrValueFn, failKey, { ...keyOptions, attr: failAttrNames });\n }\n }\n include(optionsFn) {\n let fnResult = optionsFn(this._element, this._options, this._parserOptions);\n Object.assign(this._options, fnResult);\n }\n _parseFromAttr(attrValueFn, element, attrName) {\n if (this._closest) {\n return e.closestAttr(element, attrName, attrValueFn);\n }\n else {\n return attrValueFn(element, attrName);\n }\n }\n _deriveFailAttrName(attr) {\n return this._deriveFailAttrNameForPrefix(attr, this._attrPrefix + 'on-') ||\n this._deriveFailAttrNameForPrefix(attr, this._attrPrefix);\n }\n _deriveFailAttrNameForPrefix(attr, prefix) {\n if (attr.startsWith(prefix)) {\n return `${prefix}fail-${attr.substring(prefix.length)}`;\n }\n }\n _attrNameForKey(option) {\n return `${this._attrPrefix}${u.camelToKebabCase(option)}`;\n }\n};\n\n\n/***/ }),\n/* 20 */\n/***/ (() => {\n\nconst u = up.util;\nup.FIFOCache = class FIFOCache {\n constructor({ capacity = 10, normalizeKey = u.identity } = {}) {\n this._map = new Map();\n this._capacity = capacity;\n this._normalizeKey = normalizeKey;\n }\n get(key) {\n key = this._normalizeKey(key);\n return this._map.get(key);\n }\n set(key, value) {\n if (this._map.size === this._capacity) {\n let oldestKey = this._map.keys().next().value;\n this._map.delete(oldestKey);\n }\n key = this._normalizeKey(key);\n this._map.set(key, value);\n }\n clear() {\n this._map.clear();\n }\n};\n\n\n/***/ }),\n/* 21 */\n/***/ (() => {\n\nup.Rect = class Rect extends up.Record {\n keys() {\n return [\n 'left',\n 'top',\n 'width',\n 'height'\n ];\n }\n get bottom() {\n return this.top + this.height;\n }\n get right() {\n return this.left + this.width;\n }\n grow(padding) {\n this.left -= padding;\n this.top -= padding;\n this.width += padding * 2;\n this.height += padding * 2;\n }\n static fromElement(element) {\n return new (this)(element.getBoundingClientRect());\n }\n};\n\n\n/***/ }),\n/* 22 */\n/***/ (() => {\n\nconst e = up.element;\nconst u = up.util;\nconst SHIFT_CLASS = 'up-scrollbar-away';\nup.BodyShifter = class BodyShifter {\n constructor() {\n this._anchoredElements = new Set();\n this._stack = 0;\n this._cleaner = u.cleaner();\n }\n lowerStack() {\n if (--this._stack === 0)\n this._cleaner.clean();\n }\n raiseStack() {\n if (++this._stack === 1)\n this._shiftNow();\n }\n onAnchoredElementInserted(element) {\n this._anchoredElements.add(element);\n this._shiftElement(element, 'right');\n return () => this._anchoredElements.delete(element);\n }\n _isShifted() {\n return this._rootScrollbarWidth && this._stack > 0;\n }\n _shiftNow() {\n this._rootScrollbarWidth = up.viewport.rootScrollbarWidth();\n this._cleaner(e.setStyleTemp(e.root, {\n '--up-scrollbar-width': this._rootScrollbarWidth + 'px'\n }));\n this._shiftElement(document.body, 'padding-right');\n for (let element of this._anchoredElements) {\n this._shiftElement(element, 'right');\n }\n }\n _shiftElement(element, styleProp) {\n if (!this._isShifted())\n return;\n let originalValue = e.style(element, styleProp);\n this._cleaner(e.setStyleTemp(element, { ['--up-original-' + styleProp]: originalValue }), e.addClassTemp(element, SHIFT_CLASS));\n }\n};\n\n\n/***/ }),\n/* 23 */\n/***/ (() => {\n\nconst u = up.util;\nup.Change = class Change {\n constructor(options) {\n this.options = options;\n }\n execute() {\n throw new up.NotImplemented();\n }\n improveHistoryValue(existingValue, newValue) {\n if ((existingValue === false) || u.isString(existingValue)) {\n return existingValue;\n }\n else {\n return newValue;\n }\n }\n deriveFailOptions() {\n return up.RenderOptions.deriveFailOptions(this.options);\n }\n};\n\n\n/***/ }),\n/* 24 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Change.Addition = class Addition extends up.Change {\n constructor(options) {\n super(options);\n this._acceptLayer = options.acceptLayer;\n this._dismissLayer = options.dismissLayer;\n this._eventPlans = options.eventPlans || [];\n this._response = options.response;\n }\n handleLayerChangeRequests() {\n if (this.layer.isOverlay()) {\n this._tryAcceptLayerFromServer();\n this.abortWhenLayerClosed();\n this.layer.tryAcceptForLocation(this._responseOptions());\n this.abortWhenLayerClosed();\n this._tryDismissLayerFromServer();\n this.abortWhenLayerClosed();\n this.layer.tryDismissForLocation(this._responseOptions());\n this.abortWhenLayerClosed();\n }\n this.layer.asCurrent(() => {\n for (let eventPlan of this._eventPlans) {\n up.emit({ ...eventPlan, ...this._responseOptions() });\n this.abortWhenLayerClosed();\n }\n });\n }\n _tryAcceptLayerFromServer() {\n if (u.isDefined(this._acceptLayer) && this.layer.isOverlay()) {\n this.layer.accept(this._acceptLayer, this._responseOptions());\n }\n }\n _tryDismissLayerFromServer() {\n if (u.isDefined(this._dismissLayer) && this.layer.isOverlay()) {\n this.layer.dismiss(this._dismissLayer, this._responseOptions());\n }\n }\n abortWhenLayerClosed(layer = this.layer) {\n if (layer.isClosed()) {\n throw new up.Aborted('Layer was closed');\n }\n }\n _setSource({ oldElement, newElement, source }) {\n if (source === 'keep') {\n source = (oldElement && up.fragment.source(oldElement));\n }\n if (source) {\n e.setMissingAttr(newElement, 'up-source', up.fragment.normalizeSource(source));\n }\n }\n _setTime({ newElement, time }) {\n e.setMissingAttr(newElement, 'up-time', time ? time.toUTCString() : false);\n }\n _setETag({ newElement, etag }) {\n e.setMissingAttr(newElement, 'up-etag', etag || false);\n }\n setReloadAttrs(options) {\n this._setSource(options);\n this._setTime(options);\n this._setETag(options);\n }\n _responseOptions() {\n return { response: this._response };\n }\n executeSteps(steps, responseDoc, noneOptions) {\n return new up.Change.UpdateSteps({ steps, noneOptions }).execute(responseDoc);\n }\n};\n\n\n/***/ }),\n/* 25 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.RenderJob = (_a = class RenderJob {\n constructor(options) {\n this.options = options;\n }\n execute() {\n this._rendered = this._executePromise();\n return this;\n }\n async _executePromise() {\n try {\n this._emitGuardEvent();\n this.options = up.RenderOptions.preprocess(this.options);\n up.browser.assertConfirmed(this.options);\n up.RenderOptions.assertContentGiven(this.options);\n let result = await this._getChange().execute();\n this._handleResult(result);\n return result;\n }\n catch (resultOrError) {\n this._handleResult(resultOrError) || this._handleError(resultOrError);\n throw resultOrError;\n }\n }\n _handleResult(result) {\n if (result instanceof up.RenderResult) {\n let { onRendered, onFinished } = result.options;\n if (!result.none)\n up.error.guard(() => onRendered?.(result));\n let guardedOnFinished = function (result) {\n up.error.guard(() => onFinished?.(result));\n };\n this.finished.then(guardedOnFinished, u.noop);\n return true;\n }\n }\n _handleError(error) {\n let prefix = error instanceof up.Aborted ? 'Rendering was aborted' : 'Error while rendering';\n up.puts('up.render()', `${prefix}: ${error.name}: ${error.message}`);\n up.error.guard(() => this.options.onError?.(error));\n }\n get finished() {\n return this._awaitFinished();\n }\n async _awaitFinished() {\n try {\n let result = await this._rendered;\n return await result.finished;\n }\n catch (error) {\n if (error instanceof up.RenderResult) {\n throw await error.finished;\n }\n else {\n throw error;\n }\n }\n }\n _getChange() {\n let handleAbort = u.memoize((request) => this._handleAbortOption(request));\n let renderOptions = { ...this.options, handleAbort };\n if (renderOptions.url) {\n return new up.Change.FromURL(renderOptions);\n }\n else if (renderOptions.response) {\n return new up.Change.FromResponse(renderOptions);\n }\n else {\n return new up.Change.FromContent(renderOptions);\n }\n }\n _emitGuardEvent() {\n let guardEvent = u.pluckKey(this.options, 'guardEvent');\n if (guardEvent) {\n guardEvent.renderOptions = this.options;\n if (up.emit(guardEvent, { target: this.options.origin }).defaultPrevented) {\n throw new up.Aborted(`Rendering was prevented by ${guardEvent.type} listener`);\n }\n }\n }\n _handleAbortOption(request) {\n let { abort } = this.options;\n if (!abort || !up.network.isBusy())\n return;\n let { bindFragments, bindLayer, origin, layer } = this._getChange().getPreflightProps();\n let abortOptions = {\n except: request,\n logOnce: ['up.render()', 'Change with { abort } option will abort other requests'],\n newLayer: (layer === 'new'),\n origin,\n };\n if (abort === 'target') {\n up.fragment.abort(bindFragments, { ...abortOptions });\n }\n else if (abort === 'layer') {\n up.fragment.abort({ ...abortOptions, layer: bindLayer });\n }\n else if (abort === 'all' || abort === true) {\n up.fragment.abort({ ...abortOptions, layer: 'any' });\n }\n else if (u.isFunction(abort)) {\n abort(abortOptions);\n }\n else {\n up.fragment.abort(abort, { ...abortOptions, layer: bindLayer });\n }\n }\n },\n (() => {\n u.delegatePromise(_a.prototype, function () { return this._rendered; });\n u.memoizeMethod(_a.prototype, {\n _awaitFinished: true,\n _getChange: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 26 */\n/***/ (() => {\n\nup.Change.DestroyFragment = class DestroyFragment extends up.Change {\n constructor(options) {\n super(options);\n this._layer = up.layer.get(options) || up.layer.current;\n this._element = this.options.element;\n this._animation = this.options.animation;\n this._log = this.options.log;\n this._onFinished = this.options.onFinished;\n }\n execute() {\n this._parent = this._element.parentNode;\n up.fragment.markAsDestroying(this._element);\n if (up.motion.willAnimate(this._element, this._animation, this.options)) {\n this._destroyAfterAnimation();\n }\n else {\n this._destroyNow();\n }\n }\n async _destroyAfterAnimation() {\n this._emitDestroyed();\n await this._animate();\n this._wipe();\n this._onFinished?.();\n }\n _destroyNow() {\n this._wipe();\n this._emitDestroyed();\n this._onFinished?.();\n }\n _animate() {\n return up.motion.animate(this._element, this._animation, this.options);\n }\n _wipe() {\n this._layer.asCurrent(() => {\n up.fragment.abort(this._element);\n up.script.clean(this._element, { layer: this._layer });\n up.element.cleanJQuery(this._element);\n this._element.remove();\n });\n }\n _emitDestroyed() {\n up.fragment.emitDestroyed(this._element, { parent: this._parent, log: this._log });\n }\n};\n\n\n/***/ }),\n/* 27 */\n/***/ (() => {\n\nlet u = up.util;\nup.Change.OpenLayer = class OpenLayer extends up.Change.Addition {\n constructor(options) {\n super(options);\n this.target = options.target;\n this._origin = options.origin;\n this._baseLayer = options.baseLayer;\n }\n getPreflightProps() {\n return {\n mode: this.options.mode,\n context: this._buildLayer().context,\n origin: this.options.origin,\n target: this.target,\n bindLayer: this._baseLayer,\n layer: 'new',\n bindFragments: u.compact([up.fragment.get(':main', { layer: this._baseLayer })]),\n fragments: [],\n };\n }\n execute(responseDoc, onApplicable) {\n this.responseDoc = responseDoc;\n this._matchPostflight();\n onApplicable();\n this._createOverlay();\n let unbindClosing = this.layer.on('up:layer:accepting up:layer:dimissing', this._renderOtherLayers.bind(this));\n try {\n this._renderOverlayContent();\n this._renderOtherLayers();\n return up.RenderResult.both(this._newOverlayResult, this._otherLayersResult);\n }\n finally {\n unbindClosing();\n }\n }\n _matchPostflight() {\n if (this.target === ':none') {\n this._content = document.createElement('up-none');\n }\n else {\n this._content = this.responseDoc.select(this.target);\n }\n if (!this._content || this._baseLayer.isClosed()) {\n throw new up.CannotMatch();\n }\n }\n _createOverlay() {\n up.puts('up.render()', `Opening element \"${this.target}\" in new overlay`);\n this._assertOpenEventEmitted();\n this.layer = this._buildLayer();\n this._baseLayer.peel({ history: !this.layer.history });\n up.layer.stack.push(this.layer);\n this.layer.createElements();\n this.layer.setupHandlers();\n }\n _renderOverlayContent() {\n this._handleHistory();\n this.handleLayerChangeRequests();\n this.responseDoc.commitElement(this._content);\n this.layer.setContent(this._content);\n this.setReloadAttrs({ newElement: this._content, source: this.options.source });\n this.responseDoc.finalizeElement(this._content);\n this._newOverlayResult = new up.RenderResult({\n layer: this.layer,\n fragments: [this._content],\n target: this.target,\n });\n up.hello(this.layer.element, { ...this.options, layer: this.layer, dataRoot: this._content });\n this._handleScroll();\n this._newOverlayResult.finished = this._finish();\n this.layer.opening = false;\n this._emitOpenedEvent();\n this.abortWhenLayerClosed();\n }\n _renderOtherLayers() {\n if (this._otherLayersResult)\n return;\n let otherLayerSteps = this._getHungrySteps().other;\n this._otherLayersResult = this.executeSteps(otherLayerSteps, this.responseDoc);\n }\n async _finish() {\n await this.layer.startOpenAnimation();\n this.abortWhenLayerClosed();\n this._handleFocus();\n return this._newOverlayResult;\n }\n _buildLayer() {\n const buildOptions = { ...this.options, opening: true };\n const beforeNew = optionsWithLayerDefaults => {\n return this.options = up.RenderOptions.finalize(optionsWithLayerDefaults);\n };\n return up.layer.build(buildOptions, beforeNew);\n }\n _handleHistory() {\n if (this.layer.history === 'auto') {\n this.layer.history = up.fragment.hasAutoHistory([this._content], this.layer);\n }\n let { parent } = this.layer;\n this.layer.history &&= parent.history;\n parent.saveHistory();\n this.layer.updateHistory(this.options);\n }\n _handleFocus() {\n this._baseLayer.overlayFocus?.moveToBack();\n this.layer.overlayFocus.moveToFront();\n const fragmentFocus = new up.FragmentFocus({\n fragment: this._content,\n layer: this.layer,\n autoMeans: ['autofocus', 'layer'],\n inputDevice: this.options.inputDevice,\n });\n fragmentFocus.process(this.options.focus);\n }\n _handleScroll() {\n const scrollingOptions = {\n ...this.options,\n fragment: this._content,\n layer: this.layer,\n autoMeans: ['hash', 'layer']\n };\n const scrolling = new up.FragmentScrolling(scrollingOptions);\n scrolling.process(this.options.scroll);\n }\n _assertOpenEventEmitted() {\n up.event.assertEmitted('up:layer:open', {\n origin: this._origin,\n baseLayer: this._baseLayer,\n layerOptions: this.options,\n log: \"Opening new overlay\"\n });\n }\n _emitOpenedEvent() {\n this.layer.emit('up:layer:opened', {\n origin: this._origin,\n callback: this.layer.callback('onOpened'),\n log: `Opened new ${this.layer}`\n });\n }\n _getHungrySteps() {\n return up.radio.hungrySteps(this._getEffectiveRenderOptions());\n }\n _getEffectiveRenderOptions() {\n return {\n ...this.options,\n layer: this.layer,\n history: this.layer.history,\n };\n }\n};\n\n\n/***/ }),\n/* 28 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.Change.UpdateLayer = (_a = class UpdateLayer extends up.Change.Addition {\n constructor(options) {\n options = up.RenderOptions.finalize(options);\n super(options);\n this.layer = options.layer;\n this.target = options.target;\n this._context = options.context;\n this._steps = up.fragment.parseTargetSteps(this.target, this.options);\n }\n getPreflightProps() {\n this._matchPreflight();\n let fragments = this._getFragments();\n return {\n layer: this.layer,\n bindLayer: this.layer,\n mode: this.layer.mode,\n context: u.merge(this.layer.context, this._context),\n origin: this.options.origin,\n target: this._bestPreflightSelector(),\n fragments,\n bindFragments: fragments,\n };\n }\n _bestPreflightSelector() {\n this._matchPreflight();\n return up.fragment.targetForSteps(this._steps);\n }\n _getFragments() {\n this._matchPreflight();\n return u.map(this._steps, 'oldElement');\n }\n execute(responseDoc, onApplicable) {\n this.responseDoc = responseDoc;\n this._matchPostflight();\n onApplicable();\n let unbindClosing = this.layer.on('up:layer:accepting up:layer:dimissing', this._renderOtherLayers.bind(this));\n try {\n this._renderCurrentLayer();\n this._renderOtherLayers();\n return up.RenderResult.both(this._currentLayerResult, this._otherLayersResult);\n }\n finally {\n unbindClosing();\n }\n }\n _renderCurrentLayer() {\n if (this._steps.length) {\n up.puts('up.render()', `Updating \"${this._bestPreflightSelector()}\" in ${this.layer}`);\n }\n this._setScrollAndFocusOptions();\n if (this.options.saveScroll) {\n up.viewport.saveScroll({ layer: this.layer });\n }\n if (this.options.saveFocus) {\n up.viewport.saveFocus({ layer: this.layer });\n }\n if (this.options.peel) {\n this.layer.peel({ history: !this._hasHistory() });\n }\n if (this.options.abort !== false) {\n up.fragment.abort(this._getFragments(), { reason: 'Fragment is being replaced' });\n }\n Object.assign(this.layer.context, this._context);\n if (this._hasHistory()) {\n this.layer.updateHistory(this.options);\n }\n this.handleLayerChangeRequests();\n this._currentLayerResult = this.executeSteps(this._steps, this.responseDoc, this.options);\n }\n _renderOtherLayers() {\n if (this._otherLayersResult)\n return;\n let otherLayerSteps = this._getHungrySteps().other;\n this._otherLayersResult = this.executeSteps(otherLayerSteps, this.responseDoc);\n }\n _matchPreflight() {\n this._matchOldElements();\n this._compressNestedSteps();\n }\n _matchPostflight() {\n this._matchOldElements();\n this._addHungryStepsOnCurrentLayer();\n this._compressNestedSteps();\n this._matchNewElements();\n }\n _addHungryStepsOnCurrentLayer() {\n this._steps.push(...this._getHungrySteps().current);\n }\n _matchOldElements() {\n this._steps = this._steps.filter((step) => {\n const finder = new up.FragmentFinder(u.pick(step, ['selector', 'origin', 'layer', 'match', 'preferOldElements']));\n step.oldElement ||= finder.find();\n if (step.oldElement) {\n return true;\n }\n else if (!step.maybe) {\n throw new up.CannotMatch();\n }\n });\n }\n _matchNewElements() {\n this._steps = this.responseDoc.selectSteps(this._steps);\n }\n _compressNestedSteps() {\n this._steps = up.fragment.compressNestedSteps(this._steps);\n }\n _getHungrySteps() {\n return up.radio.hungrySteps(this._getEffectiveRenderOptions());\n }\n _setScrollAndFocusOptions() {\n let focusCapsule = up.FocusCapsule.preserve(this.layer);\n this._steps.forEach((step, i) => {\n step.focusCapsule = focusCapsule;\n if (i > 0) {\n step.scroll = false;\n step.focus = false;\n }\n });\n }\n _hasHistory() {\n return u.evalAutoOption(this.options.history, this._hasAutoHistory.bind(this));\n }\n _hasAutoHistory() {\n const oldFragments = u.map(this._steps, 'oldElement');\n return up.fragment.hasAutoHistory(oldFragments, this.layer);\n }\n _getEffectiveRenderOptions() {\n return {\n ...this.options,\n layer: this.layer,\n history: this._hasHistory(),\n };\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _matchPreflight: true,\n _matchOldElements: true,\n _hasHistory: true,\n _getHungrySteps: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 29 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Change.UpdateSteps = class UpdateSteps extends up.Change.Addition {\n constructor(options) {\n super(options);\n this._noneOptions = options.noneOptions || {};\n this._steps = u.copy(options.steps);\n }\n execute(responseDoc) {\n this.responseDoc = responseDoc;\n this._steps = responseDoc.selectSteps(this._steps);\n this._steps = responseDoc.commitSteps(this._steps);\n if (!this._steps.length) {\n return this._executeNone();\n }\n this.renderResult = new up.RenderResult({\n layer: this._steps[0]?.layer,\n target: up.fragment.targetForSteps(this._steps),\n });\n this._steps.reverse();\n const motionEndPromises = this._steps.map(step => this._executeStep(step));\n this.renderResult.finished = this._finish(motionEndPromises);\n return this.renderResult;\n }\n _executeNone() {\n this._handleFocus(null, this._noneOptions);\n this._handleScroll(null, this._noneOptions);\n return up.RenderResult.buildNone();\n }\n async _finish(motionEndPromises) {\n await Promise.all(motionEndPromises);\n for (let step of this._steps) {\n this.abortWhenLayerClosed(step.layer);\n }\n return this.renderResult;\n }\n _addToResult(fragment) {\n let newFragments = fragment.matches('up-wrapper') ? fragment.children : [fragment];\n this.renderResult.fragments.unshift(...newFragments);\n }\n _executeStep(step) {\n this.setReloadAttrs(step);\n switch (step.placement) {\n case 'swap': {\n let keepPlan = this._findKeepPlan(step);\n if (keepPlan) {\n this._handleFocus(step.oldElement, step);\n this._handleScroll(step.oldElement, step);\n return Promise.resolve();\n }\n else {\n this._preserveKeepables(step);\n const parent = step.oldElement.parentNode;\n const morphOptions = {\n ...step,\n beforeStart() {\n up.fragment.markAsDestroying(step.oldElement);\n },\n afterInsert: () => {\n this._restoreKeepables(step);\n this.responseDoc.finalizeElement(step.newElement);\n this._unmarkKeepables(step);\n up.hello(step.newElement, step);\n this._addToResult(step.newElement);\n },\n beforeDetach: () => {\n up.script.clean(step.oldElement, { layer: step.layer });\n },\n afterDetach() {\n e.cleanJQuery();\n up.fragment.emitDestroyed(step.oldElement, { parent, log: false });\n },\n scrollNew: () => {\n this._handleFocus(step.newElement, step);\n this._handleScroll(step.newElement, step);\n }\n };\n return up.morph(step.oldElement, step.newElement, step.transition, morphOptions);\n }\n }\n case 'content': {\n let oldWrapper = e.wrapChildren(step.oldElement);\n let newWrapper = e.wrapChildren(step.newElement);\n let wrapperStep = {\n ...step,\n placement: 'swap',\n oldElement: oldWrapper,\n newElement: newWrapper,\n focus: false\n };\n return this._executeStep(wrapperStep).then(() => {\n e.unwrap(newWrapper);\n this._handleFocus(step.oldElement, step);\n });\n }\n case 'before':\n case 'after': {\n let wrapper = e.wrapChildren(step.newElement);\n let position = step.placement === 'before' ? 'afterbegin' : 'beforeend';\n step.oldElement.insertAdjacentElement(position, wrapper);\n this.responseDoc.finalizeElement(wrapper);\n up.hello(wrapper, step);\n this._addToResult(wrapper);\n this._handleFocus(wrapper, step);\n this._handleScroll(wrapper, step);\n return up.animate(wrapper, step.transition, step).then(() => e.unwrap(wrapper));\n }\n default: {\n up.fail('Unknown placement: %o', step.placement);\n }\n }\n }\n _findKeepPlan(options) {\n if (!options.keep) {\n return;\n }\n const { oldElement, newElement } = options;\n let doKeep = e.booleanAttr(oldElement, 'up-keep');\n if (!doKeep) {\n return;\n }\n let partner;\n let partnerSelector = up.fragment.toTarget(oldElement);\n const lookupOpts = { layer: options.layer };\n if (options.descendantsOnly) {\n partner = up.fragment.get(newElement, partnerSelector, lookupOpts);\n }\n else {\n partner = e.subtreeFirst(newElement, partnerSelector, lookupOpts);\n }\n if (partner && e.booleanAttr(partner, 'up-keep') !== false) {\n const plan = {\n oldElement,\n newElement: partner,\n newData: up.script.data(partner),\n renderOptions: options,\n };\n if (!up.fragment.emitKeep(plan).defaultPrevented) {\n return plan;\n }\n }\n }\n _preserveKeepables(step) {\n const keepPlans = [];\n if (step.keep) {\n for (let keepable of step.oldElement.querySelectorAll('[up-keep]')) {\n let keepPlan = this._findKeepPlan({ ...step, oldElement: keepable, descendantsOnly: true });\n if (keepPlan) {\n const keepableClone = keepable.cloneNode(true);\n keepable.insertAdjacentElement('beforebegin', keepableClone);\n keepable.classList.add('up-keeping');\n up.script.disableSubtree(keepPlan.newElement);\n let viewports = up.viewport.subtree(keepPlan.oldElement);\n keepPlan.revivers = viewports.map(function (viewport) {\n let cursorProps = up.viewport.copyCursorProps(viewport);\n return () => up.viewport.copyCursorProps(cursorProps, viewport);\n });\n if (this._willChangeElement(document.body)) {\n keepPlan.newElement.replaceWith(keepable);\n }\n else {\n document.body.append(keepable);\n }\n keepPlans.push(keepPlan);\n }\n }\n }\n step.keepPlans = keepPlans;\n }\n _restoreKeepables(step) {\n for (let keepPlan of step.keepPlans) {\n keepPlan.newElement.replaceWith(keepPlan.oldElement);\n for (let reviver of keepPlan.revivers) {\n reviver();\n }\n }\n }\n _unmarkKeepables(step) {\n for (let keepPlan of step.keepPlans) {\n keepPlan.oldElement.classList.remove('up-keeping');\n }\n }\n _willChangeElement(element) {\n return u.some(this._steps, (step) => step.oldElement.contains(element));\n }\n _handleFocus(fragment, options) {\n const fragmentFocus = new up.FragmentFocus({\n ...options,\n fragment,\n autoMeans: up.fragment.config.autoFocus,\n });\n return fragmentFocus.process(options.focus);\n }\n _handleScroll(fragment, options) {\n const scrolling = new up.FragmentScrolling({\n ...options,\n fragment,\n autoMeans: up.fragment.config.autoScroll\n });\n return scrolling.process(options.scroll);\n }\n};\n\n\n/***/ }),\n/* 30 */\n/***/ (() => {\n\nconst u = up.util;\nup.Change.CloseLayer = class CloseLayer extends up.Change {\n constructor(options) {\n super(options);\n this._verb = options.verb;\n this._layer = up.layer.get(options);\n this._origin = options.origin;\n this._value = options.value;\n this._preventable = options.preventable ?? true;\n this._response = options.response;\n this._history = options.history ?? true;\n }\n execute() {\n if (!this._layer.isOpen())\n return;\n up.browser.assertConfirmed(this.options);\n if (this._emitCloseEvent().defaultPrevented && this._preventable) {\n throw new up.Aborted('Close event was prevented');\n }\n this._emitClosingEvent();\n up.fragment.abort({ reason: 'Layer is closing', layer: this._layer });\n const { parent } = this._layer;\n this._layer.peel();\n this._layer.stack.remove(this._layer);\n if (this._history) {\n parent.restoreHistory();\n }\n this._handleFocus(parent);\n this._layer.teardownHandlers();\n this._layer.destroyElements(this.options);\n this._emitClosedEvent(parent);\n }\n _emitCloseEvent() {\n let event = this._layer.emit(this._buildEvent(`up:layer:${this._verb}`), {\n callback: this._layer.callback(`on${u.upperCaseFirst(this._verb)}`),\n log: [`Will ${this._verb} ${this._layer} with value %o`, this._value]\n });\n this._value = event.value;\n return event;\n }\n _emitClosingEvent() {\n let event = this._buildEvent(`up:layer:${this._verb}ing`);\n this._layer.emit(event, { log: false });\n }\n _emitClosedEvent(formerParent) {\n const verbPast = `${this._verb}ed`;\n const verbPastUpperCaseFirst = u.upperCaseFirst(verbPast);\n return this._layer.emit(this._buildEvent(`up:layer:${verbPast}`), {\n baseLayer: formerParent,\n callback: this._layer.callback(`on${verbPastUpperCaseFirst}`),\n ensureBubbles: true,\n log: [`${verbPastUpperCaseFirst} ${this._layer} with value %o`, this._value]\n });\n }\n _buildEvent(name) {\n return up.event.build(name, {\n layer: this._layer,\n value: this._value,\n origin: this._origin,\n response: this._response,\n });\n }\n _handleFocus(formerParent) {\n let hadFocus = this._layer.hasFocus();\n this._layer.overlayFocus.teardown();\n formerParent.overlayFocus?.moveToFront();\n if (hadFocus) {\n let newFocusElement = this._layer.origin || formerParent.element;\n up.focus(newFocusElement, { preventScroll: true });\n }\n }\n};\n\n\n/***/ }),\n/* 31 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.Change.FromURL = (_a = class FromURL extends up.Change {\n async execute() {\n let newPageReason = this._newPageReason();\n if (newPageReason) {\n up.puts('up.render()', newPageReason);\n up.network.loadPage(this.options);\n return u.unresolvablePromise();\n }\n let request = this.request = up.request(this._getRequestAttrs());\n this.options.onRequestKnown?.(request);\n if (this.options.preload)\n return request;\n this.options.handleAbort?.(request);\n request.runPreviews(this.options);\n return await u.always(request, responseOrError => this._onRequestSettled(responseOrError));\n }\n _newPageReason() {\n if (u.isCrossOrigin(this.options.url)) {\n return 'Loading cross-origin content in new page';\n }\n if (this.options.history && !up.browser.canPushState()) {\n return 'Loading content in new page to restore history support';\n }\n }\n _getRequestAttrs() {\n const successAttrs = this._preflightPropsForRenderOptions(this.options);\n const failAttrs = this._preflightPropsForRenderOptions(this.deriveFailOptions(), { optional: true });\n return {\n ...this.options,\n ...successAttrs,\n ...u.withRenamedKeys(failAttrs, up.fragment.failKey),\n };\n }\n getPreflightProps() {\n return this._getRequestAttrs();\n }\n _preflightPropsForRenderOptions(renderOptions, getPreflightPropsOptions) {\n const preflightChange = new up.Change.FromContent({ ...renderOptions, preflight: true });\n return preflightChange.getPreflightProps(getPreflightPropsOptions);\n }\n _onRequestSettled(response) {\n if (response instanceof up.Response) {\n return this._onRequestSettledWithResponse(response);\n }\n else {\n return this._onRequestSettledWithError(response);\n }\n }\n _onRequestSettledWithResponse(response) {\n return new up.Change.FromResponse({ ...this.options, response }).execute();\n }\n _onRequestSettledWithError(error) {\n if (error instanceof up.Offline) {\n this.request.emit('up:fragment:offline', {\n callback: this.options.onOffline,\n renderOptions: this.options,\n retry: (retryOptions) => up.render({ ...this.options, ...retryOptions }),\n log: ['Cannot load fragment from %s: %s', this.request.description, error.reason],\n });\n }\n throw error;\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _getRequestAttrs: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 32 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.Change.FromResponse = (_a = class FromResponse extends up.Change {\n constructor(options) {\n super(options);\n this._response = options.response;\n this._request = this._response.request;\n }\n execute() {\n if (up.fragment.config.skipResponse(this._loadedEventProps())) {\n this._skip();\n }\n else {\n this._request.assertEmitted('up:fragment:loaded', {\n ...this._loadedEventProps(),\n callback: this.options.onLoaded,\n log: ['Loaded fragment from %s', this._response.description],\n skip: () => this._skip()\n });\n }\n let fail = u.evalOption(this.options.fail, this._response) ?? !this._response.ok;\n if (fail) {\n throw this._updateContentFromResponse(this.deriveFailOptions());\n }\n return this._updateContentFromResponse(this.options);\n }\n _skip() {\n up.puts('up.render()', 'Skipping ' + this._response.description);\n this.options.target = ':none';\n this.options.failTarget = ':none';\n }\n _updateContentFromResponse(finalRenderOptions) {\n if (finalRenderOptions.failPrefixForced) {\n up.puts('up.render()', 'Rendering failed response using fail-prefixed options (https://unpoly.com/failed-responses)');\n }\n this._augmentOptionsFromResponse(finalRenderOptions);\n finalRenderOptions.meta = this._compilerPassMeta();\n let result = new up.Change.FromContent(finalRenderOptions).execute();\n result.finished = this.finish(result, finalRenderOptions);\n return result;\n }\n async finish(renderResult, originalRenderOptions) {\n renderResult = await renderResult.finished;\n if (up.fragment.shouldRevalidate(this._request, this._response, originalRenderOptions)) {\n renderResult = await this._revalidate(renderResult, originalRenderOptions);\n }\n return renderResult;\n }\n async _revalidate(renderResult, originalRenderOptions) {\n let inputTarget = originalRenderOptions.target;\n let effectiveTarget = renderResult.target;\n if (/:(before|after)/.test(inputTarget)) {\n up.warn('up.render()', 'Cannot revalidate cache when prepending/appending (target %s)', inputTarget);\n }\n else {\n up.puts('up.render()', 'Revalidating cached response for target \"%s\"', effectiveTarget);\n let verifyResult = await up.reload(effectiveTarget, {\n ...originalRenderOptions,\n ...up.RenderOptions.NO_MOTION,\n ...up.RenderOptions.NO_INPUT_INTERFERENCE,\n ...up.RenderOptions.NO_PREVIEWS,\n preferOldElements: renderResult.fragments,\n layer: renderResult.layer,\n onFinished: null,\n expiredResponse: this._response,\n preview: this._revalidatePreview(originalRenderOptions),\n abort: false,\n cache: false,\n background: true,\n });\n if (!verifyResult.none) {\n renderResult = verifyResult;\n }\n }\n return renderResult;\n }\n _revalidatePreview({ preview, revalidatePreview }) {\n if (revalidatePreview === true) {\n return preview;\n }\n else {\n return revalidatePreview;\n }\n }\n _loadedEventProps() {\n const { expiredResponse } = this.options;\n return {\n request: this._request,\n response: this._response,\n renderOptions: this.options,\n revalidating: !!expiredResponse,\n expiredResponse,\n };\n }\n _compilerPassMeta() {\n let meta = { revalidating: !!this.options.expiredResponse };\n up.migrate.processCompilerPassMeta?.(meta, this._response);\n return meta;\n }\n _augmentOptionsFromResponse(renderOptions) {\n const responseURL = this._response.url;\n let serverLocation = responseURL;\n let hash = this._request.hash;\n if (hash) {\n renderOptions.hash = hash;\n serverLocation += hash;\n }\n const isReloadable = (this._response.method === 'GET');\n if (isReloadable) {\n renderOptions.source = this.improveHistoryValue(renderOptions.source, responseURL);\n }\n else {\n renderOptions.source = this.improveHistoryValue(renderOptions.source, 'keep');\n renderOptions.history = !!renderOptions.location;\n }\n renderOptions.location = this.improveHistoryValue(renderOptions.location, serverLocation);\n renderOptions.title = this.improveHistoryValue(renderOptions.title, this._response.title);\n renderOptions.eventPlans = this._response.eventPlans;\n let serverTarget = this._response.target;\n if (serverTarget) {\n renderOptions.target = serverTarget;\n }\n renderOptions.acceptLayer = this._response.acceptLayer;\n renderOptions.dismissLayer = this._response.dismissLayer;\n renderOptions.document = this._response.text;\n if (this._response.none) {\n renderOptions.target = ':none';\n }\n renderOptions.context = u.merge(renderOptions.context, this._response.context);\n renderOptions.cspNonces = this._response.cspNonces;\n renderOptions.time ??= this._response.lastModified;\n renderOptions.etag ??= this._response.etag;\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _loadedEventProps: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 33 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.Change.FromContent = (_a = class FromContent extends up.Change {\n constructor(options) {\n super(options);\n this._origin = options.origin;\n this._preflight = options.preflight;\n this._layers = up.layer.getAll(options);\n }\n _getPlans() {\n let plans = [];\n this._filterLayers();\n this._improveOptionsFromResponseDoc();\n this._expandIntoPlans(plans, this._layers, this.options.target);\n this._expandIntoPlans(plans, this._layers, this.options.fallback);\n return plans;\n }\n _isRenderableLayer(layer) {\n return (layer === 'new') || layer.isOpen();\n }\n _filterLayers() {\n this._layers = u.filter(this._layers, this._isRenderableLayer);\n }\n _expandIntoPlans(plans, layers, targets) {\n for (let layer of layers) {\n for (let target of this._expandTargets(targets, layer)) {\n const props = { ...this.options, target, layer, defaultPlacement: this._defaultPlacement() };\n const change = layer === 'new' ? new up.Change.OpenLayer(props) : new up.Change.UpdateLayer(props);\n plans.push(change);\n }\n }\n }\n _expandTargets(targets, layer) {\n return up.fragment.expandTargets(targets, { layer, mode: this.options.mode, origin: this._origin });\n }\n execute() {\n if (this.options.preload) {\n return Promise.resolve();\n }\n return this._seekPlan(this._executePlan.bind(this)) || this._cannotMatchPostflightTarget();\n }\n _executePlan(matchedPlan) {\n let result = matchedPlan.execute(this._getResponseDoc(), this._onPlanApplicable.bind(this, matchedPlan));\n result.options = this.options;\n return result;\n }\n _isApplicablePlanError(error) {\n return !(error instanceof up.CannotMatch);\n }\n _onPlanApplicable(plan) {\n let primaryPlan = this._getPlans()[0];\n if (plan !== primaryPlan) {\n up.puts('up.render()', 'Could not match primary target \"%s\". Updating a fallback target \"%s\".', primaryPlan.target, plan.target);\n }\n let { assets } = this._getResponseDoc();\n if (assets) {\n up.script.assertAssetsOK(assets, plan.options);\n }\n this.options.handleAbort?.(null);\n }\n _getResponseDoc() {\n if (this._preflight)\n return;\n const docOptions = u.pick(this.options, [\n 'target',\n 'content',\n 'fragment',\n 'document',\n 'html',\n 'cspNonces',\n 'origin',\n 'data',\n ]);\n up.migrate.handleResponseDocOptions?.(docOptions);\n if (this._defaultPlacement() === 'content') {\n docOptions.target = this._firstExpandedTarget(docOptions.target);\n }\n return new up.ResponseDoc(docOptions);\n }\n _improveOptionsFromResponseDoc() {\n if (this._preflight)\n return;\n let responseDoc = this._getResponseDoc();\n if (this.options.fragment) {\n this.options.target ||= responseDoc.rootSelector();\n }\n this.options.title = this.improveHistoryValue(this.options.title, responseDoc.title);\n this.options.metaTags = this.improveHistoryValue(this.options.metaTags, responseDoc.metaTags);\n this.options.lang = this.improveHistoryValue(this.options.lang, responseDoc.lang);\n }\n _defaultPlacement() {\n if (!this.options.document && !this.options.fragment) {\n return 'content';\n }\n }\n _firstExpandedTarget(target) {\n let layer = this._layers[0] || up.layer.root;\n return this._expandTargets(target || ':main', layer)[0];\n }\n getPreflightProps(opts = {}) {\n const getPlanProps = plan => plan.getPreflightProps();\n return this._seekPlan(getPlanProps) || opts.optional || this._cannotMatchPreflightTarget();\n }\n _cannotMatchPreflightTarget() {\n this._cannotMatchTarget('Could not find target in current page');\n }\n _cannotMatchPostflightTarget() {\n this._cannotMatchTarget('Could not find common target in current page and response');\n }\n _cannotMatchTarget(reason) {\n if (this._getPlans().length) {\n const planTargets = u.uniq(u.map(this._getPlans(), 'target'));\n const humanizedLayerOption = up.layer.optionToString(this.options.layer);\n throw new up.CannotMatch([reason + \" (tried selectors %o in %s)\", planTargets, humanizedLayerOption]);\n }\n else if (this._layers.length === 0) {\n this._cannotMatchLayer();\n }\n else if (this.options.failPrefixForced) {\n throw new up.CannotMatch('No target selector given for failed responses (https://unpoly.com/failed-responses)');\n }\n else {\n throw new up.CannotMatch('No target selector given');\n }\n }\n _cannotMatchLayer() {\n throw new up.CannotMatch('Could not find a layer to render in. You may have passed an unmatchable layer reference, or a detached element.');\n }\n _seekPlan(fn) {\n for (let plan of this._getPlans()) {\n try {\n return fn(plan);\n }\n catch (error) {\n if (this._isApplicablePlanError(error)) {\n throw error;\n }\n }\n }\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _getPlans: true,\n _getResponseDoc: true,\n getPreflightProps: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 34 */\n/***/ (() => {\n\nconst u = up.util;\nup.CompilerPass = class CompilerPass {\n constructor(root, compilers, { layer, data, dataRoot, dataMap, meta }) {\n layer ||= up.layer.get(root) || up.layer.current;\n this._root = root;\n this._compilers = compilers;\n this._layer = layer;\n this._data = data;\n this._dataRoot = dataRoot || root;\n this._dataMap = dataMap;\n meta ||= {};\n meta.layer = layer;\n this._meta = meta;\n }\n run() {\n this._layer.asCurrent(() => {\n this.setCompileData();\n for (let compiler of this._compilers) {\n this._runCompiler(compiler);\n }\n });\n }\n setCompileData() {\n if (this._data) {\n this._dataRoot.upCompileData = this._data;\n }\n if (this._dataMap) {\n for (let selector in this._dataMap) {\n for (let match of this._select(selector)) {\n match.upCompileData = this._dataMap[selector];\n }\n }\n }\n }\n _runCompiler(compiler) {\n const matches = this._selectOnce(compiler);\n if (!matches.length) {\n return;\n }\n if (!compiler.isDefault) {\n up.puts('up.hello()', 'Compiling %d× \"%s\" on %s', matches.length, compiler.selector, this._layer);\n }\n if (compiler.batch) {\n this._compileBatch(compiler, matches);\n }\n else {\n for (let match of matches) {\n this._compileOneElement(compiler, match);\n }\n }\n return up.migrate.postCompile?.(matches, compiler);\n }\n _compileOneElement(compiler, element) {\n const compileArgs = [element];\n if (compiler.length !== 1) {\n const data = up.script.data(element);\n compileArgs.push(data, this._meta);\n }\n const result = this._applyCompilerFunction(compiler, element, compileArgs);\n up.destructor(element, result);\n }\n _compileBatch(compiler, elements) {\n const compileArgs = [elements];\n if (compiler.length !== 1) {\n const dataList = u.map(elements, up.script.data);\n compileArgs.push(dataList, this._meta);\n }\n const result = this._applyCompilerFunction(compiler, elements, compileArgs);\n if (result) {\n up.fail('Compilers with { batch: true } cannot return destructors');\n }\n }\n _applyCompilerFunction(compiler, elementOrElements, compileArgs) {\n return up.error.guard(() => compiler.apply(elementOrElements, compileArgs));\n }\n _select(selector) {\n return up.fragment.subtree(this._root, u.evalOption(selector), { layer: this._layer });\n }\n _selectOnce(compiler) {\n let matches = this._select(compiler.selector);\n return u.filter(matches, (element) => {\n let appliedCompilers = (element.upAppliedCompilers ||= new Set());\n if (!appliedCompilers.has(compiler)) {\n appliedCompilers.add(compiler);\n return true;\n }\n });\n }\n};\n\n\n/***/ }),\n/* 35 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.CSSTransition = class CSSTransition {\n constructor(element, lastFrame, options) {\n this._element = element;\n this._lastFrame = lastFrame;\n this._lastFrameKeys = Object.keys(this._lastFrame);\n this._finishEvent = options.finishEvent;\n this._duration = options.duration;\n this._easing = options.easing;\n this._finished = false;\n }\n start() {\n if (this._lastFrameKeys.length === 0) {\n this._finished = true;\n return Promise.resolve();\n }\n this._deferred = u.newDeferred();\n this._pauseOldTransition();\n this._startTime = new Date();\n this._startFallbackTimer();\n this._listenToFinishEvent();\n this._listenToTransitionEnd();\n this._startMotion();\n return this._deferred;\n }\n _listenToFinishEvent() {\n if (this._finishEvent) {\n this._stopListenToFinishEvent = up.on(this._element, this._finishEvent, this._onFinishEvent.bind(this));\n }\n }\n _onFinishEvent(event) {\n event.stopPropagation();\n this._finish();\n }\n _startFallbackTimer() {\n const timingTolerance = 100;\n this._fallbackTimer = u.timer((this._duration + timingTolerance), () => this._finish());\n }\n _stopFallbackTimer() {\n clearTimeout(this._fallbackTimer);\n }\n _listenToTransitionEnd() {\n this._stopListenToTransitionEnd = up.on(this._element, 'transitionend', this._onTransitionEnd.bind(this));\n }\n _onTransitionEnd(event) {\n if (event.target !== this._element) {\n return;\n }\n const elapsed = new Date() - this._startTime;\n if (elapsed <= (0.25 * this._duration)) {\n return;\n }\n const completedProperty = event.propertyName;\n if (u.contains(this._lastFrameKeys, completedProperty)) {\n this._finish();\n }\n }\n _finish() {\n if (this._finished) {\n return;\n }\n this._finished = true;\n this._stopFallbackTimer();\n this._stopListenToFinishEvent?.();\n this._stopListenToTransitionEnd?.();\n e.concludeCSSTransition(this._element);\n this._resumeOldTransition();\n this._deferred.resolve();\n }\n _pauseOldTransition() {\n const oldTransition = e.style(this._element, [\n 'transition-property',\n 'transition-duration',\n 'transition-delay',\n 'transition-timing-function'\n ]);\n if (e.hasCSSTransition(oldTransition)) {\n if (oldTransition['transition-property'] !== 'all') {\n const oldTransitionProperties = oldTransition['transition-property'].split(/\\s*,\\s*/);\n const oldTransitionFrame = e.style(this._element, oldTransitionProperties);\n this._setOldTransitionTargetFrame = e.setStyleTemp(this._element, oldTransitionFrame);\n }\n this._setOldTransition = e.concludeCSSTransition(this._element);\n }\n }\n _resumeOldTransition() {\n this._setOldTransitionTargetFrame?.();\n this._setOldTransition?.();\n }\n _startMotion() {\n e.setStyle(this._element, {\n 'transition-property': this._lastFrameKeys.join(),\n 'transition-duration': `${this._duration}ms`,\n 'transition-timing-function': this._easing\n });\n e.setStyle(this._element, this._lastFrame);\n }\n};\n\n\n/***/ }),\n/* 36 */\n/***/ (() => {\n\nconst u = up.util;\nup.DestructorPass = class DestructorPass {\n constructor(fragment, options) {\n this._fragment = fragment;\n this._options = options;\n }\n run() {\n for (let cleanable of this._selectCleanables()) {\n let registry = u.pluckKey(cleanable, 'upDestructors');\n registry?.clean(cleanable);\n }\n }\n _selectCleanables() {\n const selectOptions = { ...this._options, destroying: true };\n return up.fragment.subtree(this._fragment, '.up-can-clean', selectOptions);\n }\n};\n\n\n/***/ }),\n/* 37 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.EventEmitter = class EventEmitter extends up.Record {\n keys() {\n return [\n 'target',\n 'event',\n 'baseLayer',\n 'callback',\n 'log',\n 'ensureBubbles',\n ];\n }\n emit() {\n this._logEmission();\n if (this.baseLayer) {\n this.baseLayer.asCurrent(() => this._dispatchEvent());\n }\n else {\n this._dispatchEvent();\n }\n return this.event;\n }\n _dispatchEvent() {\n this.target.dispatchEvent(this.event);\n if (this.ensureBubbles && !this.target.isConnected) {\n document.dispatchEvent(this.event);\n }\n up.error.guard(() => this.callback?.(this.event));\n }\n assertEmitted() {\n const event = this.emit();\n if (event.defaultPrevented) {\n throw new up.Aborted(`Event ${event.type} was prevented`);\n }\n }\n _logEmission() {\n if (!up.log.config.enabled) {\n return;\n }\n let message = this.log;\n let messageArgs;\n if (u.isArray(message)) {\n [message, ...messageArgs] = message;\n }\n else {\n messageArgs = [];\n }\n const { type } = this.event;\n if (u.isString(message)) {\n up.puts(type, message, ...messageArgs);\n }\n else if (message !== false) {\n up.puts(type, `Event ${type}`);\n }\n }\n static fromEmitArgs(args, defaults = {}) {\n let options = u.extractOptions(args);\n options = u.merge(defaults, options);\n if (u.isElementLike(args[0])) {\n options.target = e.get(args.shift());\n }\n else if (args[0] instanceof up.Layer) {\n options.layer = args.shift();\n }\n let layer;\n if (u.isGiven(options.layer)) {\n layer = up.layer.get(options.layer);\n options.target ||= layer.element;\n options.baseLayer ||= layer;\n }\n if (options.baseLayer) {\n options.baseLayer = up.layer.get(options.baseLayer);\n }\n if (u.isString(options.target)) {\n options.target = up.fragment.get(options.target, { layer: options.layer });\n }\n else if (!options.target) {\n options.target = document;\n }\n if (args[0]?.preventDefault) {\n options.event = args[0];\n options.log ??= args[0].log;\n }\n else if (u.isString(args[0])) {\n options.event = up.event.build(args[0], options);\n }\n else {\n options.event = up.event.build(options);\n }\n return new (this)(options);\n }\n};\n\n\n/***/ }),\n/* 38 */\n/***/ (() => {\n\nconst u = up.util;\nup.EventListener = class EventListener extends up.Record {\n keys() {\n return [\n 'element',\n 'eventType',\n 'selector',\n 'callback',\n 'guard',\n 'baseLayer',\n 'passive',\n 'once',\n 'capture',\n 'beforeBoot',\n ];\n }\n constructor(attributes) {\n super(attributes);\n this._key = this.constructor._buildKey(attributes);\n this.isDefault = up.framework.evaling;\n this.beforeBoot ??= (this.eventType.indexOf('up:framework:') === 0);\n this.nativeCallback = this.nativeCallback.bind(this);\n }\n bind() {\n const map = (this.element.upEventListeners ||= {});\n if (map[this._key]) {\n up.fail('up.on(): The %o callback %o cannot be registered more than once', this.eventType, this.callback);\n }\n map[this._key] = this;\n this.element.addEventListener(...this._addListenerArg());\n }\n _addListenerArg() {\n let options = u.compactObject(u.pick(this, ['once', 'passive', 'capture']));\n return [this.eventType, this.nativeCallback, options];\n }\n unbind() {\n let map = this.element.upEventListeners;\n if (map) {\n delete map[this._key];\n }\n this.element.removeEventListener(...this._addListenerArg());\n }\n nativeCallback(event) {\n if (up.framework.beforeBoot && !this.beforeBoot) {\n return;\n }\n let element = event.target;\n if (this.selector) {\n element = element.closest(u.evalOption(this.selector));\n }\n if (this.guard && !this.guard(event)) {\n return;\n }\n if (element) {\n const args = [event, element];\n const expectedArgCount = this.callback.length;\n if (expectedArgCount !== 1 && expectedArgCount !== 2) {\n const data = up.script.data(element);\n args.push(data);\n }\n if (this.eventType === 'click' && element.disabled) {\n return;\n }\n const applyCallback = this.callback.bind(element, ...args);\n if (this.baseLayer) {\n this.baseLayer.asCurrent(applyCallback);\n }\n else {\n applyCallback();\n }\n }\n }\n static fromElement(attributes) {\n let map = attributes.element.upEventListeners;\n if (map) {\n const key = this._buildKey(attributes);\n return map[key];\n }\n }\n static _buildKey(attributes) {\n attributes.callback.upUid ||= u.uid();\n return [\n attributes.eventType,\n attributes.selector,\n attributes.callback.upUid\n ].join('|');\n }\n static allNonDefault(element) {\n let map = element.upEventListeners;\n if (map) {\n const listeners = Object.values(map);\n return u.reject(listeners, 'isDefault');\n }\n else {\n return [];\n }\n }\n};\n\n\n/***/ }),\n/* 39 */\n/***/ (() => {\n\nconst u = up.util;\nup.EventListenerGroup = class EventListenerGroup extends up.Record {\n keys() {\n return [\n 'elements',\n 'eventTypes',\n 'selector',\n 'callback',\n 'guard',\n 'baseLayer',\n 'passive',\n 'once',\n 'capture',\n 'beforeBoot',\n ];\n }\n bind() {\n const cleaner = u.cleaner();\n this._eachListenerAttributes(function (attrs) {\n const listener = new up.EventListener(attrs);\n listener.bind();\n return cleaner(listener.unbind.bind(listener));\n });\n return cleaner.clean;\n }\n _eachListenerAttributes(fn) {\n for (let element of this.elements) {\n for (let eventType of this.eventTypes) {\n fn(this._listenerAttributes(element, eventType));\n }\n }\n }\n _listenerAttributes(element, eventType) {\n return { ...this.attributes(), element, eventType };\n }\n unbind() {\n this._eachListenerAttributes(function (attrs) {\n let listener = up.EventListener.fromElement(attrs);\n if (listener) {\n listener.unbind();\n }\n });\n }\n static fromBindArgs(args, defaults) {\n args = u.copy(args);\n const callback = args.pop();\n let elements;\n if (args[0].addEventListener) {\n elements = [args.shift()];\n }\n else if (u.isJQuery(args[0]) || (u.isList(args[0]) && args[0][0].addEventListener)) {\n elements = args.shift();\n }\n else {\n elements = [document];\n }\n let eventTypes = u.getSimpleTokens(args.shift());\n let fixTypes = up.migrate.fixEventTypes;\n if (fixTypes) {\n eventTypes = fixTypes(eventTypes);\n }\n const options = u.extractOptions(args);\n const selector = args[0];\n const attributes = { elements, eventTypes, selector, callback, ...options, ...defaults };\n return new (this)(attributes);\n }\n};\n\n\n/***/ }),\n/* 40 */\n/***/ (() => {\n\nconst u = up.util;\nup.FieldWatcher = class FieldWatcher {\n constructor(root, options, callback) {\n this._options = options;\n this._root = root;\n this._scope = up.form.getScope(root);\n this._callback = callback;\n this._batch = options.batch;\n }\n start() {\n this._scheduledValues = null;\n this._processedValues = this._readFieldValues();\n this._currentTimer = null;\n this._callbackRunning = false;\n this._cleaner = u.cleaner();\n this._watchFieldsWithin(this._root);\n this._root.addEventListener('up:fragment:inserted', ({ target }) => {\n if (target !== this._root)\n this._watchFieldsWithin(target);\n });\n this._cleaner(up.fragment.onAborted(this._scope, () => this._abort()));\n this._cleaner(up.on(this._scope, 'reset', () => this._onFormReset()));\n }\n stop() {\n this._abort();\n this._cleaner.clean();\n }\n _fieldOptions(field) {\n let rootOptions = u.copy(this._options);\n return up.form.watchOptions(field, rootOptions, { defaults: { event: 'input' } });\n }\n _watchFieldsWithin(container) {\n for (let field of up.form.fields(container)) {\n this._watchField(field);\n }\n }\n _watchField(field) {\n let fieldOptions = this._fieldOptions(field);\n this._cleaner(up.on(field, fieldOptions.event, () => this._check(fieldOptions)));\n }\n _abort() {\n this._scheduledValues = null;\n }\n _scheduleValues(values, fieldOptions) {\n this._scheduledValues = values;\n this._scheduledFieldOptions = fieldOptions;\n let delay = fieldOptions.delay || 0;\n clearTimeout(this._currentTimer);\n this._currentTimer = u.timer(delay, () => {\n this._currentTimer = null;\n this._requestCallback();\n });\n }\n _isNewValues(values) {\n return !u.isEqual(values, this._processedValues) && !u.isEqual(this._scheduledValues, values);\n }\n async _requestCallback() {\n if (!this._scheduledValues)\n return;\n if (this._callbackRunning)\n return;\n if (this._currentTimer)\n return;\n if (!this._scope.isConnected)\n return;\n let callbackOptions = u.omit(this._scheduledFieldOptions, ['event', 'delay']);\n const diff = this._changedValues(this._processedValues, this._scheduledValues);\n this._processedValues = this._scheduledValues;\n this._scheduledValues = null;\n this._callbackRunning = true;\n this._scheduledFieldOptions = null;\n const callbackReturnValues = [];\n if (this._batch) {\n callbackReturnValues.push(this._runCallback(diff, callbackOptions));\n }\n else {\n for (let name in diff) {\n const value = diff[name];\n callbackReturnValues.push(this._runCallback(value, name, callbackOptions));\n }\n }\n if (u.some(callbackReturnValues, u.isPromise)) {\n let callbackDone = Promise.allSettled(callbackReturnValues);\n await callbackDone;\n }\n this._callbackRunning = false;\n this._requestCallback();\n }\n _runCallback(...args) {\n return up.error.guard(this._callback, ...args);\n }\n _changedValues(previous, next) {\n const changes = {};\n let keys = Object.keys(previous);\n keys = keys.concat(Object.keys(next));\n keys = u.uniq(keys);\n for (let key of keys) {\n const previousValue = previous[key];\n const nextValue = next[key];\n if (!u.isEqual(previousValue, nextValue)) {\n changes[key] = nextValue;\n }\n }\n return changes;\n }\n _readFieldValues() {\n return up.Params.fromContainer(this._root).toObject();\n }\n _check(fieldOptions = {}) {\n const values = this._readFieldValues();\n if (this._isNewValues(values)) {\n this._scheduleValues(values, fieldOptions);\n }\n }\n _onFormReset() {\n u.task(() => this._check());\n }\n};\n\n\n/***/ }),\n/* 41 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.FormValidator = class FormValidator {\n constructor(form) {\n this._form = form;\n this._dirtySolutions = [];\n this._nextRenderTimer = null;\n this._rendering = false;\n this._resetNextRenderPromise();\n this._honorAbort();\n }\n _honorAbort() {\n up.fragment.onAborted(this._form, (event) => this._onAborted(event));\n }\n _onAborted(event) {\n if (this._dirtySolutions.length) {\n this._dirtySolutions = [];\n this._nextRenderPromise.reject(new up.Aborted(event.reason));\n this._resetNextRenderPromise();\n }\n }\n _resetNextRenderPromise() {\n this._nextRenderPromise = u.newDeferred();\n }\n watchContainer(fieldOrForm) {\n let { event } = this._originOptions(fieldOrForm);\n let guard = () => up.fragment.isAlive(fieldOrForm);\n let callback = () => up.error.muteUncriticalRejection(this.validate({ origin: fieldOrForm }));\n up.on(fieldOrForm, event, { guard }, callback);\n }\n validate(options = {}) {\n let solutions = this._getSolutions(options);\n this._dirtySolutions.push(...solutions);\n this._scheduleNextRender();\n return this._nextRenderPromise;\n }\n _getSolutions(options) {\n let solutions = this._getTargetSelectorSolutions(options)\n || this._getFieldSolutions(options)\n || this._getElementSolutions(options.origin);\n for (let solution of solutions) {\n solution.renderOptions = this._originOptions(solution.origin, options);\n solution.target = up.fragment.resolveOrigin(solution.target, solution);\n }\n return solutions;\n }\n _getFieldSolutions({ origin, ...options }) {\n if (up.form.isField(origin)) {\n return this._getValidateAttrSolutions(origin) || this._getFormGroupSolutions(origin, options);\n }\n }\n _getFormGroupSolutions(field, { formGroup = true }) {\n if (!formGroup)\n return;\n let solution = up.form.groupSolution(field);\n if (solution) {\n up.puts('up.validate()', 'Validating form group of field %o', field);\n return [solution];\n }\n }\n _getTargetSelectorSolutions({ target, origin }) {\n if (u.isString(target)) {\n up.puts('up.validate()', 'Validating target \"%s\"', target);\n let simpleSelectors = up.fragment.splitTarget(target);\n return u.compact(simpleSelectors.map(function (simpleSelector) {\n let element = up.fragment.get(simpleSelector, { origin });\n if (element) {\n return {\n element,\n target: simpleSelector,\n origin\n };\n }\n else {\n up.fail('Validation target \"%s\" does not match an element', simpleSelector);\n }\n }));\n }\n }\n _getElementSolutions(element) {\n up.puts('up.validate()', 'Validating element %o', element);\n return [{\n element,\n target: up.fragment.toTarget(element),\n origin: element\n }];\n }\n _getValidateAttrSolutions(field) {\n let containerWithAttr = field.closest('[up-validate]');\n if (containerWithAttr) {\n let target = e.booleanOrStringAttr(containerWithAttr, 'up-validate');\n return this._getTargetSelectorSolutions({ target, origin: field });\n }\n }\n _originOptions(element, overrideOptions) {\n return up.form.watchOptions(element, overrideOptions, { defaults: { event: 'change' } });\n }\n _scheduleNextRender() {\n let solutionDelays = this._dirtySolutions.map((solution) => solution.renderOptions.delay);\n let shortestDelay = Math.min(...solutionDelays) || 0;\n clearTimeout(this._nextRenderTimer);\n this._nextRenderTimer = u.timer(shortestDelay, () => {\n this._nextRenderTimer = null;\n this._renderDirtySolutions();\n });\n }\n _renderDirtySolutions() {\n up.error.muteUncriticalRejection(this._doRenderDirtySolutions());\n }\n async _doRenderDirtySolutions() {\n if (!this._dirtySolutions.length)\n return;\n if (this._rendering)\n return;\n if (this._nextRenderTimer)\n return;\n let options = this._mergeRenderOptions(this._dirtySolutions);\n this._dirtySolutions = [];\n this._rendering = true;\n let renderingPromise = this._nextRenderPromise;\n this._resetNextRenderPromise();\n try {\n renderingPromise.resolve(up.render(options));\n await renderingPromise;\n }\n finally {\n this._rendering = false;\n this._renderDirtySolutions();\n }\n }\n _mergeRenderOptions(dirtySolutions) {\n let dirtyOrigins = u.map(dirtySolutions, 'origin');\n let dirtyFields = u.flatMap(dirtyOrigins, up.form.fields);\n let dirtyNames = u.uniq(u.map(dirtyFields, 'name'));\n let dirtyRenderOptionsList = u.map(dirtySolutions, 'renderOptions');\n let options = u.mergeDefined(...dirtyRenderOptionsList, up.form.destinationOptions(this._form));\n options.target = u.map(dirtySolutions, 'target').join(', ');\n options.origin = this._form;\n options.focus ??= 'keep';\n options.failOptions = false;\n options.defaultMaybe = true;\n options.params = up.Params.merge(options.params, ...u.map(dirtyRenderOptionsList, 'params'));\n options.headers = u.merge(options.headers, ...u.map(dirtyRenderOptionsList, 'headers'));\n this._addValidateHeader(options.headers, dirtyNames);\n options.feedback = u.some(dirtyRenderOptionsList, 'feedback');\n options.data = undefined;\n options.dataMap = u.mapObject(dirtySolutions, ({ target, element, renderOptions: { data, keepData } }) => [\n target,\n keepData ? up.data(element) : data\n ]);\n options.preview = undefined;\n options.previewMap = u.mapObject(dirtySolutions, ({ target, renderOptions: { preview } }) => [target, preview]);\n options.placeholder = undefined;\n options.placeholderMap = u.mapObject(dirtySolutions, ({ target, renderOptions: { placeholder } }) => [target, placeholder]);\n options.disable = dirtySolutions.map((solution) => up.fragment.resolveOrigin(solution.renderOptions.disable, solution));\n options.guardEvent = up.event.build('up:form:validate', {\n fields: dirtyFields,\n log: 'Validating form',\n params: options.params,\n form: this._form,\n });\n return options;\n }\n _addValidateHeader(headers, names) {\n let key = up.protocol.headerize('validate');\n let value = names.join(' ');\n if (!value || value.length > up.protocol.config.maxHeaderSize)\n value = ':unknown';\n headers[key] = value;\n }\n static forElement(element) {\n let form = up.form.get(element);\n return form.upFormValidator ||= new this(form);\n }\n};\n\n\n/***/ }),\n/* 42 */\n/***/ (() => {\n\nup.FocusCapsule = class FocusCapsule {\n constructor(element, target) {\n this._element = element;\n this._target = target;\n this._cursorProps = up.viewport.copyCursorProps(this._element);\n }\n wasLost() {\n return document.activeElement !== this._element && !this._voided;\n }\n autoVoid() {\n up.on('focusin', { once: true }, () => this._voided = true);\n }\n restore(layer, focusOptions) {\n if (!this.wasLost()) {\n return false;\n }\n let rediscoveredElement = up.fragment.get(this._target, { layer });\n if (rediscoveredElement) {\n up.viewport.copyCursorProps(this._cursorProps, rediscoveredElement);\n up.focus(rediscoveredElement, focusOptions);\n return true;\n }\n }\n static preserve(layer) {\n let focusedElement = up.viewport.focusedElementWithin(layer.element);\n if (!focusedElement)\n return;\n let target = up.fragment.tryToTarget(focusedElement);\n if (!target)\n return;\n return new this(focusedElement, target);\n }\n};\n\n\n/***/ }),\n/* 43 */\n/***/ (() => {\n\nconst u = up.util;\nup.FragmentProcessor = class FragmentProcessor extends up.Record {\n keys() {\n return [\n 'fragment',\n 'autoMeans',\n 'origin',\n 'layer'\n ];\n }\n process(opt) {\n let preprocessed = this.preprocess(opt);\n return this.tryProcess(preprocessed);\n }\n preprocess(opt) {\n return u.getComplexTokens(opt);\n }\n tryProcess(opt) {\n if (u.isArray(opt)) {\n return this.processArray(opt);\n }\n if (u.isFunction(opt)) {\n let result = up.error.guard(opt, this.fragment, this.attributes());\n return this.tryProcess(result);\n }\n if (u.isElement(opt)) {\n return this.processElement(opt);\n }\n if (u.isString(opt)) {\n if (opt === 'auto') {\n return this.tryProcess(this.autoMeans);\n }\n let match = opt.match(/^(.+?)-if-(.+?)$/);\n if (match) {\n return this.resolveCondition(match[2]) && this.process(match[1]);\n }\n }\n return this.processPrimitive(opt);\n }\n processArray(array) {\n return u.find(array, opt => this.tryProcess(opt));\n }\n resolveCondition(condition) {\n if (condition === 'main') {\n return this.fragment && up.fragment.contains(this.fragment, ':main');\n }\n }\n findSelector(selector) {\n const lookupOpts = { layer: this.layer, origin: this.origin };\n let matchWithinFragment = this.fragment && up.fragment.get(this.fragment, selector, lookupOpts);\n let match = matchWithinFragment || up.fragment.get(selector, lookupOpts);\n if (match) {\n return match;\n }\n else {\n up.warn('up.render()', 'Could not find an element matching \"%s\"', selector);\n }\n }\n};\n\n\n/***/ }),\n/* 44 */\n/***/ (() => {\n\nconst u = up.util;\nconst DESCENDANT_SELECTOR = /^([^ >+(]+) (.+)$/;\nup.FragmentFinder = class FragmentFinder {\n constructor(options) {\n this._options = options;\n this._origin = options.origin;\n this._selector = options.selector;\n this._document = options.document || window.document;\n this._match = options.match ?? up.fragment.config.match;\n this._preferOldElements = options.preferOldElements;\n }\n find() {\n return this._findInPreferredElements() || this._findInRegion() || this._findFirst();\n }\n _findInPreferredElements() {\n if (this._preferOldElements) {\n return this._preferOldElements.find((preferOldElement) => this._document.contains(preferOldElement) && up.fragment.matches(preferOldElement, this._selector));\n }\n }\n _findInRegion() {\n if (this._match === 'region' && !up.fragment.containsMainPseudo(this._selector) && this._origin?.isConnected) {\n return this._findClosest() || this._findDescendantInRegion();\n }\n }\n _findClosest() {\n return up.fragment.closest(this._origin, this._selector, this._options);\n }\n _findDescendantInRegion() {\n let simpleSelectors = up.fragment.splitTarget(this._selector);\n return u.findResult(simpleSelectors, (simpleSelector) => {\n let parts = simpleSelector.match(DESCENDANT_SELECTOR);\n if (parts) {\n let parent = up.fragment.closest(this._origin, parts[1], this._options);\n if (parent) {\n return up.fragment.getFirstDescendant(parent, parts[2]);\n }\n }\n });\n }\n _findFirst() {\n return up.fragment.getFirstDescendant(this._document, this._selector, this._options);\n }\n};\n\n\n/***/ }),\n/* 45 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nconst PREVENT_SCROLL_OPTIONS = { preventScroll: true };\nup.FragmentFocus = class FragmentFocus extends up.FragmentProcessor {\n keys() {\n return super.keys().concat([\n 'hash',\n 'focusCapsule',\n 'inputDevice',\n ]);\n }\n processPrimitive(opt) {\n switch (opt) {\n case 'keep':\n return this._restoreLostFocus();\n case 'restore':\n return this._restorePreviousFocusForLocation();\n case 'target':\n case true:\n return this._focusElement(this.fragment);\n case 'layer':\n return this._focusElement(this.layer.getFocusElement());\n case 'main':\n return this._focusSelector(':main');\n case 'hash':\n return this._focusHash();\n case 'autofocus':\n return this._autofocus();\n default:\n if (u.isString(opt)) {\n return this._focusSelector(opt);\n }\n }\n }\n processElement(element) {\n return this._focusElement(element);\n }\n resolveCondition(condition) {\n if (condition === 'lost') {\n return this._wasFocusLost();\n }\n else {\n return super.resolveCondition(condition);\n }\n }\n _focusSelector(selector) {\n let match = this.findSelector(selector);\n return this._focusElement(match);\n }\n _restoreLostFocus() {\n return this.focusCapsule?.restore(this.layer, PREVENT_SCROLL_OPTIONS);\n }\n _restorePreviousFocusForLocation() {\n return up.viewport.restoreFocus({ layer: this.layer });\n }\n _autofocus() {\n let autofocusElement = this.fragment && e.subtreeFirst(this.fragment, '[autofocus]');\n if (autofocusElement) {\n return this._focusElement(autofocusElement);\n }\n }\n _focusElement(element) {\n if (element) {\n up.focus(element, { force: true, ...PREVENT_SCROLL_OPTIONS, inputDevice: this.inputDevice });\n return true;\n }\n }\n _focusHash() {\n let hashTarget = up.viewport.firstHashTarget(this.hash, { layer: this.layer });\n if (hashTarget) {\n return this._focusElement(hashTarget);\n }\n }\n _wasFocusLost() {\n return this.focusCapsule?.wasLost();\n }\n};\n\n\n/***/ }),\n/* 46 */\n/***/ (() => {\n\nconst e = up.element;\nup.FragmentPolling = class FragmentPolling {\n constructor(fragment) {\n this._options = up.radio.pollOptions(fragment);\n this._fragment = fragment;\n up.destructor(fragment, this._onFragmentDestroyed.bind(this));\n up.fragment.onAborted(fragment, this._onFragmentAborted.bind(this));\n this._state = 'initialized';\n this._abortable = true;\n this._loading = false;\n this._satisfyInterval();\n }\n static forFragment(fragment) {\n return fragment.upPolling ||= new this(fragment);\n }\n onPollAttributeObserved() {\n this._start();\n }\n _onFragmentDestroyed() {\n this._stop();\n }\n _start(options) {\n Object.assign(this._options, options);\n if (this._state !== 'started') {\n if (!up.fragment.isTargetable(this._fragment)) {\n up.warn('[up-poll]', 'Cannot poll untargetable fragment %o', this._fragment);\n return;\n }\n this._state = 'started';\n this._ensureEventsBound();\n this._scheduleRemainingTime();\n }\n }\n _stop() {\n if (this._state === 'started') {\n this._clearReloadTimer();\n this._state = 'stopped';\n this.unbindEvents?.();\n }\n }\n forceStart(options) {\n Object.assign(this._options, options);\n this.forceStarted = true;\n this._start();\n }\n forceStop() {\n this._stop();\n this.forceStarted = false;\n }\n _ensureEventsBound() {\n if (!this.unbindEvents) {\n this.unbindEvents = up.on('visibilitychange up:layer:opened up:layer:dismissed up:layer:accepted', this._onVisibilityChange.bind(this));\n }\n }\n _onVisibilityChange() {\n if (this._isFragmentVisible()) {\n this._scheduleRemainingTime();\n }\n else {\n }\n }\n _isFragmentVisible() {\n return (!document.hidden) &&\n (this._options.ifLayer === 'any' || this._isOnFrontLayer());\n }\n _clearReloadTimer() {\n clearTimeout(this._reloadTimer);\n this._reloadTimer = null;\n }\n _scheduleRemainingTime() {\n if (!this._reloadTimer && !this._loading) {\n this._clearReloadTimer();\n this._reloadTimer = setTimeout(this._onTimerReached.bind(this), this._getRemainingDelay());\n }\n }\n _onTimerReached() {\n this._reloadTimer = null;\n this._tryReload();\n }\n _tryReload() {\n if (this._state !== 'started') {\n return;\n }\n if (!this._isFragmentVisible()) {\n up.puts('[up-poll]', 'Will not poll hidden fragment');\n return;\n }\n this._reloadNow();\n }\n _getFullDelay() {\n return this._options.interval ?? e.numberAttr(this._fragment, 'up-interval') ?? up.radio.config.pollInterval;\n }\n _getRemainingDelay() {\n return Math.max(this._getFullDelay() - this._getFragmentAge(), 0);\n }\n _getFragmentAge() {\n return new Date() - this._lastAttempt;\n }\n _isOnFrontLayer() {\n this.layer ||= up.layer.get(this._fragment);\n return this.layer?.isFront?.();\n }\n _reloadNow() {\n this._clearReloadTimer();\n let oldAbortable = this._abortable;\n try {\n this._abortable = false;\n this._loading = true;\n up.reload(this._fragment, this._reloadOptions()).then(this._onReloadSuccess.bind(this), this._onReloadFailure.bind(this));\n }\n finally {\n this._abortable = oldAbortable;\n }\n }\n _reloadOptions() {\n let guardEvent = up.event.build('up:fragment:poll', { log: ['Polling fragment', this._fragment] });\n return { ...this._options, guardEvent };\n }\n _onFragmentAborted({ newLayer }) {\n if (this._abortable && !newLayer) {\n this._stop();\n }\n }\n _onReloadSuccess({ fragment }) {\n this._loading = false;\n this._satisfyInterval();\n if (fragment) {\n this._onFragmentSwapped(fragment);\n }\n else {\n this._scheduleRemainingTime();\n }\n }\n _onFragmentSwapped(newFragment) {\n this._stop();\n if (this.forceStarted && up.fragment.matches(this._fragment, newFragment)) {\n this.constructor.forFragment(newFragment).forceStart(this._options);\n }\n }\n _onReloadFailure(reason) {\n this._loading = false;\n this._satisfyInterval();\n this._scheduleRemainingTime();\n up.error.throwCritical(reason);\n }\n _satisfyInterval() {\n this._lastAttempt = new Date();\n }\n};\n\n\n/***/ }),\n/* 47 */\n/***/ (() => {\n\nconst u = up.util;\nup.FragmentScrolling = class FragmentScrolling extends up.FragmentProcessor {\n keys() {\n return super.keys().concat([\n 'hash',\n 'mode',\n 'revealTop',\n 'revealMax',\n 'revealSnap',\n 'scrollBehavior',\n ]);\n }\n processPrimitive(opt) {\n switch (opt) {\n case 'reset':\n return this._reset();\n case 'layer':\n return this._revealLayer();\n case 'main':\n return this._revealSelector(':main');\n case 'restore':\n return this._restore();\n case 'hash':\n return this.hash && up.viewport.revealHash(this.hash, this.attributes());\n case 'target':\n case 'reveal':\n case true:\n return this._revealElement(this.fragment);\n default:\n if (u.isString(opt)) {\n return this._revealSelector(opt);\n }\n }\n }\n processElement(element) {\n return this._revealElement(element);\n }\n _revealElement(element) {\n if (element) {\n up.reveal(element, this.attributes());\n return true;\n }\n }\n _revealSelector(selector) {\n let match = this.findSelector(selector);\n return this._revealElement(match);\n }\n _revealLayer() {\n return this._revealElement(this.layer.getBoxElement());\n }\n _reset() {\n up.viewport.resetScroll({ ...this.attributes(), around: this.fragment });\n return true;\n }\n _restore() {\n return up.viewport.restoreScroll({ ...this.attributes(), around: this.fragment });\n }\n};\n\n\n/***/ }),\n/* 48 */\n/***/ (() => {\n\nconst e = up.element;\nconst u = up.util;\nup.Layer = class Layer extends up.Record {\n keys() {\n return [\n 'element',\n 'stack',\n 'history',\n 'mode',\n 'context',\n 'lastScrollTops',\n 'lastFocusCapsules',\n ];\n }\n defaults() {\n return {\n context: {},\n lastScrollTops: up.viewport.newStateCache(),\n lastFocusCapsules: up.viewport.newStateCache()\n };\n }\n constructor(options = {}) {\n super(options);\n if (!this.mode) {\n throw \"missing { mode } option\";\n }\n }\n setupHandlers() {\n up.link.convertClicks(this);\n }\n teardownHandlers() { }\n mainTargets() {\n return up.layer.mainTargets(this.mode);\n }\n sync() {\n }\n accept() {\n throw new up.NotImplemented();\n }\n dismiss() {\n throw new up.NotImplemented();\n }\n peel(options) {\n this.stack.peel(this, options);\n }\n evalOption(option) {\n return u.evalOption(option, this);\n }\n isCurrent() {\n return this.stack.isCurrent(this);\n }\n isFront() {\n return this.stack.isFront(this);\n }\n isRoot() {\n return this.stack.isRoot(this);\n }\n isOverlay() {\n return this.stack.isOverlay(this);\n }\n isOpen() {\n return this.stack.isOpen(this);\n }\n isClosed() {\n return this.stack.isClosed(this);\n }\n get parent() {\n return this.stack.parentOf(this);\n }\n get child() {\n return this.stack.childOf(this);\n }\n get ancestors() {\n return this.stack.ancestorsOf(this);\n }\n get descendants() {\n return this.stack.descendantsOf(this);\n }\n get subtree() {\n return [this, ...this.descendants];\n }\n get index() {\n return this._index ??= this.stack.indexOf(this);\n }\n getContentElement() {\n return this.contentElement || this.element;\n }\n getBoxElement() {\n return this.boxElement || this.element;\n }\n getFocusElement() {\n return this.getBoxElement();\n }\n getFirstSwappableElement() {\n throw new up.NotImplemented();\n }\n contains(element) {\n return element.closest(up.layer.anySelector()) === this.element;\n }\n on(...args) {\n return this._buildEventListenerGroup(args).bind();\n }\n off(...args) {\n return this._buildEventListenerGroup(args).unbind();\n }\n _buildEventListenerGroup(args) {\n return up.EventListenerGroup.fromBindArgs(args, {\n guard: (event) => this._containsEventTarget(event),\n elements: [this.element],\n baseLayer: this\n });\n }\n _containsEventTarget(event) {\n return this.contains(event.target);\n }\n wasHitByMouseEvent({ clientX, clientY }) {\n const hittableElement = document.elementFromPoint(clientX, clientY);\n return !hittableElement || this.contains(hittableElement);\n }\n _buildEventEmitter(args) {\n return up.EventEmitter.fromEmitArgs(args, { layer: this });\n }\n emit(...args) {\n return this._buildEventEmitter(args).emit();\n }\n isDetached() {\n return !this.element.isConnected;\n }\n saveHistory() {\n if (this.history) {\n this.savedTitle = document.title;\n this.savedMetaTags = up.history.findMetaTags();\n this.savedLocation = up.history.location;\n this.savedLang = up.history.getLang();\n }\n }\n restoreHistory() {\n if (!this.showsLiveHistory()) {\n return;\n }\n if (this.savedLocation) {\n up.history.push(this.savedLocation);\n }\n if (this.savedTitle) {\n document.title = this.savedTitle;\n }\n if (this.savedMetaTags) {\n up.history.updateMetaTags(this.savedMetaTags);\n }\n if (u.isString(this.savedLang)) {\n up.history.updateLang(this.savedLang);\n }\n }\n asCurrent(fn) {\n return this.stack.asCurrent(this, fn);\n }\n updateHistory(options) {\n if (u.isString(options.location)) {\n this.location = options.location;\n }\n if (up.history.config.updateMetaTags && u.isList(options.metaTags)) {\n up.migrate?.warnOfHungryMetaTags?.(options.metaTags);\n this.metaTags = options.metaTags;\n }\n if (u.isString(options.title)) {\n this.title = options.title;\n }\n if (u.isString(options.lang)) {\n this.lang = options.lang;\n }\n }\n showsLiveHistory() {\n return this.history && this.isFront();\n }\n get title() {\n if (this.showsLiveHistory()) {\n return document.title;\n }\n else {\n return this.savedTitle;\n }\n }\n set title(title) {\n this.savedTitle = title;\n if (this.showsLiveHistory()) {\n document.title = title;\n }\n }\n get metaTags() {\n if (this.showsLiveHistory()) {\n return up.history.findMetaTags();\n }\n else {\n return this.savedMetaTags;\n }\n }\n set metaTags(metaTags) {\n this.savedMetaTags = metaTags;\n if (this.showsLiveHistory()) {\n up.history.updateMetaTags(metaTags);\n }\n }\n get lang() {\n if (this.showsLiveHistory()) {\n return up.history.getLang();\n }\n else {\n return this.savedLang;\n }\n }\n set lang(lang) {\n this.savedLang = lang;\n if (this.showsLiveHistory()) {\n up.history.updateLang(lang);\n }\n }\n get location() {\n if (this.showsLiveHistory()) {\n return up.history.location;\n }\n else {\n return this.savedLocation;\n }\n }\n set location(location) {\n const previousLocation = this.location;\n location = u.normalizeURL(location);\n if (previousLocation !== location || this.opening) {\n this.savedLocation = location;\n if (this.showsLiveHistory()) {\n up.history.push(location);\n }\n if (!this.opening) {\n this.emit('up:layer:location:changed', { location });\n }\n }\n }\n selector(part) {\n return this.constructor.selector(part);\n }\n static selector(_part) {\n throw new up.NotImplemented();\n }\n toString() {\n throw new up.NotImplemented();\n }\n affix(...args) {\n return e.affix(this.getFirstSwappableElement(), ...args);\n }\n [u.isEqual.key](other) {\n return (this.constructor === other.constructor) && (this.element === other.element);\n }\n hasFocus() {\n let focusedElement = document.activeElement;\n return focusedElement !== document.body && this.element.contains(focusedElement);\n }\n reset() {\n Object.assign(this, this.defaults());\n }\n};\n\n\n/***/ }),\n/* 49 */\n/***/ (() => {\n\nvar _a;\nconst e = up.element;\nconst u = up.util;\nup.Layer.Overlay = (_a = class Overlay extends up.Layer {\n keys() {\n return [\n ...super.keys(),\n ...this.constructor.VISUAL_KEYS,\n 'onOpened',\n 'onAccept',\n 'onAccepted',\n 'onDismiss',\n 'onDismissed',\n 'acceptEvent',\n 'dismissEvent',\n 'acceptLocation',\n 'dismissLocation',\n 'opening'\n ];\n }\n constructor(options) {\n super(options);\n if (this.dismissable === true) {\n this.dismissable = ['button', 'key', 'outside'];\n }\n else if (this.dismissable === false) {\n this.dismissable = [];\n }\n else {\n this.dismissable = u.getSimpleTokens(this.dismissable);\n }\n if (this.acceptLocation) {\n this.acceptLocation = new up.URLPattern(this.acceptLocation);\n }\n if (this.dismissLocation) {\n this.dismissLocation = new up.URLPattern(this.dismissLocation);\n }\n }\n callback(name) {\n let fn = this[name];\n if (fn) {\n return fn.bind(this);\n }\n }\n createElement(parentElement) {\n this.nesting ||= this._suggestVisualNesting();\n const elementAttrs = u.compactObject(u.pick(this, ['align', 'position', 'size', 'class', 'nesting']));\n this.element = this.affixPart(parentElement, null, elementAttrs);\n }\n createBackdropElement(parentElement) {\n this.backdropElement = this.affixPart(parentElement, 'backdrop');\n }\n createViewportElement(parentElement) {\n this.viewportElement = this.affixPart(parentElement, 'viewport', { 'up-viewport': '' });\n }\n createBoxElement(parentElement) {\n this.boxElement = this.affixPart(parentElement, 'box');\n }\n createContentElement(parentElement) {\n this.contentElement = this.affixPart(parentElement, 'content');\n }\n setContent(content) {\n this.contentElement.append(content);\n this.onContentSet();\n }\n onContentSet() {\n }\n createDismissElement(parentElement) {\n this.dismissElement = this.affixPart(parentElement, 'dismiss', {\n 'up-dismiss': '\":button\"',\n 'aria-label': this.dismissARIALabel\n });\n return e.affix(this.dismissElement, 'span[aria-hidden=\"true\"]', { text: this.dismissLabel });\n }\n affixPart(parentElement, part, options = {}) {\n return e.affix(parentElement, this.selector(part), options);\n }\n static selector(part) {\n return u.compact(['up', this.mode, part]).join('-');\n }\n _suggestVisualNesting() {\n const { parent } = this;\n if (this.mode === parent.mode) {\n return 1 + parent._suggestVisualNesting();\n }\n else {\n return 0;\n }\n }\n setupHandlers() {\n super.setupHandlers();\n this.overlayFocus = new up.OverlayFocus(this);\n if (this._supportsDismissMethod('button')) {\n this.createDismissElement(this.getBoxElement());\n }\n if (this._supportsDismissMethod('outside')) {\n if (this.viewportElement) {\n up.on(this.viewportElement, 'up:click', event => {\n if (event.target === this.viewportElement) {\n this._onOutsideClicked(event, true);\n }\n });\n }\n else {\n this.unbindParentClicked = this.parent.on('up:click', (event, element) => {\n if (!up.layer.isWithinForeignOverlay(element)) {\n const originClicked = this.origin && this.origin.contains(element);\n this._onOutsideClicked(event, originClicked);\n }\n });\n }\n }\n if (this._supportsDismissMethod('key')) {\n this.unbindEscapePressed = up.event.onEscape(event => this.onEscapePressed(event));\n }\n this.registerClickCloser('up-accept', (value, closeOptions) => {\n this.accept(value, closeOptions);\n });\n this.registerClickCloser('up-dismiss', (value, closeOptions) => {\n this.dismiss(value, closeOptions);\n });\n up.migrate.registerLayerCloser?.(this);\n this._registerEventCloser(this.acceptEvent, this.accept);\n this._registerEventCloser(this.dismissEvent, this.dismiss);\n this.on('up:click', 'label[for]', (event, label) => this._onLabelClicked(event, label));\n }\n _onLabelClicked(event, label) {\n let id = label.getAttribute('for');\n let fieldSelector = up.form.fieldSelector(e.idSelector(id));\n let fieldsAnywhere = up.fragment.all(fieldSelector, { layer: 'any' });\n let fieldsInLayer = up.fragment.all(fieldSelector, { layer: this });\n if (fieldsAnywhere.length > 1 && fieldsInLayer[0] !== fieldsAnywhere[0]) {\n event.preventDefault();\n const field = fieldsInLayer[0];\n field.focus();\n if (field.matches('input[type=checkbox], input[type=radio]')) {\n field.click();\n }\n }\n }\n _onOutsideClicked(event, halt) {\n up.log.putsEvent(event);\n if (halt)\n up.event.halt(event);\n up.error.muteUncriticalSync(() => this.dismiss(':outside', { origin: event.target }));\n }\n onEscapePressed(event) {\n if (this.isFront()) {\n let field = up.form.focusedField();\n if (field) {\n field.blur();\n }\n else if (this._supportsDismissMethod('key')) {\n up.event.halt(event, { log: true });\n up.error.muteUncriticalSync(() => this.dismiss(':key'));\n }\n }\n }\n registerClickCloser(attribute, closeFn) {\n let selector = `[${attribute}]`;\n this.on('up:click', selector, function (event) {\n up.event.halt(event, { log: true });\n const origin = event.target.closest(selector);\n const value = e.jsonAttr(origin, attribute);\n const closeOptions = { origin };\n const parser = new up.OptionsParser(origin, closeOptions);\n parser.booleanOrString('animation');\n parser.string('easing');\n parser.number('duration');\n parser.string('confirm');\n up.error.muteUncriticalSync(() => closeFn(value, closeOptions));\n });\n }\n _registerEventCloser(eventTypes, closeFn) {\n if (!eventTypes) {\n return;\n }\n return this.on(eventTypes, event => {\n event.preventDefault();\n up.error.muteUncriticalSync(() => closeFn.call(this, event, { response: event.response }));\n });\n }\n tryAcceptForLocation(options) {\n this._tryCloseForLocation(this.acceptLocation, this.accept, options);\n }\n tryDismissForLocation(options) {\n this._tryCloseForLocation(this.dismissLocation, this.dismiss, options);\n }\n _tryCloseForLocation(urlPattern, closeFn, options) {\n let location, resolution;\n if (urlPattern && (location = this.location) && (resolution = urlPattern.recognize(location))) {\n const closeValue = { ...resolution, location };\n up.error.muteUncriticalSync(() => closeFn.call(this, closeValue, options));\n }\n }\n teardownHandlers() {\n super.teardownHandlers();\n this.unbindParentClicked?.();\n this.unbindEscapePressed?.();\n this.overlayFocus.teardown();\n }\n destroyElements(options) {\n const animation = () => this.startCloseAnimation(options);\n const onFinished = () => {\n this.onElementsRemoved();\n options.onFinished?.();\n };\n const destroyOptions = { ...options, animation, onFinished, log: false };\n up.destroy(this.element, destroyOptions);\n }\n onElementsRemoved() {\n }\n _startAnimation(options = {}) {\n const boxDone = up.animate(this.getBoxElement(), options.boxAnimation, options);\n let backdropDone;\n if (this.backdrop && !up.motion.isNone(options.boxAnimation)) {\n backdropDone = up.animate(this.backdropElement, options.backdropAnimation, options);\n }\n return Promise.all([boxDone, backdropDone]);\n }\n async startOpenAnimation(options = {}) {\n let boxAnimation = options.animation ?? this.evalOption(this.openAnimation);\n let backdropAnimation = 'fade-in';\n await this._startAnimation({\n boxAnimation,\n backdropAnimation,\n easing: options.easing || this.openEasing,\n duration: options.duration || this.openDuration\n });\n this.wasEverVisible = true;\n }\n startCloseAnimation(options = {}) {\n let boxAnimation = this.wasEverVisible && (options.animation ?? this.evalOption(this.closeAnimation));\n let backdropAnimation = 'fade-out';\n return this._startAnimation({\n boxAnimation,\n backdropAnimation,\n easing: options.easing || this.closeEasing,\n duration: options.duration || this.closeDuration\n });\n }\n accept(value = null, options = {}) {\n return this._executeCloseChange('accept', value, options);\n }\n dismiss(value = null, options = {}) {\n return this._executeCloseChange('dismiss', value, options);\n }\n _supportsDismissMethod(method) {\n return u.contains(this.dismissable, method);\n }\n _executeCloseChange(verb, value, options) {\n options = { ...options, verb, value, layer: this };\n return new up.Change.CloseLayer(options).execute();\n }\n getFirstSwappableElement() {\n return this.getContentElement().children[0];\n }\n toString() {\n return `${this.mode} overlay`;\n }\n },\n _a.VISUAL_KEYS = [\n 'mode',\n 'position',\n 'align',\n 'size',\n 'origin',\n 'class',\n 'backdrop',\n 'dismissable',\n 'dismissLabel',\n 'dismissARIALabel',\n 'openAnimation',\n 'closeAnimation',\n 'openDuration',\n 'closeDuration',\n 'openEasing',\n 'closeEasing',\n 'trapFocus',\n ],\n _a);\n\n\n/***/ }),\n/* 50 */\n/***/ (() => {\n\nup.Layer.OverlayWithTether = class OverlayWithTether extends up.Layer.Overlay {\n createElements() {\n if (!this.origin) {\n up.fail('Missing { origin } option');\n }\n this._tether = new up.Tether({\n anchor: this.origin,\n align: this.align,\n position: this.position\n });\n this.createElement(this._tether.parent);\n this.createContentElement(this.element);\n }\n onContentSet() {\n this._tether.start(this.element);\n }\n onElementsRemoved() {\n this._tether.stop();\n }\n sync() {\n if (this.isOpen()) {\n if (this.isDetached() || this._tether.isDetached()) {\n this.dismiss(':detached', {\n animation: false,\n preventable: false\n });\n }\n else {\n this._tether.sync();\n }\n }\n }\n};\n\n\n/***/ }),\n/* 51 */\n/***/ (() => {\n\nup.Layer.OverlayWithViewport = class OverlayWithViewport extends up.Layer.Overlay {\n static getParentElement() {\n return document.body;\n }\n createElements() {\n up.viewport.bodyShifter.raiseStack();\n this.createElement(this.constructor.getParentElement());\n if (this.backdrop) {\n this.createBackdropElement(this.element);\n }\n this.createViewportElement(this.element);\n this.createBoxElement(this.viewportElement);\n this.createContentElement(this.boxElement);\n }\n onElementsRemoved() {\n up.viewport.bodyShifter.lowerStack();\n }\n sync() {\n if (this.isDetached() && this.isOpen()) {\n this.constructor.getParentElement().appendChild(this.element);\n }\n }\n};\n\n\n/***/ }),\n/* 52 */\n/***/ (() => {\n\nvar _a;\nconst e = up.element;\nup.Layer.Root = (_a = class Root extends up.Layer {\n get element() {\n return e.root;\n }\n constructor(options) {\n super(options);\n this.setupHandlers();\n }\n getFirstSwappableElement() {\n return document.body;\n }\n static selector() {\n return 'html';\n }\n setupHandlers() {\n if (!this.element.upHandlersApplied) {\n this.element.upHandlersApplied = true;\n super.setupHandlers();\n }\n }\n sync() {\n this.setupHandlers();\n }\n accept() {\n this._cannotCloseRoot();\n }\n dismiss() {\n this._cannotCloseRoot();\n }\n _cannotCloseRoot() {\n up.fail('Cannot close the root layer');\n }\n toString() {\n return \"root layer\";\n }\n },\n _a.mode = 'root',\n _a);\n\n\n/***/ }),\n/* 53 */\n/***/ (() => {\n\nvar _a;\nup.Layer.Modal = (_a = class Modal extends up.Layer.OverlayWithViewport {\n },\n _a.mode = 'modal',\n _a);\n\n\n/***/ }),\n/* 54 */\n/***/ (() => {\n\nvar _a;\nup.Layer.Popup = (_a = class Popup extends up.Layer.OverlayWithTether {\n },\n _a.mode = 'popup',\n _a);\n\n\n/***/ }),\n/* 55 */\n/***/ (() => {\n\nvar _a;\nup.Layer.Drawer = (_a = class Drawer extends up.Layer.OverlayWithViewport {\n },\n _a.mode = 'drawer',\n _a);\n\n\n/***/ }),\n/* 56 */\n/***/ (() => {\n\nvar _a;\nup.Layer.Cover = (_a = class Cover extends up.Layer.OverlayWithViewport {\n },\n _a.mode = 'cover',\n _a);\n\n\n/***/ }),\n/* 57 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nconst e = up.element;\nup.LayerLookup = (_a = class LayerLookup {\n constructor(stack, options) {\n this._stack = stack;\n if (options.normalizeLayerOptions !== false) {\n up.layer.normalizeOptions(options);\n }\n this._options = options;\n this._values = u.getSimpleTokens(options.layer);\n }\n all() {\n let results = u.flatMap(this._values, value => this._resolveValue(value));\n results = u.compact(results);\n results = u.uniq(results);\n return results;\n }\n static all(stack, ...args) {\n const options = u.parseArgIntoOptions(args, 'layer');\n const { layer } = options;\n if (layer instanceof up.Layer) {\n return [layer];\n }\n return new this(stack, options).all();\n }\n _forElement(element) {\n element = e.get(element);\n return u.find(this._stack.reversed(), layer => layer.contains(element));\n }\n _forIndex(value) {\n return this._stack.at(value);\n }\n _resolveValue(value) {\n if (value instanceof up.Layer) {\n return value;\n }\n if (u.isNumber(value)) {\n return this._forIndex(value);\n }\n if (/^\\d+$/.test(value)) {\n return this._forIndex(Number(value));\n }\n if (u.isElementLike(value)) {\n return this._forElement(value);\n }\n switch (value) {\n case 'any':\n return [this._getBaseLayer(), ...this._stack.reversed()];\n case 'current':\n return this._getBaseLayer();\n case 'closest':\n return this._stack.selfAndAncestorsOf(this._getBaseLayer());\n case 'parent':\n return this._getBaseLayer().parent;\n case 'ancestor':\n case 'ancestors':\n return this._getBaseLayer().ancestors;\n case 'child':\n return this._getBaseLayer().child;\n case 'descendant':\n case 'descendants':\n return this._getBaseLayer().descendants;\n case 'subtree':\n return this._getBaseLayer().subtree;\n case 'new':\n return 'new';\n case 'root':\n return this._stack.root;\n case 'overlay':\n case 'overlays':\n return u.reverse(this._stack.overlays);\n case 'front':\n return this._stack.front;\n case 'origin':\n return this._getOriginLayer();\n default:\n return up.fail(\"Unknown { layer } option: %o\", value);\n }\n }\n _getOriginLayer() {\n let { origin, originLayer } = this._options;\n if (originLayer) {\n return originLayer;\n }\n if (origin) {\n return this._forElement(origin);\n }\n }\n _getBaseLayer() {\n let { baseLayer } = this._options;\n if (u.isString(baseLayer)) {\n const recursiveOptions = { ...this._options, baseLayer: this._stack.current, normalizeLayerOptions: false, layer: baseLayer };\n return this.constructor.all(this._stack, recursiveOptions)[0];\n }\n else {\n return baseLayer || this._getOriginLayer() || this._stack.current;\n }\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _getBaseLayer: true,\n _getOriginLayer: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 58 */\n/***/ (() => {\n\nconst u = up.util;\nup.LayerStack = class LayerStack {\n constructor() {\n this._currentOverrides = [];\n this.layers = [this._buildRoot()];\n }\n _buildRoot() {\n return up.layer.build({ mode: 'root', stack: this });\n }\n remove(layer) {\n u.remove(this.layers, layer);\n }\n peel(layer, options) {\n const descendants = u.reverse(layer.descendants);\n const dismissOptions = { ...options, preventable: false };\n for (let descendant of descendants) {\n descendant.dismiss(':peel', dismissOptions);\n }\n }\n reset() {\n this.peel(this.root, { animation: false });\n this._currentOverrides = [];\n this.root.reset();\n }\n isOpen(layer) {\n return u.contains(this.layers, layer);\n }\n isClosed(layer) {\n return !this.isOpen(layer);\n }\n parentOf(layer) {\n return this.layers[layer.index - 1];\n }\n childOf(layer) {\n return this.layers[layer.index + 1];\n }\n ancestorsOf(layer) {\n return u.reverse(this.layers.slice(0, layer.index));\n }\n selfAndAncestorsOf(layer) {\n return [layer, ...layer.ancestors];\n }\n descendantsOf(layer) {\n return this.layers.slice(layer.index + 1);\n }\n isRoot(layer) {\n return this.root === layer;\n }\n isOverlay(layer) {\n return this.root !== layer;\n }\n isCurrent(layer) {\n return this.current === layer;\n }\n isFront(layer) {\n return this.front === layer;\n }\n get(...args) {\n return this.getAll(...args)[0];\n }\n getAll(...args) {\n return up.LayerLookup.all(this, ...args);\n }\n sync() {\n for (let layer of this.layers) {\n layer.sync();\n }\n }\n asCurrent(layer, fn) {\n try {\n this._currentOverrides.push(layer);\n return fn();\n }\n finally {\n this._currentOverrides.pop();\n }\n }\n reversed() {\n return u.reverse(this.layers);\n }\n dismissOverlays(value = null, options = {}) {\n options.dismissable = false;\n for (let overlay of u.reverse(this.overlays)) {\n overlay.dismiss(value, options);\n }\n }\n at(index) {\n return this.layers[index];\n }\n indexOf(layer) {\n return this.layers.indexOf(layer);\n }\n get count() {\n return this.layers.length;\n }\n get root() {\n return this.layers[0];\n }\n get overlays() {\n return this.root.descendants;\n }\n get current() {\n return u.last(this._currentOverrides) || this.front;\n }\n get front() {\n return u.last(this.layers);\n }\n};\n\n\n/***/ }),\n/* 59 */\n/***/ (() => {\n\nconst u = up.util;\nup.LinkCurrentURLs = class LinkCurrentURLs {\n constructor(link) {\n this._isSafe = up.link.isSafe(link);\n if (this._isSafe) {\n const href = link.getAttribute('href');\n if (href && (href !== '#')) {\n this._href = u.matchableURL(href);\n }\n const upHREF = link.getAttribute('up-href');\n if (upHREF) {\n this._upHREF = u.matchableURL(upHREF);\n }\n const alias = link.getAttribute('up-alias');\n if (alias) {\n this._aliasPattern = new up.URLPattern(alias);\n }\n }\n }\n isCurrent(normalizedLocation) {\n if (!normalizedLocation) {\n return false;\n }\n return !!(this._href === normalizedLocation ||\n this._upHREF === normalizedLocation ||\n this._aliasPattern?.test?.(normalizedLocation, false));\n }\n};\n\n\n/***/ }),\n/* 60 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.LinkFollowIntent = class LinkFollowIntent {\n constructor(link, callback) {\n this._link = link;\n this._callback = callback;\n this._lastRequest = null;\n this._on('mouseenter mousedown touchstart', (event) => this._scheduleCallback(event));\n this._on('mouseleave', () => this._unscheduleCallback());\n up.fragment.onAborted(this._link, () => this._unscheduleCallback());\n }\n _on(eventType, fn) {\n up.on(this._link, eventType, { passive: true }, fn);\n }\n _scheduleCallback(event) {\n if (!up.link.shouldFollowEvent(event, this._link))\n return;\n this._unscheduleCallback();\n const applyDelay = (event.type === 'mouseenter');\n if (applyDelay) {\n let delay = this._parseDelay();\n this._timer = u.timer(delay, () => this._runCallback(event));\n }\n else {\n this._runCallback(event);\n }\n }\n _unscheduleCallback() {\n clearTimeout(this._timer);\n if (this._lastRequest?.background)\n this._lastRequest.abort();\n this._lastRequest = null;\n }\n _parseDelay() {\n return e.numberAttr(this._link, 'up-preload-delay') ?? up.link.config.preloadDelay;\n }\n _runCallback(event) {\n up.log.putsEvent(event);\n this._callback({ onRequestKnown: (request) => this._lastRequest = request });\n }\n};\n\n\n/***/ }),\n/* 61 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.MotionController = class MotionController {\n constructor(name) {\n this._activeClass = `up-${name}`;\n this._selector = `.${this._activeClass}`;\n this.finishEvent = `up:${name}:finish`;\n this.finishCount = 0;\n this._clusterCount = 0;\n }\n startFunction(cluster, startMotion, memory = {}) {\n cluster = e.list(cluster);\n const mutedAnimator = () => up.error.muteUncriticalRejection(startMotion());\n memory.trackMotion = memory.trackMotion ?? up.motion.isEnabled();\n if (memory.trackMotion === false) {\n return mutedAnimator();\n }\n else {\n memory.trackMotion = false;\n this.finish(cluster);\n this._markCluster(cluster);\n let promise = this._whileForwardingFinishEvent(cluster, mutedAnimator);\n promise = promise.then(() => this._unmarkCluster(cluster));\n return promise;\n }\n }\n finish(elements) {\n this.finishCount++;\n if ((this._clusterCount === 0) || !up.motion.isEnabled()) {\n return;\n }\n elements = this._expandFinishRequest(elements);\n for (let element of elements) {\n this._finishOneElement(element);\n }\n return up.migrate.formerlyAsync?.('up.motion.finish()');\n }\n _expandFinishRequest(elements) {\n if (elements) {\n return u.flatMap(elements, el => e.list(el.closest(this._selector), el.querySelectorAll(this._selector)));\n }\n else {\n return document.querySelectorAll(this._selector);\n }\n }\n isActive(element) {\n return element.classList.contains(this._activeClass);\n }\n _finishOneElement(element) {\n this._emitFinishEvent(element);\n }\n _emitFinishEvent(element, eventAttrs = {}) {\n eventAttrs = { target: element, log: false, ...eventAttrs };\n return up.emit(this.finishEvent, eventAttrs);\n }\n _markCluster(cluster) {\n this._clusterCount++;\n this._toggleActive(cluster, true);\n }\n _unmarkCluster(cluster) {\n this._clusterCount--;\n this._toggleActive(cluster, false);\n }\n _toggleActive(cluster, isActive) {\n for (let element of cluster) {\n element.classList.toggle(this._activeClass, isActive);\n }\n }\n _whileForwardingFinishEvent(cluster, fn) {\n if (cluster.length < 2) {\n return fn();\n }\n const doForward = (event) => {\n if (!event.forwarded) {\n for (let element of cluster) {\n if (element !== event.target && this.isActive(element)) {\n this._emitFinishEvent(element, { forwarded: true });\n }\n }\n }\n };\n const unbindFinish = up.on(cluster, this.finishEvent, doForward);\n return fn().then(unbindFinish);\n }\n async reset() {\n await this.finish();\n this.finishCount = 0;\n this._clusterCount = 0;\n }\n};\n\n\n/***/ }),\n/* 62 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.NonceableCallback = class NonceableCallback {\n constructor(script, nonce) {\n this.script = script;\n this.nonce = nonce;\n }\n static fromString(string) {\n let match = string.match(/^(nonce-([^\\s]+)\\s)?(.*)$/);\n return new this(match[3], match[2]);\n }\n toFunction(...argNames) {\n let script = this.script;\n if (this.nonce) {\n let callbackThis = this;\n return function (...args) {\n return callbackThis._runAsNoncedFunction(script, this, argNames, args);\n };\n }\n else {\n return new Function(...argNames, script);\n }\n }\n toString() {\n return `nonce-${this.nonce} ${this.script}`;\n }\n _runAsNoncedFunction(script, thisArg, argNames, args) {\n let wrappedScript = `\n try {\n up.noncedEval.value = (function(${argNames.join()}) {\n ${script}\n }).apply(up.noncedEval.thisArg, up.noncedEval.args)\n } catch (error) {\n up.noncedEval.error = error\n }\n `;\n let scriptElement;\n try {\n up.noncedEval = { args, thisArg: thisArg };\n scriptElement = e.affix(document.body, 'script', { nonce: this.nonce, text: wrappedScript });\n if (up.noncedEval.error) {\n throw up.noncedEval.error;\n }\n else {\n return up.noncedEval.value;\n }\n }\n finally {\n up.noncedEval = undefined;\n if (scriptElement) {\n scriptElement.remove();\n }\n }\n }\n _allowedBy(allowedNonces) {\n return this.nonce && u.contains(allowedNonces, this.nonce);\n }\n static adoptNonces(element, allowedNonces) {\n if (!allowedNonces?.length) {\n return;\n }\n const getPageNonce = u.memoize(up.protocol.cspNonce);\n u.each(up.script.config.nonceableAttributes, (attribute) => {\n let matches = e.subtree(element, `[${attribute}^=\"nonce-\"]`);\n u.each(matches, (match) => {\n let attributeValue = match.getAttribute(attribute);\n let callback = this.fromString(attributeValue);\n let warn = (message, ...args) => up.log.warn('up.render()', `Cannot use callback [${attribute}=\"${attributeValue}\"]: ${message}`, ...args);\n if (!callback._allowedBy(allowedNonces)) {\n return warn(\"Callback's CSP nonce (%o) does not match response header (%o)\", callback.nonce, allowedNonces);\n }\n let pageNonce = getPageNonce();\n if (!pageNonce) {\n return warn(\"Current page's CSP nonce is unknown\");\n }\n callback.nonce = pageNonce;\n match.setAttribute(attribute, callback.toString());\n });\n });\n }\n};\n\n\n/***/ }),\n/* 63 */\n/***/ (() => {\n\nconst e = up.element;\nconst u = up.util;\nup.OverlayFocus = class OverlayFocus {\n constructor(layer) {\n this._layer = layer;\n this._focusElement = this._layer.getFocusElement();\n this._trapFocus = this._layer.trapFocus;\n }\n moveToFront() {\n if (this._active) {\n return;\n }\n this._active = true;\n this._unsetAttrs = e.setAttrsTemp(this._focusElement, {\n 'tabindex': '0',\n 'role': 'dialog',\n 'aria-modal': this._trapFocus.toString()\n });\n if (this._trapFocus) {\n this._untrapFocus = up.on('focusin', event => this._onFocus(event));\n this._focusTrapBefore = e.affix(this._focusElement, 'beforebegin', 'up-focus-trap[tabindex=0]');\n this._focusTrapAfter = e.affix(this._focusElement, 'afterend', 'up-focus-trap[tabindex=0]');\n }\n }\n moveToBack() {\n this.teardown();\n }\n teardown() {\n if (!this._active) {\n return;\n }\n this._active = false;\n this._unsetAttrs();\n if (this._trapFocus) {\n this._untrapFocus();\n this._focusTrapBefore.remove();\n this._focusTrapAfter.remove();\n }\n }\n _onFocus(event) {\n const { target } = event;\n if (this._processingFocusEvent || up.layer.isWithinForeignOverlay(target)) {\n return;\n }\n this._processingFocusEvent = true;\n if (target === this._focusTrapBefore) {\n this._focusEnd();\n }\n else if ((target === this._focusTrapAfter) || !this._layer.contains(target)) {\n this._focusStart();\n }\n this._processingFocusEvent = false;\n }\n _focusStart(focusOptions) {\n up.focus(this._focusElement, focusOptions);\n }\n _focusEnd() {\n this._focusLastDescendant(this._layer.getBoxElement()) || this._focusStart();\n }\n _focusLastDescendant(element) {\n for (let child of u.reverse(element.children)) {\n if (up.viewport.tryFocus(child) || this._focusLastDescendant(child)) {\n return true;\n }\n }\n }\n};\n\n\n/***/ }),\n/* 64 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Params = class Params {\n constructor(raw) {\n this.clear();\n this.addAll(raw);\n }\n clear() {\n this.entries = [];\n }\n [u.copy.key]() {\n return new up.Params(this);\n }\n toObject() {\n const obj = {};\n for (let entry of this.entries) {\n const { name, value } = entry;\n if (!u.isBasicObjectProperty(name)) {\n if (this._isArrayKey(name)) {\n obj[name] ||= [];\n obj[name].push(value);\n }\n else {\n obj[name] = value;\n }\n }\n }\n return obj;\n }\n toArray() {\n return this.entries;\n }\n toFormData() {\n const formData = new FormData();\n for (let entry of this.entries) {\n formData.append(entry.name, entry.value);\n }\n if (!formData.entries) {\n formData.originalArray = this.entries;\n }\n return formData;\n }\n toQuery() {\n let parts = u.map(this.entries, this._arrayEntryToQuery.bind(this));\n parts = u.compact(parts);\n return parts.join('&');\n }\n _arrayEntryToQuery(entry) {\n const { value } = entry;\n if (this._isBinaryValue(value)) {\n return;\n }\n let query = encodeURIComponent(entry.name);\n if (u.isGiven(value)) {\n query += \"=\";\n query += encodeURIComponent(value);\n }\n return query;\n }\n _isBinaryValue(value) {\n return value instanceof Blob;\n }\n hasBinaryValues() {\n const values = u.map(this.entries, 'value');\n return u.some(values, this._isBinaryValue);\n }\n toURL(base) {\n let parts = [base, this.toQuery()];\n parts = u.filter(parts, u.isPresent);\n const separator = u.contains(base, '?') ? '&' : '?';\n return parts.join(separator);\n }\n add(name, value) {\n this.entries.push({ name, value });\n }\n addAll(raw) {\n if (u.isMissing(raw)) {\n }\n else if (raw instanceof this.constructor) {\n this.entries.push(...raw.entries);\n }\n else if (u.isArray(raw)) {\n this.entries.push(...raw);\n }\n else if (u.isString(raw)) {\n this._addAllFromQuery(raw);\n }\n else if (u.isFormData(raw)) {\n this._addAllFromFormData(raw);\n }\n else if (u.isObject(raw)) {\n this._addAllFromObject(raw);\n }\n else {\n up.fail(\"Unsupport params type: %o\", raw);\n }\n }\n _addAllFromObject(object) {\n for (let key in object) {\n const value = object[key];\n const valueElements = u.isArray(value) ? value : [value];\n for (let valueElement of valueElements) {\n this.add(key, valueElement);\n }\n }\n }\n _addAllFromQuery(query) {\n for (let part of query.split('&')) {\n if (part) {\n let [name, value] = part.split('=');\n name = decodeURIComponent(name);\n if (u.isGiven(value)) {\n value = decodeURIComponent(value);\n }\n else {\n value = null;\n }\n this.add(name, value);\n }\n }\n }\n _addAllFromFormData(formData) {\n for (let value of formData.entries()) {\n this.add(...value);\n }\n }\n set(name, value) {\n this.delete(name);\n this.add(name, value);\n }\n delete(name) {\n this.entries = u.reject(this.entries, this._matchEntryFn(name));\n }\n _matchEntryFn(name) {\n return entry => entry.name === name;\n }\n get(name) {\n if (this._isArrayKey(name)) {\n return this.getAll(name);\n }\n else {\n return this.getFirst(name);\n }\n }\n getFirst(name) {\n const entry = u.find(this.entries, this._matchEntryFn(name));\n return entry?.value;\n }\n getAll(name) {\n if (this._isArrayKey(name)) {\n return this.getAll(name);\n }\n else {\n const entries = u.map(this.entries, this._matchEntryFn(name));\n return u.map(entries, 'value');\n }\n }\n _isArrayKey(key) {\n return key.endsWith('[]');\n }\n [u.isBlank.key]() {\n return this.entries.length === 0;\n }\n static fromForm(form) {\n return this.fromContainer(form);\n }\n static fromContainer(container) {\n let fields = up.form.fields(container);\n return this.fromFields(fields);\n }\n static fromFields(fields) {\n const params = new (this)();\n for (let field of u.wrapList(fields)) {\n params.addField(field);\n }\n return params;\n }\n addField(field) {\n field = e.get(field);\n let name = field.name;\n if (name && !field.disabled) {\n const { tagName } = field;\n const { type } = field;\n if (tagName === 'SELECT') {\n for (let option of field.querySelectorAll('option')) {\n if (option.selected) {\n this.add(name, option.value);\n }\n }\n }\n else if ((type === 'checkbox') || (type === 'radio')) {\n if (field.checked) {\n this.add(name, field.value);\n }\n }\n else if (type === 'file') {\n for (let file of field.files) {\n this.add(name, file);\n }\n }\n else {\n return this.add(name, field.value);\n }\n }\n }\n [u.isEqual.key](other) {\n return (this.constructor === other.constructor) && u.isEqual(this.entries, other.entries);\n }\n static fromURL(url) {\n const params = new (this)();\n const urlParts = u.parseURL(url);\n let query = urlParts.search;\n if (query) {\n query = query.replace(/^\\?/, '');\n params.addAll(query);\n }\n return params;\n }\n static stripURL(url) {\n return u.normalizeURL(url, { search: false });\n }\n static merge(...objects) {\n return objects.reduce(function (allParams, params) {\n allParams.addAll(params);\n return allParams;\n }, new up.Params());\n }\n};\n\n\n/***/ }),\n/* 65 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Preview = class Preview {\n constructor({ fragment, request, renderOptions, cleaner }) {\n this.fragment = fragment;\n this.request = request;\n this.renderOptions = renderOptions;\n this._cleaner = cleaner;\n }\n undo(...args) {\n if (this.ended) {\n reportError(new up.Error('Preview used after end of request'));\n }\n else {\n this._cleaner.guard(...args);\n }\n }\n get origin() {\n return this.request.origin;\n }\n get params() {\n return this.request.params;\n }\n get layer() {\n return this.request.layer;\n }\n get ended() {\n return this.request.ended;\n }\n get expiredResponse() {\n return this.renderOptions.expiredResponse;\n }\n get revalidating() {\n return !!this.expiredResponse;\n }\n run(value, options = {}) {\n for (let fn of up.status.resolvePreviewFns(value)) {\n this.undo(up.error.guard(fn, this, options));\n }\n }\n revert() {\n this._cleaner.clean();\n }\n setAttrs(...args) {\n let [element, attrs] = this._parseMutatorArgs(args, 'val', 'val');\n this.undo(e.setAttrsTemp(element, attrs));\n }\n addClass(...args) {\n let [element, klass] = this._parseMutatorArgs(args, 'val', 'val');\n this.undo(e.addClassTemp(element, klass));\n }\n addClassBatch(elements, classes) {\n for (let element of elements) {\n for (let klass of classes) {\n this.addClass(element, klass);\n }\n }\n }\n removeClass(...args) {\n let [element, klass] = this._parseMutatorArgs(args, 'val', 'val');\n this.undo(e.removeClassTemp(element, klass));\n }\n setStyle(...args) {\n let [element, styles] = this._parseMutatorArgs(args, 'val', 'val');\n this.undo(e.setStyleTemp(element, styles));\n }\n disable(...args) {\n let [element] = this._parseMutatorArgs(args, 'val');\n this.undo(up.form.disable(element));\n }\n insert(...args) {\n let [reference, position = 'beforeend', tempValue] = this._parseMutatorArgs(args, 'val', u.isAdjacentPosition, 'val');\n this.undo(up.fragment.insertTemp(reference, position, tempValue));\n }\n show(...args) {\n let [element] = this._parseMutatorArgs(args, 'val');\n this.undo(e.showTemp(element));\n }\n hide(...args) {\n let [element] = this._parseMutatorArgs(args, 'val');\n this.undo(e.hideTemp(element));\n }\n hideContent(...args) {\n let [parent] = this._parseMutatorArgs(args, 'val');\n let wrapper = e.wrapChildren(parent);\n e.hide(wrapper);\n this.undo(() => e.unwrap(wrapper));\n }\n showPlaceholder(...args) {\n let [parent, placeholderReference] = this._parseMutatorArgs(args, 'val', 'val');\n let placeholderNodes = up.fragment.provideNodes(placeholderReference, { origin: this.origin });\n up.puts('[up-placeholder]', 'Showing placeholder %o', placeholderReference);\n if (parent) {\n this.swapContent(parent, placeholderNodes);\n }\n else if (this.layer === 'new') {\n this.openLayer(placeholderNodes, { closeAnimation: false });\n this.renderOptions.openAnimation = false;\n }\n }\n swapContent(...args) {\n let [parent, newContent] = this._parseMutatorArgs(args, 'val', 'val');\n this.hideContent(parent);\n this.insert(parent, newContent);\n }\n openLayer(content, options = {}) {\n let undoDismissValue = ':undo-preview';\n let onDismiss = ({ value }) => {\n if (value !== undoDismissValue)\n this.request.abort({ reason: 'Preview overlay dismissed' });\n };\n up.layer.open({\n ...u.pick(this.renderOptions, [...up.Layer.Overlay.VISUAL_KEYS, 'target']),\n ...options,\n content,\n abort: false,\n onDismiss\n });\n let overlay = up.layer.front;\n this.undo(() => overlay.dismiss(undoDismissValue, { preventable: false }));\n return overlay;\n }\n _parseMutatorArgs(args, ...specs) {\n let [element, ...rest] = u.args(args, ...specs);\n element = up.fragment.get(element, { layer: this.layer, origin: this.origin }) || this.fragment;\n return [element, ...rest];\n }\n};\n\n\n/***/ }),\n/* 66 */\n/***/ (() => {\n\nconst e = up.element;\nconst TRANSITION_DELAY = 300;\nup.ProgressBar = class ProgressBar {\n constructor() {\n this._step = 0;\n this._element = e.affix(document.body, 'up-progress-bar');\n this._element.style.transition = `width ${TRANSITION_DELAY}ms ease-out`;\n this._moveTo(0);\n e.paint(this._element);\n this._width = 31;\n this._nextStep();\n }\n _nextStep() {\n let diff;\n if (this._width < 80) {\n if (Math.random() < 0.15) {\n diff = 7 + (5 * Math.random());\n }\n else {\n diff = 1.5 + (0.5 * Math.random());\n }\n }\n else {\n diff = 0.13 * (100 - this._width) * Math.random();\n }\n this._moveTo(this._width + diff);\n this._step++;\n const nextStepDelay = TRANSITION_DELAY + (this._step * 40);\n this.timeout = setTimeout(this._nextStep.bind(this), nextStepDelay);\n }\n _moveTo(width) {\n this._width = width;\n this._element.style.width = `${width}vw`;\n }\n destroy() {\n clearTimeout(this.timeout);\n this._element.remove();\n }\n conclude() {\n clearTimeout(this.timeout);\n this._moveTo(100);\n setTimeout(this.destroy.bind(this), TRANSITION_DELAY);\n }\n};\n\n\n/***/ }),\n/* 67 */\n/***/ (() => {\n\nconst u = up.util;\nup.RenderOptions = (function () {\n const NO_PREVIEWS = {\n preview: false,\n disable: false,\n placeholder: false,\n feedback: false,\n };\n const NO_INPUT_INTERFERENCE = {\n scroll: false,\n focus: 'keep',\n confirm: false,\n };\n const NO_MOTION = {\n transition: false,\n animation: false,\n openAnimation: false,\n closeAnimation: false,\n };\n const PREFLIGHT_KEYS = [\n 'url',\n 'method',\n 'origin',\n 'headers',\n 'params',\n 'cache',\n 'fallback',\n 'abort',\n 'abortable',\n 'confirm',\n 'feedback',\n 'disable',\n 'placeholder',\n 'preview',\n 'origin',\n 'originLayer',\n 'baseLayer',\n 'navigate',\n 'fail',\n 'onError',\n ];\n const SHARED_KEYS = PREFLIGHT_KEYS.concat([\n 'keep',\n 'hungry',\n 'history',\n 'source',\n 'saveScroll',\n ]);\n const CONTENT_KEYS = [\n 'url',\n 'response',\n 'content',\n 'fragment',\n 'document',\n ];\n const LATE_KEYS = [\n 'history',\n 'focus',\n 'scroll',\n ];\n function navigateDefaults(options) {\n if (options.navigate) {\n return up.fragment.config.navigateOptions;\n }\n }\n function normalizeURL({ url }) {\n if (url) {\n return { url: u.normalizeURL(url) };\n }\n }\n function removeUsePrefix(options) {\n u.renameKey(options, 'useData', 'data');\n u.renameKey(options, 'useHungry', 'hungry');\n u.renameKey(options, 'useKeep', 'keep');\n }\n function preprocess(options) {\n up.migrate.preprocessRenderOptions?.(options);\n up.layer.normalizeOptions(options);\n removeUsePrefix(options);\n const defaults = u.merge(up.fragment.config.renderOptions, navigateDefaults(options));\n return u.merge(u.omit(defaults, LATE_KEYS), { defaults }, { inputDevice: up.event.inputDevice }, options, normalizeURL(options), rememberOriginLayer(options));\n }\n function rememberOriginLayer({ origin, originLayer }) {\n if (origin && !originLayer) {\n return {\n originLayer: up.layer.get(origin),\n };\n }\n }\n function finalize(preprocessedOptions, lateDefaults) {\n return u.merge(preprocessedOptions.defaults, lateDefaults, preprocessedOptions);\n }\n function assertContentGiven(options) {\n if (!u.some(CONTENT_KEYS, contentKey => u.isGiven(options[contentKey]))) {\n if (options.defaultToEmptyContent) {\n options.content = '';\n }\n else {\n up.fail('up.render() needs either { ' + CONTENT_KEYS.join(', ') + ' } option');\n }\n }\n }\n function failOverrides(options) {\n const overrides = {};\n for (let key in options) {\n const value = options[key];\n let unprefixed = up.fragment.successKey(key);\n if (unprefixed) {\n overrides[unprefixed] = value;\n }\n }\n return overrides;\n }\n function deriveFailOptions(preprocessedOptions) {\n let overrides = failOverrides(preprocessedOptions);\n if (preprocessedOptions.failOptions) {\n return {\n ...preprocessedOptions.defaults,\n ...u.pick(preprocessedOptions, SHARED_KEYS),\n ...overrides,\n ...{ failPrefixForced: true }\n };\n }\n else {\n return {\n ...preprocessedOptions,\n ...overrides,\n };\n }\n }\n return {\n preprocess,\n finalize,\n assertContentGiven,\n deriveFailOptions,\n NO_PREVIEWS,\n NO_MOTION,\n NO_INPUT_INTERFERENCE,\n };\n})();\n\n\n/***/ }),\n/* 68 */\n/***/ (() => {\n\nup.RenderResult = class RenderResult extends up.Record {\n keys() {\n return [\n 'fragments',\n 'layer',\n 'target',\n 'options',\n 'finished',\n ];\n }\n defaults() {\n return {\n fragments: [],\n };\n }\n get none() {\n return !this.fragments.length;\n }\n get fragment() {\n return this.fragments[0];\n }\n static both(main, extension, mergeFinished = true) {\n if (!extension)\n return main;\n return new this({\n target: main.target,\n layer: main.layer,\n options: main.options,\n fragments: main.fragments.concat(extension.fragments),\n finished: (mergeFinished && this.mergeFinished(main, extension))\n });\n }\n static async mergeFinished(main, extension) {\n return this.both(await main.finished, await extension.finished, false);\n }\n static buildNone() {\n return new this({\n target: ':none',\n finished: Promise.resolve(),\n });\n }\n};\n\n\n/***/ }),\n/* 69 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nup.Request = (_a = class Request extends up.Record {\n keys() {\n return [\n 'method',\n 'url',\n 'hash',\n 'params',\n 'target',\n 'failTarget',\n 'headers',\n 'timeout',\n 'background',\n 'cache',\n 'expireCache',\n 'evictCache',\n 'layer',\n 'mode',\n 'context',\n 'failLayer',\n 'failMode',\n 'failContext',\n 'origin',\n 'builtAt',\n 'wrapMethod',\n 'contentType',\n 'payload',\n 'onLoading',\n 'fail',\n 'abortable',\n 'lateDelay',\n 'previews',\n ];\n }\n defaults() {\n return {\n state: 'new',\n abortable: true,\n headers: {},\n timeout: up.network.config.timeout,\n builtAt: new Date(),\n previews: [],\n };\n }\n constructor(options) {\n super(options);\n this.params = new up.Params(this.params);\n if (this.wrapMethod == null) {\n this.wrapMethod = up.network.config.wrapMethod;\n }\n this._normalize();\n if ((this.target || this.layer || this.origin) && !options.basic) {\n const layerLookupOptions = { origin: this.origin };\n this.layer = up.layer.get(this.layer, layerLookupOptions);\n this.failLayer = up.layer.get(this.failLayer, layerLookupOptions);\n this.context ||= this.layer.context || {};\n this.failContext ||= this.failLayer?.context || {};\n this.mode ||= this.layer.mode;\n this.failMode ||= this.failLayer?.mode;\n }\n this.bindLayer = options.bindLayer || this.layer;\n this._fragments = options.fragments;\n this._bindFragments = options.bindFragments;\n this._deferred = u.newDeferred();\n this._setAutoHeaders();\n }\n get effectiveLateTime() {\n if (this.background) {\n return false;\n }\n else {\n return this.lateDelay ?? u.evalOption(up.network.config.lateDelay, this);\n }\n }\n isTimed() {\n return u.isNumber(this.effectiveLateTime);\n }\n get xhr() {\n return this._xhr ??= new XMLHttpRequest();\n }\n get fragments() {\n return (this._fragments ||= this._findFragments());\n }\n _findFragments() {\n let steps = up.fragment.parseTargetSteps(this.target);\n let lookupOpts = { origin: this.origin, layer: this.layer };\n let matches = u.map(steps, (step) => up.fragment.get(step.selector, lookupOpts));\n return u.compact(matches);\n }\n get bindFragments() {\n return this._bindFragments || this.fragments;\n }\n get fragment() {\n return this.fragments?.[0];\n }\n _normalize() {\n this.method = u.normalizeMethod(this.method);\n this._extractHashFromURL();\n this._transferParamsToURL();\n this.url = u.normalizeURL(this.url);\n }\n _evictExpensiveAttrs() {\n u.task(() => {\n this.layer = undefined;\n this.failLayer = undefined;\n this._bindLayer = undefined;\n this.origin = undefined;\n this._fragments = undefined;\n this._bindFragments = undefined;\n });\n }\n _extractHashFromURL() {\n let match = this.url?.match(/^([^#]*)(#.+)$/);\n if (match) {\n this.url = match[1];\n return this.hash = match[2];\n }\n }\n _transferParamsToURL() {\n if (!this.url || this.allowsPayload() || u.isBlank(this.params)) {\n return;\n }\n this.url = this.params.toURL(this.url);\n this.params.clear();\n }\n isSafe() {\n return up.network.isSafeMethod(this.method);\n }\n allowsPayload() {\n return u.methodAllowsPayload(this.method);\n }\n will302RedirectWithGET() {\n return this.isSafe() || (this.method === 'POST');\n }\n willCache() {\n return u.evalAutoOption(this.cache, up.network.config.autoCache, this);\n }\n runQueuedCallbacks() {\n u.always(this, () => this._evictExpensiveAttrs());\n }\n load() {\n if (this.state !== 'new')\n return;\n if (this._emitLoad()) {\n this.state = 'loading';\n this._normalize();\n this.onLoading?.();\n this.expired = false;\n new up.Request.XHRRenderer(this).buildAndSend({\n onload: () => this._onXHRLoad(),\n onerror: () => this._onXHRError(),\n ontimeout: () => this._onXHRTimeout(),\n onabort: () => this._onXHRAbort()\n });\n return true;\n }\n else {\n this.abort({ reason: 'Prevented by event listener' });\n }\n }\n runPreviews(renderOptions) {\n if (!this.ended && !this.fromCache) {\n this._revertPreviews = up.status.runPreviews(this, renderOptions);\n }\n }\n _emitLoad() {\n let event = this.emit('up:request:load', { log: ['Loading %s', this.description] });\n return !event.defaultPrevented;\n }\n loadPage() {\n up.network.abort();\n new up.Request.FormRenderer(this).buildAndSubmit();\n }\n _onXHRLoad() {\n const response = this._extractResponseFromXHR();\n const log = 'Loaded ' + response.description;\n this.emit('up:request:loaded', { request: response.request, response, log });\n this.respondWith(response);\n }\n _onXHRError() {\n this._setOfflineState('Network error');\n }\n _onXHRTimeout() {\n this._setOfflineState('Timeout');\n }\n _onXHRAbort() {\n this._setAbortedState();\n }\n abort({ reason } = {}) {\n if (this._setAbortedState(reason) && this._xhr) {\n this._xhr.abort();\n }\n }\n _setAbortedState(reason) {\n if (this.ended)\n return;\n let message = 'Aborted request to ' + this.description + (reason ? ': ' + reason : '');\n this.state = 'aborted';\n this._reject(new up.Aborted(message));\n this.emit('up:request:aborted', { log: message });\n return true;\n }\n _setOfflineState(reason) {\n if (this.ended)\n return;\n let message = 'Cannot load request to ' + this.description + (reason ? ': ' + reason : '');\n this.state = 'offline';\n this.emit('up:request:offline', { log: message });\n this._reject(new up.Offline(message));\n }\n respondWith(response) {\n this.response = response;\n if (this.ended)\n return;\n this.state = 'loaded';\n if (response.ok) {\n this._resolve(response);\n }\n else {\n this._reject(response);\n }\n }\n _resolve(response) {\n this._onSettle();\n this._deferred.resolve(response);\n }\n _reject(responseOrError) {\n this._onSettle();\n this._deferred.reject(responseOrError);\n }\n _onSettle() {\n this._revertPreviews?.();\n }\n get ended() {\n return (this.state !== 'new') && (this.state !== 'loading') && (this.state !== 'tracking');\n }\n csrfHeader() {\n return up.protocol.csrfHeader();\n }\n csrfParam() {\n return up.protocol.csrfParam();\n }\n csrfToken() {\n if (!this.isSafe() && !this.isCrossOrigin()) {\n return up.protocol.csrfToken();\n }\n }\n isCrossOrigin() {\n return u.isCrossOrigin(this.url);\n }\n _extractResponseFromXHR() {\n const responseAttrs = {\n method: this.method,\n url: this.url,\n request: this,\n xhr: this.xhr,\n text: this.xhr.responseText,\n status: this.xhr.status,\n title: up.protocol.titleFromXHR(this.xhr),\n target: up.protocol.targetFromXHR(this.xhr),\n acceptLayer: up.protocol.acceptLayerFromXHR(this.xhr),\n dismissLayer: up.protocol.dismissLayerFromXHR(this.xhr),\n eventPlans: up.protocol.eventPlansFromXHR(this.xhr),\n context: up.protocol.contextFromXHR(this.xhr),\n expireCache: up.protocol.expireCacheFromXHR(this.xhr),\n evictCache: up.protocol.evictCacheFromXHR(this.xhr),\n fail: this.fail,\n };\n let methodFromResponse = up.protocol.methodFromXHR(this.xhr);\n let urlFromResponse = up.protocol.locationFromXHR(this.xhr);\n if (urlFromResponse) {\n if (!u.matchURLs(this.url, urlFromResponse)) {\n methodFromResponse ||= 'GET';\n }\n responseAttrs.url = urlFromResponse;\n }\n if (methodFromResponse) {\n responseAttrs.method = methodFromResponse;\n }\n return new up.Response(responseAttrs);\n }\n _buildEventEmitter(args) {\n return up.EventEmitter.fromEmitArgs(args, {\n layer: this.bindLayer,\n request: this,\n origin: this.origin\n });\n }\n emit(...args) {\n return this._buildEventEmitter(args).emit();\n }\n assertEmitted(...args) {\n this._buildEventEmitter(args).assertEmitted();\n }\n get description() {\n return this.method + ' ' + this.url;\n }\n isBoundToSubtrees(subtreeRoots) {\n subtreeRoots = u.wrapList(subtreeRoots);\n return u.some(this.bindFragments, function (fragment) {\n return u.some(subtreeRoots, (subtreeElement) => subtreeElement.contains(fragment));\n });\n }\n isBoundToLayers(layers) {\n return u.contains(layers, this.bindLayer);\n }\n get age() {\n return new Date() - this.builtAt;\n }\n header(name) {\n return this.headers[name];\n }\n _setAutoHeaders() {\n for (let key of ['target', 'failTarget', 'mode', 'failMode', 'context', 'failContext']) {\n this._setPropertyHeader(key);\n }\n let csrfHeader, csrfToken;\n if ((csrfHeader = this.csrfHeader()) && (csrfToken = this.csrfToken())) {\n this._setAutoHeader(csrfHeader, csrfToken);\n }\n this._setAutoHeader(up.protocol.headerize('version'), up.version);\n }\n _setPropertyHeader(key) {\n this._setAutoHeader(up.protocol.headerize(key), this[key]);\n }\n _setAutoHeader(name, value) {\n if (u.isMissing(value)) {\n return;\n }\n if (u.isOptions(value) || u.isArray(value)) {\n value = u.safeStringifyJSON(value);\n }\n this.headers[name] = value;\n }\n mergeIfUnsent(trackingRequest) {\n if (this.state !== 'new')\n return;\n if (!this.target || !trackingRequest.target)\n return;\n let targetAtoms = up.fragment.splitTarget(this.target + ',' + trackingRequest.target);\n this.target = u.uniq(targetAtoms).join(', ');\n this._setPropertyHeader('target');\n this._fragments = u.uniq([...this.fragments, ...trackingRequest.fragments]);\n }\n static tester(condition, { except } = {}) {\n let testFn;\n if (u.isFunction(condition)) {\n testFn = condition;\n }\n else if (condition instanceof this) {\n testFn = (request) => condition === request;\n }\n else if (u.isString(condition)) {\n let pattern = new up.URLPattern(condition);\n testFn = (request) => pattern.test(request.url);\n }\n else {\n testFn = (_request) => condition;\n }\n if (except) {\n return (request) => !up.cache.willHaveSameResponse(request, except) && testFn(request);\n }\n else {\n return testFn;\n }\n }\n },\n (() => {\n u.delegatePromise(_a.prototype, function () { return this._deferred; });\n })(),\n _a);\n\n\n/***/ }),\n/* 70 */\n/***/ (() => {\n\nconst u = up.util;\nclass Route {\n constructor() {\n this.varyHeaders = new Set();\n this.requests = [];\n }\n matchBest(newRequest) {\n let matches = this.requests.filter((cachedRequest) => this.satisfies(cachedRequest, newRequest));\n return u.last(matches);\n }\n delete(request) {\n u.remove(this.requests, request);\n }\n put(request) {\n this.requests.push(request);\n }\n updateVary(response) {\n for (let headerName of response.varyHeaderNames) {\n this.varyHeaders.add(headerName);\n }\n }\n satisfies(cachedRequest, newRequest) {\n if (cachedRequest === newRequest)\n return true;\n return u.every(this.varyHeaders, (varyHeader) => {\n let cachedValue = cachedRequest.header(varyHeader);\n let newValue = newRequest.header(varyHeader);\n if (varyHeader === 'X-Up-Target' || varyHeader === 'X-Up-Fail-Target') {\n if (!cachedValue)\n return true;\n if (!newValue)\n return false;\n let cachedTokens = up.fragment.splitTarget(cachedValue);\n let newTokens = up.fragment.splitTarget(newValue);\n return u.containsAll(cachedTokens, newTokens);\n }\n else {\n return cachedValue === newValue;\n }\n });\n }\n}\nup.Request.Cache = class Cache {\n constructor() {\n this.reset();\n }\n reset() {\n this._routes = {};\n this._requests = [];\n }\n get(request) {\n request = this._wrap(request);\n let route = this._getRoute(request);\n let cachedRequest = route.matchBest(request);\n if (cachedRequest) {\n if (this._isUsable(cachedRequest)) {\n return cachedRequest;\n }\n else {\n this._delete(request, route);\n }\n }\n }\n async put(request) {\n request = this._wrap(request);\n let route = this._getRoute(request);\n let { response } = request;\n if (response)\n route.updateVary(response);\n let superseded = route.requests.filter((oldRequest) => route.satisfies(request, oldRequest));\n for (let r of superseded) {\n this._delete(r);\n }\n request.cacheRoute = route;\n route.put(request);\n this._requests.push(request);\n this._limitSize();\n }\n alias(existingCachedRequest, newRequest) {\n existingCachedRequest = this.get(existingCachedRequest);\n if (!existingCachedRequest)\n return;\n newRequest = this._wrap(newRequest);\n this.track(existingCachedRequest, newRequest, { force: true });\n this.put(newRequest);\n return newRequest;\n }\n async track(existingRequest, newRequest, options = {}) {\n newRequest.trackedRequest = existingRequest;\n newRequest.state = 'tracking';\n let value;\n if (existingRequest.ended && existingRequest.response) {\n value = existingRequest.response;\n }\n else {\n value = await u.always(existingRequest);\n }\n if (value instanceof up.Response) {\n if (options.force || existingRequest.cacheRoute.satisfies(existingRequest, newRequest)) {\n newRequest.fromCache = true;\n value = u.variant(value, { request: newRequest });\n newRequest.respondWith(value);\n u.delegate(newRequest, ['expired', 'state'], () => existingRequest);\n }\n else {\n delete newRequest.trackedRequest;\n newRequest.state = 'new';\n options.onIncompatible?.(newRequest);\n }\n }\n else {\n newRequest.state = existingRequest.state;\n newRequest._reject(value);\n }\n }\n willHaveSameResponse(existingRequest, newRequest) {\n return existingRequest === newRequest || existingRequest === newRequest.trackedRequest;\n }\n evict(condition = true, testerOptions) {\n this._eachMatch(condition, testerOptions, (request) => this._delete(request));\n }\n expire(condition = true, testerOptions) {\n this._eachMatch(condition, testerOptions, (request) => request.expired = true);\n }\n reindex(request) {\n this._delete(request);\n delete request.cacheRoute;\n this.put(request);\n }\n _delete(request) {\n u.remove(this._requests, request);\n request.cacheRoute?.delete(request);\n }\n _getRoute(request) {\n return request.cacheRoute || (this._routes[request.description] ||= new Route());\n }\n _isUsable(request) {\n return request.age < up.network.config.cacheEvictAge;\n }\n get currentSize() {\n return this._requests.length;\n }\n get _capacity() {\n return up.network.config.cacheSize;\n }\n _limitSize() {\n for (let i = 0; i < (this.currentSize - this._capacity); i++) {\n this._delete(this._requests[0]);\n }\n }\n _eachMatch(condition = true, testerOptions, fn) {\n let tester = up.Request.tester(condition, testerOptions);\n let results = u.filter(this._requests, tester);\n u.each(results, fn);\n }\n _wrap(requestOrOptions) {\n return u.wrapValue(up.Request, requestOrOptions);\n }\n};\n\n\n/***/ }),\n/* 71 */\n/***/ (() => {\n\nconst u = up.util;\nup.Request.Queue = class Queue {\n constructor() {\n this.reset();\n }\n reset() {\n this._queuedRequests = [];\n this._currentRequests = [];\n this._emittedLate = false;\n }\n get allRequests() {\n return this._currentRequests.concat(this._queuedRequests);\n }\n asap(request) {\n request.runQueuedCallbacks();\n u.always(request, responseOrError => this._onRequestSettled(request, responseOrError));\n this._scheduleSlowTimer(request);\n this._queueRequest(request);\n queueMicrotask(() => this._poke());\n }\n promoteToForeground(request) {\n if (request.background) {\n request.background = false;\n this._scheduleSlowTimer(request);\n }\n }\n _scheduleSlowTimer(request) {\n if (!request.isTimed())\n return;\n let timeUntilLate = Math.max(request.effectiveLateTime - request.age);\n u.timer(timeUntilLate, () => this._checkForLate());\n }\n _getMaxConcurrency() {\n return u.evalOption(up.network.config.concurrency);\n }\n _hasConcurrencyLeft() {\n const maxConcurrency = this._getMaxConcurrency();\n return (maxConcurrency === -1) || (this._currentRequests.length < maxConcurrency);\n }\n isBusy() {\n return this._currentRequests.length > 0 || this._queuedRequests.length > 0;\n }\n _queueRequest(request) {\n this._queuedRequests.push(request);\n }\n _pluckNextRequest() {\n let request = u.find(this._queuedRequests, request => !request.background);\n request ||= this._queuedRequests[0];\n return u.remove(this._queuedRequests, request);\n }\n _sendRequestNow(request) {\n if (request.load()) {\n this._currentRequests.push(request);\n }\n }\n _onRequestSettled(request, responseOrError) {\n u.remove(this._currentRequests, request) || u.remove(this._queuedRequests, request);\n if ((responseOrError instanceof up.Response) && responseOrError.ok) {\n up.network.registerAliasForRedirect(request, responseOrError);\n }\n queueMicrotask(() => this._poke());\n u.task(() => this._checkForRecover());\n }\n _poke() {\n let request;\n if (this._hasConcurrencyLeft() && (request = this._pluckNextRequest())) {\n return this._sendRequestNow(request);\n }\n }\n abort(...args) {\n let [conditions = true, { except, reason, logOnce }] = u.args(args, 'val', 'options');\n let tester = up.Request.tester(conditions, { except });\n for (let list of [this._currentRequests, this._queuedRequests]) {\n const abortableRequests = u.filter(list, tester);\n for (let abortableRequest of abortableRequests) {\n if (logOnce) {\n up.puts(...logOnce);\n logOnce = null;\n }\n abortableRequest.abort({ reason });\n u.remove(list, abortableRequest);\n }\n }\n }\n _checkForLate() {\n if (!this._emittedLate && this._hasLateTimedRequests()) {\n this._emittedLate = true;\n up.emit('up:network:late', { log: 'Server is slow to respond' });\n }\n }\n _checkForRecover() {\n if (this._emittedLate && !this._timedRequests.length) {\n this._emittedLate = false;\n up.emit('up:network:recover', { log: 'Slow requests were loaded' });\n }\n }\n get _timedRequests() {\n return this.allRequests.filter((request) => request.isTimed());\n }\n _hasLateTimedRequests() {\n const timerTolerance = 1;\n const isLate = (request) => request.age >= (request.effectiveLateTime - timerTolerance);\n return u.some(this._timedRequests, isLate);\n }\n};\n\n\n/***/ }),\n/* 72 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nconst HTML_FORM_METHODS = ['GET', 'POST'];\nup.Request.FormRenderer = class FormRenderer {\n constructor(request) {\n this._request = request;\n }\n buildAndSubmit() {\n this.params = u.copy(this._request.params);\n let action = this._request.url;\n let { method } = this._request;\n const paramsFromQuery = up.Params.fromURL(action);\n this.params.addAll(paramsFromQuery);\n action = up.Params.stripURL(action);\n if (!u.contains(HTML_FORM_METHODS, method)) {\n method = up.protocol.wrapMethod(method, this.params);\n }\n this._form = e.affix(document.body, 'form.up-request-loader', { method, action });\n let contentType = this._request.contentType;\n if (contentType) {\n this._form.setAttribute('enctype', contentType);\n }\n let csrfParam, csrfToken;\n if ((csrfParam = this._request.csrfParam()) && (csrfToken = this._request.csrfToken())) {\n this.params.add(csrfParam, csrfToken);\n }\n u.each(this.params.toArray(), this._addField.bind(this));\n up.browser.submitForm(this._form);\n }\n _addField(attrs) {\n e.affix(this._form, 'input[type=hidden]', attrs);\n }\n};\n\n\n/***/ }),\n/* 73 */\n/***/ (() => {\n\nvar _a;\nconst CONTENT_TYPE_URL_ENCODED = 'application/x-www-form-urlencoded';\nconst CONTENT_TYPE_FORM_DATA = 'multipart/form-data';\nconst u = up.util;\nup.Request.XHRRenderer = (_a = class XHRRenderer {\n constructor(request) {\n this._request = request;\n }\n buildAndSend(handlers) {\n const xhr = this._request.xhr;\n this._params = u.copy(this._request.params);\n if (this._request.timeout) {\n xhr.timeout = this._request.timeout;\n }\n xhr.open(this._getMethod(), this._request.url);\n let contentType = this._getContentType();\n if (contentType) {\n xhr.setRequestHeader('Content-Type', contentType);\n }\n for (let headerName in this._request.headers) {\n let headerValue = this._request.headers[headerName];\n xhr.setRequestHeader(headerName, headerValue);\n }\n Object.assign(xhr, handlers);\n xhr.send(this._getPayload());\n }\n _getMethod() {\n let method = this._request.method;\n if (this._request.wrapMethod && !this._request.will302RedirectWithGET()) {\n method = up.protocol.wrapMethod(method, this._params);\n }\n return method;\n }\n _getContentType() {\n this._finalizePayload();\n return this._contentType;\n }\n _getPayload() {\n this._finalizePayload();\n return this._payload;\n }\n _finalizePayload() {\n this._payload = this._request.payload;\n this._contentType = this._request.contentType;\n if (!this._payload && this._request.allowsPayload()) {\n if (!this._contentType) {\n this._contentType = this._params.hasBinaryValues() ? CONTENT_TYPE_FORM_DATA : CONTENT_TYPE_URL_ENCODED;\n }\n if (this._contentType === CONTENT_TYPE_FORM_DATA) {\n this._contentType = null;\n this._payload = this._params.toFormData();\n }\n else {\n this._payload = this._params.toQuery().replace(/%20/g, '+');\n }\n }\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _finalizePayload: true,\n _getMethod: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 74 */\n/***/ (() => {\n\nconst u = up.util;\nup.Response = class Response extends up.Record {\n keys() {\n return [\n 'method',\n 'url',\n 'text',\n 'status',\n 'request',\n 'xhr',\n 'target',\n 'title',\n 'acceptLayer',\n 'dismissLayer',\n 'eventPlans',\n 'context',\n 'expireCache',\n 'evictCache',\n 'headers',\n 'loadedAt',\n 'fail',\n ];\n }\n defaults() {\n return {\n headers: {},\n loadedAt: new Date()\n };\n }\n get ok() {\n return !u.evalOption(this.fail ?? up.network.config.fail, this);\n }\n get none() {\n return !this.text;\n }\n header(name) {\n return this.headers[name] || this.xhr?.getResponseHeader(name);\n }\n get varyHeaderNames() {\n let varyHeaderValue = this.header('Vary');\n return u.getSimpleTokens(varyHeaderValue, { separator: ',' });\n }\n get contentType() {\n return this.header('Content-Type');\n }\n get cspNonces() {\n return up.protocol.cspNoncesFromHeader(this.header('Content-Security-Policy') || this.header('Content-Security-Policy-Report-Only'));\n }\n get lastModified() {\n let header = this.header('Last-Modified');\n if (header) {\n return new Date(header);\n }\n }\n get etag() {\n return this.header('ETag');\n }\n get json() {\n return this.parsedJSON ||= JSON.parse(this.text);\n }\n get age() {\n let now = new Date();\n return now - this.loadedAt;\n }\n get expired() {\n return this.age > up.network.config.cacheExpireAge ||\n this.request.expired;\n }\n get description() {\n return `HTTP ${this.status} response to ${this.request.description}`;\n }\n};\n\n\n/***/ }),\n/* 75 */\n/***/ (() => {\n\nvar _a;\nconst u = up.util;\nconst e = up.element;\nconst FULL_DOCUMENT_PATTERN = /^\\s*<(html|!DOCTYPE)\\b/i;\nup.ResponseDoc = (_a = class ResponseDoc {\n constructor({ document, fragment, content, target, origin, data, cspNonces, match }) {\n if (document) {\n this._parseDocument(document, origin, data);\n }\n else if (fragment) {\n this._parseFragment(fragment, origin, data);\n }\n else {\n this._parseContent(content || '', origin, target, data);\n }\n this._cspNonces = cspNonces;\n if (origin) {\n let originSelector = up.fragment.tryToTarget(origin);\n if (originSelector) {\n this._rediscoveredOrigin = this.select(originSelector);\n }\n }\n this._match = match;\n }\n _parseDocument(value, origin, data) {\n if (value instanceof Document) {\n this._document = value;\n this._isFullDocument = true;\n }\n else if (u.isString(value)) {\n this._isFullDocument = FULL_DOCUMENT_PATTERN.test(value);\n let htmlParser = (html) => [e.createBrokenDocumentFromHTML(html)];\n let nodes = up.fragment.provideNodes(value, { origin, data, htmlParser });\n if (nodes[0] instanceof Document) {\n this._document = nodes[0];\n }\n else {\n this._document = this._buildFauxDocument(nodes);\n }\n }\n else {\n this._document = this._buildFauxDocument(value);\n }\n }\n _parseDocumentFromHTML(html) {\n return e.createBrokenDocumentFromHTML(html);\n }\n _parseFragment(value, origin, data) {\n let element = e.extractSingular(up.fragment.provideNodes(value, { origin, data }));\n this._document = this._buildFauxDocument(element);\n }\n _parseContent(value, origin, target, data) {\n if (!target)\n up.fail(\"must pass a { target } when passing { content }\");\n let simplifiedTarget = u.map(up.fragment.parseTargetSteps(target), 'selector').join();\n let nodes = up.fragment.provideNodes(value, { origin, data });\n let matchingElement = e.createFromSelector(simplifiedTarget, { content: nodes });\n this._document = this._buildFauxDocument(matchingElement);\n }\n _buildFauxDocument(nodes) {\n nodes = u.wrapList(nodes);\n let fauxDocument = document.createElement('up-document');\n fauxDocument.append(...nodes);\n return fauxDocument;\n }\n rootSelector() {\n return up.fragment.toTarget(this._document.children[0]);\n }\n get title() {\n return this._fromHead(this._getTitleText);\n }\n _getHead() {\n if (this._isFullDocument) {\n return this._document.head;\n }\n }\n _fromHead(fn) {\n let head = this._getHead();\n return head && fn(head);\n }\n get metaTags() {\n return this._fromHead(up.history.findMetaTags);\n }\n get assets() {\n return this._fromHead(up.script.findAssets);\n }\n get lang() {\n if (this._isFullDocument) {\n return up.history.getLang(this._document);\n }\n }\n _getTitleText(head) {\n return head.querySelector('title')?.textContent;\n }\n select(selector) {\n let finder = new up.FragmentFinder({\n selector: selector,\n origin: this._rediscoveredOrigin,\n document: this._document,\n match: this._match,\n });\n return finder.find();\n }\n selectSteps(steps) {\n return steps.filter((step) => {\n return this._trySelectStep(step) || this._cannotMatchStep(step);\n });\n }\n commitSteps(steps) {\n return steps.filter((step) => this.commitElement(step.newElement));\n }\n _trySelectStep(step) {\n if (step.newElement) {\n return true;\n }\n let newElement = this.select(step.selector);\n if (!newElement) {\n return;\n }\n let { selectEvent } = step;\n if (selectEvent) {\n selectEvent.newFragment = newElement;\n selectEvent.renderOptions = step.originalRenderOptions;\n up.emit(step.oldElement, selectEvent, { callback: step.selectCallback });\n if (selectEvent.defaultPrevented) {\n return;\n }\n }\n step.newElement = newElement;\n return true;\n }\n _cannotMatchStep(step) {\n if (!step.maybe) {\n throw new up.CannotMatch();\n }\n }\n commitElement(element) {\n if (this._document.contains(element)) {\n if (!up.fragment.config.runScripts) {\n up.script.disableSubtree(element);\n }\n element.remove();\n return true;\n }\n }\n finalizeElement(element) {\n up.NonceableCallback.adoptNonces(element, this._cspNonces);\n if (this._document instanceof Document) {\n let brokenElements = e.subtree(element, ':is(noscript,script,audio,video):not(.up-keeping, .up-keeping *)');\n u.each(brokenElements, e.fixParserDamage);\n }\n }\n },\n (() => {\n u.memoizeMethod(_a.prototype, {\n _getHead: true,\n });\n })(),\n _a);\n\n\n/***/ }),\n/* 76 */\n/***/ (() => {\n\nconst e = up.element;\nconst u = up.util;\nup.RevealMotion = class RevealMotion {\n constructor(element, options = {}) {\n this._element = element;\n this._viewport = e.get(options.viewport) || up.viewport.get(this._element);\n this._obstructionsLayer = up.layer.get(this._viewport);\n this._behavior = options.scrollBehavior ?? options.behavior ?? 'instant';\n const viewportConfig = up.viewport.config;\n this._snap = options.snap ?? options.revealSnap ?? viewportConfig.revealSnap;\n this._padding = options.padding ?? options.revealPadding ?? viewportConfig.revealPadding;\n this._top = options.top ?? options.revealTop ?? viewportConfig.revealTop;\n this._max = options.max ?? options.revealMax ?? viewportConfig.revealMax;\n this._topObstructionSelector = viewportConfig.selector('fixedTopSelectors');\n this._bottomObstructionSelector = viewportConfig.selector('fixedBottomSelectors');\n }\n start() {\n const viewportRect = this._getViewportRect(this._viewport);\n const elementRect = up.Rect.fromElement(this._element);\n if (this._max) {\n const maxPixels = u.evalOption(this._max, this._element);\n elementRect.height = Math.min(elementRect.height, maxPixels);\n }\n elementRect.grow(this._padding);\n this._substractObstructions(viewportRect);\n if (viewportRect.height < 0) {\n up.fail('Viewport has no visible area');\n }\n const originalScrollTop = this._viewport.scrollTop;\n let newScrollTop = originalScrollTop;\n if (this._top || (elementRect.height > viewportRect.height)) {\n const diff = elementRect.top - viewportRect.top;\n newScrollTop += diff;\n }\n else if (elementRect.top < viewportRect.top) {\n newScrollTop -= (viewportRect.top - elementRect.top);\n }\n else if (elementRect.bottom > viewportRect.bottom) {\n newScrollTop += (elementRect.bottom - viewportRect.bottom);\n }\n else {\n }\n if (u.isNumber(this._snap) && (newScrollTop < this._snap) && (elementRect.top < (0.5 * viewportRect.height))) {\n newScrollTop = 0;\n }\n if (newScrollTop !== originalScrollTop) {\n this._viewport.scrollTo({ top: newScrollTop, behavior: this._behavior });\n }\n }\n _getViewportRect() {\n if (up.viewport.isRoot(this._viewport)) {\n return new up.Rect({\n left: 0,\n top: 0,\n width: up.viewport.rootWidth(),\n height: up.viewport.rootHeight()\n });\n }\n else {\n return up.Rect.fromElement(this._viewport);\n }\n }\n _selectObstructions(selector) {\n let elements = up.fragment.all(selector, { layer: this._obstructionsLayer });\n return u.filter(elements, e.isVisible);\n }\n _substractObstructions(viewportRect) {\n for (let obstruction of this._selectObstructions(this._topObstructionSelector)) {\n let obstructionRect = up.Rect.fromElement(obstruction);\n let diff = obstructionRect.bottom - viewportRect.top;\n if (diff > 0) {\n viewportRect.top += diff;\n viewportRect.height -= diff;\n }\n }\n for (let obstruction of this._selectObstructions(this._bottomObstructionSelector)) {\n let obstructionRect = up.Rect.fromElement(obstruction);\n let diff = viewportRect.bottom - obstructionRect.top;\n if (diff > 0) {\n viewportRect.height -= diff;\n }\n }\n }\n};\n\n\n/***/ }),\n/* 77 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Selector = class Selector {\n constructor(selector, elementOrDocument, options = {}) {\n this._filters = [];\n let matchingInExternalDocument = elementOrDocument && !document.contains(elementOrDocument);\n if (!matchingInExternalDocument && !options.destroying) {\n this._filters.push(up.fragment.isNotDestroying);\n }\n this._ignoreLayers = matchingInExternalDocument || options.layer === 'any' || up.layer.count === 1;\n let expandTargetLayer;\n if (this._ignoreLayers) {\n expandTargetLayer = up.layer.root;\n }\n else {\n options.layer ??= u.presence(elementOrDocument, u.isElement);\n this._layers = up.layer.getAll(options);\n if (!this._layers.length)\n throw new up.CannotMatch([\"Unknown layer: %o\", options.layer]);\n this._filters.push(match => u.some(this._layers, layer => layer.contains(match)));\n expandTargetLayer = this._layers[0];\n }\n this._selectors = up.fragment.expandTargets(selector, { ...options, layer: expandTargetLayer });\n this._unionSelector = this._selectors.join() || 'match-none';\n }\n matches(element) {\n return e.elementLikeMatches(element, this._unionSelector) && this._passesFilter(element);\n }\n closest(element) {\n return this._filterOne(element.closest(this._unionSelector));\n }\n descendants(root = document) {\n return this._filterMany(root.querySelectorAll(this._unionSelector));\n }\n firstDescendant(root) {\n if (this._ignoreLayers) {\n root ||= document;\n return this._firstSelectorMatch((selector) => root.querySelectorAll(selector));\n }\n else {\n return u.findResult(this._layers, (layer) => {\n return this._firstSelectorMatch((selector) => e.subtree(layer.element, selector));\n });\n }\n }\n subtree(root) {\n return this._filterMany(e.subtree(root, this._unionSelector));\n }\n _firstSelectorMatch(fn) {\n return u.findResult(this._selectors, (selector) => {\n return this._filterMany(fn(selector))[0];\n });\n }\n _passesFilter(element) {\n return element && u.every(this._filters, filter => filter(element));\n }\n _filterOne(element) {\n return u.presence(element, this._passesFilter.bind(this));\n }\n _filterMany(elements) {\n return u.filter(elements, this._passesFilter.bind(this));\n }\n};\n\n\n/***/ }),\n/* 78 */\n/***/ (() => {\n\nconst u = up.util;\nconst e = up.element;\nup.Tether = class Tether {\n constructor(options) {\n up.migrate.handleTetherOptions?.(options);\n this._anchor = options.anchor;\n this._align = options.align;\n this._position = options.position;\n this._alignAxis = (this._position === 'top') || (this._position === 'bottom') ? 'horizontal' : 'vertical';\n this._viewport = up.viewport.get(this._anchor);\n this.parent = this._viewport === e.root ? document.body : this._viewport;\n this._syncOnScroll = !this._viewport.contains(this._anchor.offsetParent);\n }\n start(element) {\n this._element = element;\n this._element.style.position = 'absolute';\n this._setOffset(0, 0);\n this.sync();\n this._changeEventSubscription('on');\n }\n stop() {\n this._changeEventSubscription('off');\n }\n _changeEventSubscription(fn) {\n let doScheduleSync = this._scheduleSync.bind(this);\n up[fn](window, 'resize', doScheduleSync);\n if (this._syncOnScroll) {\n up[fn](this._viewport, 'scroll', doScheduleSync);\n }\n }\n _scheduleSync() {\n clearTimeout(this.syncTimer);\n return this.syncTimer = u.task(this.sync.bind(this));\n }\n isDetached() {\n return !this.parent.isConnected || !this._anchor.isConnected;\n }\n sync() {\n const elementBox = this._element.getBoundingClientRect();\n const elementMargin = {\n top: e.styleNumber(this._element, 'margin-top'),\n right: e.styleNumber(this._element, 'margin-right'),\n bottom: e.styleNumber(this._element, 'margin-bottom'),\n left: e.styleNumber(this._element, 'margin-left')\n };\n const anchorBox = this._anchor.getBoundingClientRect();\n let left;\n let top;\n switch (this._alignAxis) {\n case 'horizontal': {\n switch (this._position) {\n case 'top':\n top = anchorBox.top - elementMargin.bottom - elementBox.height;\n break;\n case 'bottom':\n top = anchorBox.top + anchorBox.height + elementMargin.top;\n break;\n }\n switch (this._align) {\n case 'left':\n left = anchorBox.left + elementMargin.left;\n break;\n case 'center':\n left = anchorBox.left + (0.5 * (anchorBox.width - elementBox.width));\n break;\n case 'right':\n left = (anchorBox.left + anchorBox.width) - elementBox.width - elementMargin.right;\n break;\n }\n break;\n }\n case 'vertical': {\n switch (this._align) {\n case 'top':\n top = anchorBox.top + elementMargin.top;\n break;\n case 'center':\n top = anchorBox.top + (0.5 * (anchorBox.height - elementBox.height));\n break;\n case 'bottom':\n top = (anchorBox.top + anchorBox.height) - elementBox.height - elementMargin.bottom;\n break;\n }\n switch (this._position) {\n case 'left':\n left = anchorBox.left - elementMargin.right - elementBox.width;\n break;\n case 'right':\n left = anchorBox.left + anchorBox.width + elementMargin.left;\n break;\n }\n break;\n }\n }\n if (u.isDefined(left) || u.isDefined(top)) {\n this._moveTo(left, top);\n }\n else {\n up.fail('Invalid tether constraints: %o', this._describeConstraints());\n }\n }\n _describeConstraints() {\n return { position: this._position, align: this._align };\n }\n _moveTo(targetLeft, targetTop) {\n const elementBox = this._element.getBoundingClientRect();\n this._setOffset((targetLeft - elementBox.left) + this.offsetLeft, (targetTop - elementBox.top) + this.offsetTop);\n }\n _setOffset(left, top) {\n this.offsetLeft = left;\n this.offsetTop = top;\n e.setStyle(this._element, { left, top }, 'px');\n }\n};\n\n\n/***/ }),\n/* 79 */\n/***/ (() => {\n\nconst u = up.util;\nup.URLPattern = class URLPattern {\n constructor(fullPattern) {\n this._groups = [];\n const positiveList = [];\n const negativeList = [];\n for (let pattern of u.getSimpleTokens(fullPattern)) {\n if (pattern[0] === '-') {\n negativeList.push(pattern.substring(1));\n }\n else {\n positiveList.push(pattern);\n }\n }\n this._positiveRegexp = this._buildRegexp(positiveList, true);\n this._negativeRegexp = this._buildRegexp(negativeList, false);\n }\n _buildRegexp(list, capture) {\n if (!list.length) {\n return;\n }\n list = u.flatMap(list, u.matchableURLPatternAtom);\n list = list.map(u.escapeRegExp);\n let reCode = list.join('|');\n reCode = reCode.replace(/\\\\\\*/g, '.*?');\n reCode = reCode.replace(/(:|\\\\\\$)([a-z][\\w-]*)/ig, (match, type, name) => {\n if (type === '\\\\$') {\n if (capture) {\n this._groups.push({ name, cast: Number });\n }\n return '(\\\\d+)';\n }\n else {\n if (capture) {\n this._groups.push({ name, cast: String });\n }\n return '([^/?#]+)';\n }\n });\n return new RegExp('^(?:' + reCode + ')$');\n }\n test(url, doNormalize = true) {\n if (doNormalize) {\n url = u.matchableURL(url);\n }\n return this._positiveRegexp.test(url) && !this._isExcluded(url);\n }\n recognize(url, doNormalize = true) {\n if (doNormalize) {\n url = u.matchableURL(url);\n }\n let match = this._positiveRegexp.exec(url);\n if (match && !this._isExcluded(url)) {\n const resolution = {};\n this._groups.forEach((group, groupIndex) => {\n let value = match[groupIndex + 1];\n if (value) {\n return resolution[group.name] = group.cast(value);\n }\n });\n return resolution;\n }\n }\n _isExcluded(url) {\n return this._negativeRegexp?.test(url);\n }\n};\n\n\n/***/ }),\n/* 80 */\n/***/ (() => {\n\nup.framework = (function () {\n let readyState = 'evaling';\n function emitReset() {\n up.emit('up:framework:reset', { log: false });\n }\n function boot() {\n if (readyState !== 'configuring') {\n console.error('Unpoly has already booted');\n return;\n }\n let issue = supportIssue();\n if (!issue) {\n readyState = 'booting';\n up.emit('up:framework:boot', { log: false });\n readyState = 'booted';\n up.emit('up:framework:booted', { log: false });\n }\n else {\n console.error(\"Unpoly cannot boot: %s\", issue);\n }\n }\n function mustBootManually() {\n let unpolyScript = document.currentScript;\n if (unpolyScript?.async) {\n return true;\n }\n if (unpolyScript?.getAttribute('up-boot') === 'manual') {\n return true;\n }\n if (document.readyState === 'complete') {\n return true;\n }\n }\n function onEvaled() {\n up.emit('up:framework:evaled', { log: false });\n if (mustBootManually()) {\n console.debug('Call up.boot() after you have configured Unpoly');\n }\n else {\n document.addEventListener('DOMContentLoaded', boot);\n }\n readyState = 'configuring';\n }\n function startExtension() {\n if (readyState !== 'configuring') {\n throw new Error('Unpoly extensions must be loaded before booting');\n }\n readyState = 'evaling';\n }\n function stopExtension() {\n readyState = 'configuring';\n }\n function isSupported() {\n return !supportIssue();\n }\n function supportIssue() {\n for (let feature of ['Promise', 'DOMParser', 'FormData', 'reportError']) {\n if (!window[feature]) {\n return `Browser doesn't support the ${feature} API`;\n }\n }\n if (document.compatMode === 'BackCompat') {\n return 'Browser is in quirks mode (missing DOCTYPE?)';\n }\n for (let selector of [':is(*)', ':has(*)']) {\n if (!CSS.supports(`selector(${selector})`)) {\n return `Browser doesn't support the ${selector} selector`;\n }\n }\n }\n return {\n onEvaled,\n boot,\n startExtension,\n stopExtension,\n reset: emitReset,\n get evaling() { return readyState === 'evaling'; },\n get booted() { return readyState === 'booted'; },\n get beforeBoot() { return readyState !== 'booting' && readyState !== 'booted'; },\n isSupported,\n };\n})();\nup.boot = up.framework.boot;\n\n\n/***/ }),\n/* 81 */\n/***/ (() => {\n\nup.event = (function () {\n const u = up.util;\n const e = up.element;\n function reset() {\n for (let globalElement of [window, document, e.root, document.body]) {\n for (let listener of up.EventListener.allNonDefault(globalElement)) {\n listener.unbind();\n }\n }\n }\n function on(...args) {\n return buildListenerGroup(args).bind();\n }\n function off(...args) {\n return buildListenerGroup(args).unbind();\n }\n function buildListenerGroup(args, options) {\n return up.EventListenerGroup.fromBindArgs(args, options);\n }\n function buildEmitter(args) {\n return up.EventEmitter.fromEmitArgs(args);\n }\n function emit(...args) {\n return buildEmitter(args).emit();\n }\n function build(...args) {\n const props = u.extractOptions(args);\n const type = args[0] || props.type || up.fail('Missing event type');\n const event = new Event(type, { bubbles: true, cancelable: true });\n Object.assign(event, u.omit(props, ['type', 'target']));\n return event;\n }\n function assertEmitted(...args) {\n return buildEmitter(args).assertEmitted();\n }\n function onEscape(listener) {\n return on('keydown', function (event) {\n if (event.key === 'Escape') {\n return listener(event);\n }\n });\n }\n function halt(event, options = {}) {\n if (options.log)\n up.log.putsEvent(event);\n event.stopImmediatePropagation();\n event.preventDefault();\n }\n const keyModifiers = ['metaKey', 'shiftKey', 'ctrlKey', 'altKey'];\n function isUnmodified(event) {\n return (u.isUndefined(event.button) || (event.button === 0)) &&\n !u.some(keyModifiers, modifier => event[modifier]);\n }\n function isSyntheticClick(event) {\n return u.isMissing(event.clientX);\n }\n function fork(originalEvent, newType, copyKeys = []) {\n const newEvent = build(newType, u.pick(originalEvent, copyKeys));\n newEvent.originalEvent = originalEvent;\n ['stopPropagation', 'stopImmediatePropagation', 'preventDefault'].forEach(function (key) {\n const originalMethod = newEvent[key];\n return newEvent[key] = function () {\n originalEvent[key]();\n return originalMethod.call(newEvent);\n };\n });\n if (originalEvent.defaultPrevented) {\n newEvent.preventDefault();\n }\n return newEvent;\n }\n function executeEmitAttr(event, element) {\n if (!isUnmodified(event)) {\n return;\n }\n const eventType = e.attr(element, 'up-emit');\n const eventProps = e.jsonAttr(element, 'up-emit-props');\n const forkedEvent = fork(event, eventType);\n Object.assign(forkedEvent, eventProps);\n up.emit(element, forkedEvent);\n }\n on('up:click', '[up-emit]', executeEmitAttr);\n let inputDevices = ['unknown'];\n function getInputDevice() {\n return u.last(inputDevices);\n }\n function observeInputDevice(newModality) {\n inputDevices.push(newModality);\n setTimeout(() => inputDevices.pop());\n }\n on('keydown keyup', { capture: true }, () => observeInputDevice('key'));\n on('pointerdown pointerup', { capture: true }, () => observeInputDevice('pointer'));\n on('up:framework:reset', reset);\n return {\n on,\n off,\n build,\n emit,\n assertEmitted,\n onEscape,\n halt,\n isUnmodified,\n isSyntheticClick,\n fork,\n keyModifiers,\n get inputDevice() { return getInputDevice(); }\n };\n})();\nup.on = up.event.on;\nup.off = up.event.off;\nup.emit = up.event.emit;\n\n\n/***/ }),\n/* 82 */\n/***/ (() => {\n\nup.protocol = (function () {\n const u = up.util;\n const e = up.element;\n const headerize = function (camel) {\n const header = camel.replace(/(^.|[A-Z])/g, char => '-' + char.toUpperCase());\n return 'X-Up' + header;\n };\n const extractHeader = function (xhr, shortHeader, parseFn = u.identity) {\n let value = xhr.getResponseHeader(headerize(shortHeader));\n if (value) {\n return parseFn(value);\n }\n };\n function targetFromXHR(xhr) {\n return extractHeader(xhr, 'target');\n }\n function parseModifyCacheValue(value) {\n if (value === 'false') {\n return false;\n }\n else {\n return value;\n }\n }\n function evictCacheFromXHR(xhr) {\n return extractHeader(xhr, 'evictCache', parseModifyCacheValue);\n }\n function expireCacheFromXHR(xhr) {\n return extractHeader(xhr, 'expireCache') || up.migrate.clearCacheFromXHR?.(xhr);\n }\n function contextFromXHR(xhr) {\n return extractHeader(xhr, 'context', u.parseRelaxedJSON);\n }\n function methodFromXHR(xhr) {\n return extractHeader(xhr, 'method', u.normalizeMethod);\n }\n function titleFromXHR(xhr) {\n return up.migrate.titleFromXHR?.(xhr) ?? extractHeader(xhr, 'title', u.parseRelaxedJSON);\n }\n function eventPlansFromXHR(xhr) {\n return extractHeader(xhr, 'events', u.parseRelaxedJSON);\n }\n function acceptLayerFromXHR(xhr) {\n return extractHeader(xhr, 'acceptLayer', u.parseRelaxedJSON);\n }\n function dismissLayerFromXHR(xhr) {\n return extractHeader(xhr, 'dismissLayer', u.parseRelaxedJSON);\n }\n const initialRequestMethod = u.memoize(function () {\n return u.normalizeMethod(up.browser.popCookie('_up_method'));\n });\n function locationFromXHR(xhr) {\n let location = extractHeader(xhr, 'location') || xhr.responseURL;\n if (location) {\n return u.normalizeURL(location);\n }\n }\n const config = new up.Config(() => ({\n methodParam: '_method',\n csrfParam() { return e.metaContent('csrf-param'); },\n csrfToken() { return e.metaContent('csrf-token'); },\n cspNonce() { return e.metaContent('csp-nonce'); },\n csrfHeader: 'X-CSRF-Token',\n maxHeaderSize: 2048,\n }));\n function csrfHeader() {\n return u.evalOption(config.csrfHeader);\n }\n function csrfParam() {\n return u.evalOption(config.csrfParam);\n }\n function csrfToken() {\n return u.evalOption(config.csrfToken);\n }\n function cspNonce() {\n return u.evalOption(config.cspNonce);\n }\n function cspNoncesFromHeader(cspHeader) {\n let nonces = [];\n if (cspHeader) {\n let parts = cspHeader.split(/\\s*;\\s*/);\n for (let part of parts) {\n if (part.indexOf('script-src') === 0) {\n let noncePattern = /'nonce-([^']+)'/g;\n let match;\n while (match = noncePattern.exec(part)) {\n nonces.push(match[1]);\n }\n }\n }\n }\n return nonces;\n }\n function wrapMethod(method, params) {\n params.add(config.methodParam, method);\n return 'POST';\n }\n return {\n config,\n locationFromXHR,\n titleFromXHR,\n targetFromXHR,\n methodFromXHR,\n acceptLayerFromXHR,\n contextFromXHR,\n dismissLayerFromXHR,\n eventPlansFromXHR,\n expireCacheFromXHR,\n evictCacheFromXHR,\n csrfHeader,\n csrfParam,\n csrfToken,\n cspNonce,\n initialRequestMethod,\n headerize,\n wrapMethod,\n cspNoncesFromHeader,\n };\n})();\n\n\n/***/ }),\n/* 83 */\n/***/ (() => {\n\nup.log = (function () {\n const u = up.util;\n const config = new up.LogConfig();\n function printToStandard(...args) {\n if (config.enabled) {\n printToStream('log', ...args);\n }\n }\n const printToWarn = (...args) => printToStream('warn', ...args);\n const printToError = (...args) => printToStream('error', ...args);\n function printToStream(stream, trace, message, ...args) {\n printToStreamStyled(stream, trace, '', message, ...args);\n }\n function printToStreamStyled(stream, trace, customStyles, message, ...args) {\n if (message) {\n if (config.format) {\n console[stream](`%c${trace}%c ${message}`, 'color: #666666; padding: 1px 3px; border: 1px solid #bbbbbb; border-radius: 2px; font-size: 90%; display: inline-block;' + customStyles, '', ...args);\n }\n else {\n console[stream](`[${trace}] ${u.sprintf(message, ...args)}`);\n }\n }\n }\n function printUserEvent(event) {\n if (config.enabled) {\n event = event.originalEvent || event;\n let color = '#5566cc';\n printToStreamStyled('log', event.type, `color: white; border-color: ${color}; background-color: ${color}`, 'Interaction on %o', event.target);\n }\n }\n function printBanner() {\n if (!config.banner) {\n return;\n }\n const logo = \" __ _____ ___ ___ / /_ __\\n\" +\n `/ // / _ \\\\/ _ \\\\/ _ \\\\/ / // / ${up.version}\\n` +\n \"\\\\___/_//_/ .__/\\\\___/_/\\\\_. / \\n\" +\n \" / / / /\\n\\n\";\n let text = \"\";\n if (!up.migrate.loaded) {\n text += \"Load unpoly-migrate.js to polyfill deprecated APIs.\\n\\n\";\n }\n if (config.enabled) {\n text += \"Call `up.log.disable()` to disable logging for this session.\";\n }\n else {\n text += \"Call `up.log.enable()` to enable logging for this session.\";\n }\n const color = 'color: #777777';\n if (config.format) {\n console.log('%c' + logo + '%c' + text, 'font-family: monospace;' + color, color);\n }\n else {\n console.log(logo + text);\n }\n }\n up.on('up:framework:boot', printBanner);\n function enable() {\n config.enabled = true;\n }\n function disable() {\n config.enabled = false;\n }\n return {\n puts: printToStandard,\n putsEvent: printUserEvent,\n error: printToError,\n warn: printToWarn,\n config,\n enable,\n disable,\n };\n})();\nup.puts = up.log.puts;\nup.warn = up.log.warn;\n\n\n/***/ }),\n/* 84 */\n/***/ (() => {\n\nup.script = (function () {\n const u = up.util;\n const e = up.element;\n const config = new up.Config(() => ({\n assetSelectors: [\n 'link[rel=stylesheet]',\n 'script[src]',\n '[up-asset]'\n ],\n noAssetSelectors: [\n '[up-asset=false]',\n ],\n nonceableAttributes: [\n 'up-watch',\n 'up-on-keep',\n 'up-on-hungry',\n 'up-on-opened',\n 'up-on-accepted',\n 'up-on-dismissed',\n 'up-on-loaded',\n 'up-on-rendered',\n 'up-on-finished',\n 'up-on-error',\n 'up-on-offline',\n ],\n scriptSelectors: [\n 'script:not([type])',\n 'script[type=\"text/javascript\"]',\n 'script[type=\"module\"]',\n 'script[type=\"importmap\"]',\n ],\n noScriptSelectors: [\n 'script[type=\"application/ld+json\"]'\n ]\n }));\n const SYSTEM_MACRO_PRIORITIES = {\n '[up-back]': -100,\n '[up-clickable]': -200,\n '[up-drawer]': -200,\n '[up-modal]': -200,\n '[up-cover]': -200,\n '[up-popup]': -200,\n '[up-tooltip]': -200,\n '[up-dash]': -200,\n '[up-flashes]': -200,\n '[up-expand]': -300,\n '[data-method]': -400,\n '[data-confirm]': -400,\n };\n let registeredCompilers = [];\n let registeredMacros = [];\n function registerCompiler(...args) {\n registerProcessor(args);\n }\n function registerMacro(...args) {\n registerProcessor(args, { macro: true });\n }\n function registerAttrCompiler(...args) {\n let [attr, options, valueCallback] = parseProcessorArgs(args);\n let selector = `[${attr}]`;\n let { defaultValue } = options;\n let callback = (element) => {\n let value = e.booleanOrStringAttr(element, attr);\n if (value === false)\n return;\n if (u.isDefined(defaultValue) && value === true)\n value = defaultValue;\n return valueCallback(element, value);\n };\n registerProcessor([selector, options, callback]);\n }\n function detectSystemMacroPriority(macroSelector) {\n macroSelector = u.evalOption(macroSelector);\n for (let substr in SYSTEM_MACRO_PRIORITIES) {\n if (macroSelector.indexOf(substr) >= 0) {\n return SYSTEM_MACRO_PRIORITIES[substr];\n }\n }\n up.fail('Unregistered priority for system macro %o', macroSelector);\n }\n function registerProcessor(args, overrides = {}) {\n let processor = buildProcessor(args, overrides);\n if (processor.macro) {\n if (up.framework.evaling) {\n processor.priority ||= detectSystemMacroPriority(processor.selector);\n }\n insertProcessor(registeredMacros, processor);\n }\n else {\n insertProcessor(registeredCompilers, processor);\n }\n }\n const parseProcessorArgs = function (args) {\n return u.args(args, 'val', 'options', 'callback');\n };\n function buildProcessor(args, overrides) {\n let [selector, options, callback] = parseProcessorArgs(args);\n options = u.options(options, {\n selector,\n isDefault: up.framework.evaling,\n priority: 0,\n batch: false,\n });\n return Object.assign(callback, options, overrides);\n }\n function insertProcessor(queue, newCompiler) {\n let existingCompiler;\n let index = 0;\n while ((existingCompiler = queue[index]) && (existingCompiler.priority >= newCompiler.priority)) {\n index += 1;\n }\n queue.splice(index, 0, newCompiler);\n if (up.framework.booted) {\n if (newCompiler.priority === 0) {\n for (let layer of up.layer.stack) {\n compile(layer.element, { layer, compilers: [newCompiler] });\n }\n }\n else {\n up.puts('up.compiler()', 'Compiler %s was registered after booting Unpoly. Compiler will run for future fragments only.', newCompiler.selector);\n }\n }\n return newCompiler;\n }\n function compile(fragment, options) {\n up.emit(fragment, 'up:fragment:compile', { log: false });\n let compilers = options.compilers || registeredMacros.concat(registeredCompilers);\n const pass = new up.CompilerPass(fragment, compilers, options);\n pass.run();\n }\n function registerDestructor(element, destructor) {\n let fns = u.scanFunctions(destructor);\n if (!fns.length)\n return;\n let registry = (element.upDestructors ||= buildDestructorRegistry(element));\n registry.guard(fns);\n }\n function buildDestructorRegistry(element) {\n let registry = u.cleaner();\n registry(e.addClassTemp(element, 'up-can-clean'));\n return registry;\n }\n function hello(element, options = {}) {\n element = up.fragment.get(element, options);\n up.puts('up.hello()', \"Compiling fragment %o\", element);\n compile(element, options);\n up.fragment.emitInserted(element);\n return element;\n }\n function clean(fragment, options = {}) {\n new up.DestructorPass(fragment, options).run();\n }\n function readData(element) {\n element = up.fragment.get(element);\n return element.upData ||= buildData(element);\n }\n function buildData(element) {\n let parsedJSON = e.jsonAttr(element, 'up-data') ?? {};\n if (!u.isOptions(parsedJSON)) {\n return parsedJSON;\n }\n return {\n ...element.upTemplateData,\n ...element.dataset,\n ...parsedJSON,\n ...element.upCompileData,\n };\n }\n function findAssets(head = document.head) {\n return head.querySelectorAll(config.selector('assetSelectors'));\n }\n function assertAssetsOK(newAssets, renderOptions) {\n let oldAssets = findAssets();\n let oldHTML = u.map(oldAssets, 'outerHTML').join();\n let newHTML = u.map(newAssets, 'outerHTML').join();\n if (oldHTML !== newHTML) {\n up.event.assertEmitted('up:assets:changed', { oldAssets, newAssets, renderOptions });\n }\n }\n function disableScript(scriptElement) {\n scriptElement.type = 'up-disabled-script';\n }\n function disableScriptsInSubtree(root) {\n let selector = config.selector('scriptSelectors');\n u.each(e.subtree(root, selector), disableScript);\n }\n function isScript(value) {\n return config.matches(value, 'scriptSelectors');\n }\n function reset() {\n registeredCompilers = u.filter(registeredCompilers, 'isDefault');\n registeredMacros = u.filter(registeredMacros, 'isDefault');\n }\n up.on('up:framework:reset', reset);\n return {\n config,\n compiler: registerCompiler,\n macro: registerMacro,\n attrCompiler: registerAttrCompiler,\n destructor: registerDestructor,\n hello,\n clean,\n data: readData,\n findAssets,\n assertAssetsOK,\n disableSubtree: disableScriptsInSubtree,\n isScript,\n };\n})();\nup.compiler = up.script.compiler;\nup.destructor = up.script.destructor;\nup.macro = up.script.macro;\nup.data = up.script.data;\nup.hello = up.script.hello;\nup.attribute = up.script.attrCompiler;\n\n\n/***/ }),\n/* 85 */\n/***/ (() => {\n\nup.history = (function () {\n const u = up.util;\n const e = up.element;\n const config = new up.Config(() => ({\n enabled: true,\n updateMetaTags: true,\n restoreTargets: ['body'],\n metaTagSelectors: [\n 'meta',\n 'link[rel=alternate]',\n 'link[rel=canonical]',\n 'link[rel=icon]',\n '[up-meta]',\n 'script[type=\"application/ld+json\"]',\n ],\n noMetaTagSelectors: [\n 'meta[http-equiv]',\n '[up-meta=false]',\n 'meta[name=csp-nonce]',\n ],\n }));\n let previousLocation;\n let nextPreviousLocation;\n function reset() {\n previousLocation = undefined;\n nextPreviousLocation = undefined;\n trackCurrentLocation();\n }\n function currentLocation() {\n return u.normalizeURL(location.href);\n }\n function trackCurrentLocation() {\n const url = currentLocation();\n if (nextPreviousLocation !== url) {\n previousLocation = nextPreviousLocation;\n nextPreviousLocation = url;\n }\n }\n trackCurrentLocation();\n function isLocation(url, options) {\n return u.matchURLs(url, location.href, { hash: true, ...options });\n }\n function replace(location, options = {}) {\n location = u.normalizeURL(location);\n if (manipulate('replaceState', location) && (options.event !== false)) {\n emitLocationChanged({ location, reason: 'replace', log: `Replaced state for ${location}` });\n }\n }\n function push(location) {\n location = u.normalizeURL(location);\n if (!isLocation(location) && manipulate('pushState', location)) {\n emitLocationChanged({ location, reason: 'push', log: `Advanced to location ${location}` });\n }\n }\n function emitLocationChanged(props) {\n let event = up.event.build('up:location:changed', props);\n up.migrate?.renamedProperty?.(event, 'url', 'location');\n up.emit(event);\n }\n function manipulate(method, url) {\n if (config.enabled) {\n const state = buildState();\n window.history[method](state, '', url);\n trackCurrentLocation();\n return true;\n }\n }\n function buildState() {\n return { up: {} };\n }\n function restoreStateOnPop(state) {\n if (!state?.up) {\n up.puts('popstate', 'Ignoring a history state not owned by Unpoly');\n return;\n }\n let location = currentLocation();\n up.error.muteUncriticalRejection(up.render({\n guardEvent: up.event.build('up:location:restore', { location, log: `Restoring location ${location}` }),\n url: location,\n target: config.restoreTargets,\n fail: false,\n history: true,\n location,\n peel: true,\n layer: 'root',\n cache: 'auto',\n revalidate: 'auto',\n saveScroll: false,\n scroll: ['restore', 'auto'],\n saveFocus: false,\n focus: ['restore', 'auto'],\n }));\n }\n function onPop(event) {\n trackCurrentLocation();\n let location = currentLocation();\n emitLocationChanged({ location, reason: 'pop', log: `Navigated to history entry ${location}` });\n up.viewport.saveFocus({ location: previousLocation });\n up.viewport.saveScroll({ location: previousLocation });\n restoreStateOnPop(event.state);\n }\n function register() {\n window.addEventListener('popstate', onPop);\n if (up.protocol.initialRequestMethod() === 'GET') {\n replace(currentLocation(), { event: false });\n }\n }\n up.on('up:framework:boot', function () {\n if ('jasmine' in window) {\n register();\n }\n else {\n setTimeout(register, 100);\n }\n });\n function findMetaTags(head = document.head) {\n return head.querySelectorAll(config.selector('metaTagSelectors'));\n }\n function updateMetaTags(newMetaTags) {\n let oldMetaTags = findMetaTags();\n for (let oldMetaTag of oldMetaTags) {\n oldMetaTag.remove();\n }\n for (let newMetaTag of newMetaTags) {\n document.head.append(newMetaTag);\n }\n }\n function getLang(doc = document) {\n let { documentElement } = doc;\n if (documentElement.matches('html')) {\n return doc.documentElement.lang;\n }\n }\n function updateLang(newLang) {\n e.setAttrPresence(e.root, 'lang', newLang, !!newLang);\n }\n up.macro('[up-back]', function (link) {\n if (previousLocation) {\n e.setMissingAttrs(link, {\n 'up-href': previousLocation,\n 'up-scroll': 'restore'\n });\n link.removeAttribute('up-back');\n up.link.makeFollowable(link);\n }\n });\n up.on('up:framework:reset', reset);\n return {\n config,\n push,\n replace,\n get location() { return currentLocation(); },\n get previousLocation() { return previousLocation; },\n isLocation,\n findMetaTags,\n updateMetaTags,\n getLang,\n updateLang,\n };\n})();\n\n\n/***/ }),\n/* 86 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(87);\nconst u = up.util;\nconst e = up.element;\nup.fragment = (function () {\n function upTagName(element) {\n let tagName = e.tagName(element);\n if (tagName.startsWith('up-')) {\n return tagName;\n }\n }\n const STRONG_TARGET_DERIVERS = [\n '[up-id]',\n '[id]',\n 'html',\n 'head',\n 'body',\n ];\n const config = new up.Config(() => ({\n badTargetClasses: [/^up-/],\n strongTargetDerivers: STRONG_TARGET_DERIVERS,\n targetDerivers: [\n ...STRONG_TARGET_DERIVERS,\n 'main',\n '[up-main]',\n upTagName,\n 'link[rel][type]',\n 'link[rel=preload][href]',\n 'link[rel=preconnect][href]',\n 'link[rel=prefetch][href]',\n 'link[rel]',\n 'meta[property]',\n '*[name]',\n 'form[action]',\n 'a[href]',\n '[class]',\n '[up-flashes]',\n 'form',\n ],\n verifyDerivedTarget: true,\n renderOptions: {\n hungry: true,\n keep: true,\n saveScroll: true,\n saveFocus: true,\n focus: 'keep',\n abort: 'target',\n failOptions: true,\n feedback: true,\n },\n navigateOptions: {\n cache: 'auto',\n revalidate: 'auto',\n fallback: true,\n focus: 'auto',\n scroll: 'auto',\n history: 'auto',\n peel: true,\n },\n match: 'region',\n runScripts: true,\n autoHistoryTargets: [':main'],\n autoFocus: ['hash', 'autofocus', 'main-if-main', 'keep', 'target-if-lost'],\n autoScroll: ['hash', 'layer-if-main'],\n autoRevalidate: (response) => response.expired,\n skipResponse: defaultSkipResponse,\n }));\n u.delegate(config, ['mainTargets'], () => up.layer.config.any);\n function defaultSkipResponse({ response, expiredResponse }) {\n return !response.text || response.text === expiredResponse?.text;\n }\n function sourceOf(element, options = {}) {\n element = getSmart(element, options);\n return e.closestAttr(element, 'up-source');\n }\n function normalizeSource(source) {\n return u.normalizeURL(source, { hash: false });\n }\n function timeOf(element) {\n let value = e.closestAttr(element, 'up-time');\n if (value && value !== 'false') {\n if (/^\\d+$/.test(value)) {\n value = Number(value) * 1000;\n }\n return new Date(value);\n }\n }\n function etagOf(element) {\n let value = e.closestAttr(element, 'up-etag');\n if (value && value !== 'false') {\n return value;\n }\n }\n const render = up.mockable((...args) => {\n let options = parseTargetAndOptions(args);\n return new up.RenderJob(options).execute();\n });\n const navigate = up.mockable((...args) => {\n const options = parseTargetAndOptions(args);\n return render({ ...options, navigate: true });\n });\n function emitFragmentInserted(element) {\n return up.emit(element, 'up:fragment:inserted', {\n log: ['Inserted fragment %o', element],\n });\n }\n function emitFragmentKeep(keepPlan) {\n let { oldElement, newElement: newFragment, newData, renderOptions } = keepPlan;\n const log = ['Keeping fragment %o', oldElement];\n const callback = e.callbackAttr(oldElement, 'up-on-keep', { exposedKeys: ['newFragment', 'newData'] });\n return up.emit(oldElement, 'up:fragment:keep', { newFragment, newData, renderOptions, log, callback });\n }\n function emitFragmentDestroyed(fragment, options) {\n const log = options.log ?? ['Destroyed fragment %o', fragment];\n const parent = options.parent || document;\n return up.emit(parent, 'up:fragment:destroyed', { fragment, parent, log });\n }\n function isNotDestroying(element) {\n return !element.closest('.up-destroying');\n }\n function isAlive(fragment) {\n return fragment.isConnected && isNotDestroying(fragment);\n }\n function getSmart(...args) {\n let [root, selector, options] = parseGetArgs(args);\n if (u.isElementLike(selector)) {\n return e.get(selector);\n }\n if (root) {\n return getFirstDescendant(root, selector, options);\n }\n return new up.FragmentFinder({\n selector,\n origin: options.origin,\n layer: options.layer,\n match: options.match,\n }).find();\n }\n function getFirstDescendant(...args) {\n let [root, selectorString, options] = parseGetArgs(args);\n let selector = new up.Selector(selectorString, root, options);\n return selector.firstDescendant(root);\n }\n function parseGetArgs(args) {\n return u.args(args, 'val', 'val', 'options');\n }\n function getAll(...args) {\n let [root, selectorString, options] = parseGetArgs(args);\n if (u.isElement(selectorString)) {\n return [selectorString];\n }\n if (u.isList(selectorString)) {\n return selectorString;\n }\n let selector = new up.Selector(selectorString, root, options);\n return selector.descendants(root);\n }\n function getSubtree(element, selector, options = {}) {\n return new up.Selector(selector, element, options).subtree(element);\n }\n function contains(root, selectorOrElement) {\n if (u.isElement(selectorOrElement)) {\n return e.contains(root, selectorOrElement) && up.layer.get(root).contains(selectorOrElement);\n }\n else {\n return getSubtree(root, selectorOrElement).length > 0;\n }\n }\n function closest(element, selector, options) {\n return new up.Selector(selector, element, options).closest(element);\n }\n function destroy(...args) {\n const options = parseTargetAndOptions(args);\n if (options.element = getSmart(options.target, options)) {\n new up.Change.DestroyFragment(options).execute();\n }\n return up.migrate.formerlyAsync?.('up.destroy()');\n }\n function parseTargetAndOptions(args) {\n const options = u.parseArgIntoOptions(args, 'target');\n if (u.isElement(options.target)) {\n options.origin ||= options.target;\n }\n return options;\n }\n function markFragmentAsDestroying(element) {\n element.classList.add('up-destroying');\n element.setAttribute('aria-hidden', 'true');\n }\n function reload(...args) {\n const options = parseTargetAndOptions(args);\n options.target ||= ':main';\n const element = getSmart(options.target, options);\n options.url ||= sourceOf(element);\n options.headers = u.merge(options.headers, conditionalHeaders(element));\n if (options.keepData || e.booleanAttr(element, 'up-keep-data')) {\n options.data = up.data(element);\n }\n up.migrate.postprocessReloadOptions?.(options);\n return render(options);\n }\n function conditionalHeaders(element) {\n let headers = {};\n let time = timeOf(element);\n if (time) {\n headers['If-Modified-Since'] = time.toUTCString();\n }\n let etag = etagOf(element);\n if (etag) {\n headers['If-None-Match'] = etag;\n }\n return headers;\n }\n function visit(url, options) {\n return navigate({ ...options, url });\n }\n const KEY_PATTERN = /^(onFail|on|fail)?(.+)$/;\n function successKey(key) {\n let match = KEY_PATTERN.exec(key);\n if (match) {\n let [_, prefix, suffix] = match;\n switch (prefix) {\n case 'onFail':\n return 'on' + u.upperCaseFirst(suffix);\n case 'fail':\n return u.lowerCaseFirst(suffix);\n }\n }\n }\n function failKey(key) {\n let match = KEY_PATTERN.exec(key);\n if (match) {\n let [_, prefix, suffix] = match;\n switch (prefix) {\n case 'on':\n return 'onFail' + u.upperCaseFirst(suffix);\n case undefined:\n return 'fail' + u.upperCaseFirst(suffix);\n }\n }\n }\n function toTarget(element, options) {\n return u.presence(element, u.isString) || tryToTarget(element, options) || cannotTarget(element);\n }\n function isTargetable(element) {\n return !!tryToTarget(element);\n }\n function untargetableMessage(element) {\n return `Cannot derive good target selector from a <${e.tagName(element)}> element without identifying attributes. Try setting an [id] or configure up.fragment.config.targetDerivers.`;\n }\n function cannotTarget(element) {\n throw new up.CannotTarget(untargetableMessage(element));\n }\n function tryToTarget(element, options = {}) {\n let derivers = options.strong ? config.strongTargetDerivers : config.targetDerivers;\n return u.findResult(derivers, function (deriver) {\n let target = deriveTarget(element, deriver);\n if (target && isGoodTarget(target, element, options)) {\n return target;\n }\n });\n }\n function deriveTarget(element, deriver) {\n if (u.isFunction(deriver)) {\n return deriver(element);\n }\n else if (element.matches(deriver)) {\n try {\n return deriveTargetFromPattern(element, deriver);\n }\n catch (e) {\n if (e instanceof up.CannotParse) {\n return deriver;\n }\n else {\n throw e;\n }\n }\n }\n }\n function deriveTargetFromPattern(element, deriver) {\n let { includePath, excludeRaw } = e.parseSelector(deriver);\n if (includePath.length !== 1) {\n throw new up.CannotParse(deriver);\n }\n let { tagName, id, classNames, attributes } = includePath[0];\n let result = '';\n if (tagName === '*') {\n result += e.tagName(element);\n }\n else if (tagName) {\n result += tagName;\n }\n for (let className of classNames) {\n result += e.classSelector(className);\n }\n if (id) {\n result += e.idSelector(id);\n }\n for (let attributeName in attributes) {\n let attributeValue = attributes[attributeName] || element.getAttribute(attributeName);\n if (attributeName === 'id') {\n result += e.idSelector(attributeValue);\n }\n else if (attributeName === 'class') {\n for (let goodClass of goodClassesForTarget(element)) {\n result += e.classSelector(goodClass);\n }\n }\n else {\n result += e.attrSelector(attributeName, attributeValue);\n }\n }\n if (excludeRaw) {\n result += excludeRaw;\n }\n return result;\n }\n function isGoodTarget(target, element, options = {}) {\n let verify = options.verify ?? config.verifyDerivedTarget;\n return !isAlive(element) || !verify || up.fragment.get(target, { layer: element, ...options }) === element;\n }\n function matchesPattern(pattern, str) {\n if (u.isRegExp(pattern)) {\n return pattern.test(str);\n }\n else {\n return pattern === str;\n }\n }\n function goodClassesForTarget(element) {\n let isGood = (klass) => !u.some(config.badTargetClasses, (badTargetClass) => matchesPattern(badTargetClass, klass));\n return u.filter(element.classList, isGood);\n }\n const MAIN_PSEUDO = /:main\\b/;\n const LAYER_PSEUDO = /:layer\\b/;\n const ORIGIN_PSEUDO = /:origin\\b/;\n function containsMainPseudo(target) {\n return MAIN_PSEUDO.test(target);\n }\n function expandTargets(targets, options = {}) {\n const { layer } = options;\n if (layer !== 'new' && !(layer instanceof up.Layer)) {\n up.fail('Must pass an up.Layer as { layer } option, but got %o', layer);\n }\n targets = u.copy(u.wrapList(targets));\n const expanded = [];\n while (targets.length) {\n let target = targets.shift();\n if (target === true)\n target = ':main';\n if (containsMainPseudo(target)) {\n let mode = resolveMode(options);\n let replaced = up.layer.mainTargets(mode).map((mainTarget) => target.replace(MAIN_PSEUDO, mainTarget));\n targets.unshift(...replaced);\n }\n else if (LAYER_PSEUDO.test(target)) {\n if (layer === 'new' || layer.opening)\n continue;\n let firstSwappableTarget = toTarget(layer.getFirstSwappableElement(), options);\n targets.unshift(target.replace(LAYER_PSEUDO, firstSwappableTarget));\n }\n else if (u.isElementLike(target)) {\n expanded.push(toTarget(target, options));\n }\n else if (u.isString(target)) {\n expanded.push(resolveOrigin(target, options));\n }\n }\n return u.uniq(expanded);\n }\n function resolveMode({ layer, mode }) {\n if (layer === 'new') {\n return mode || up.fail('Must pass a { mode } option together with { layer: \"new\" }');\n }\n else {\n return layer.mode;\n }\n }\n function modernResolveOrigin(target, { origin } = {}) {\n return target.replace(ORIGIN_PSEUDO, function (match) {\n if (origin) {\n return toTarget(origin);\n }\n else {\n up.fail('Missing { origin } element to resolve \"%s\" reference (found in %s)', match, target);\n }\n });\n }\n function resolveOrigin(target, options) {\n if (!u.isString(target))\n return target;\n return (up.migrate.resolveOrigin || modernResolveOrigin)(target, options);\n }\n function splitTarget(target) {\n return u.getComplexTokens(target);\n }\n function parseTargetSteps(target, options = {}) {\n let defaultPlacement = options.defaultPlacement || 'swap';\n let defaultMaybe = options.defaultMaybe ?? false;\n let steps = [];\n let simpleSelectors = splitTarget(target);\n for (let selector of simpleSelectors) {\n if (selector === ':none')\n continue;\n let placement = defaultPlacement;\n let maybe = defaultMaybe;\n selector = selector.replace(/\\b::?(before|after|content)\\b/, (_match, customPlacement) => {\n placement = customPlacement;\n return '';\n });\n selector = selector.replace(/\\b:maybe\\b/, () => {\n maybe = true;\n return '';\n });\n const step = {\n ...options,\n selector,\n placement,\n maybe,\n originalRenderOptions: options,\n };\n steps.push(step);\n }\n return steps;\n }\n function hasAutoHistory(newFragments, layer) {\n let vanillaSelector = expandTargets(config.autoHistoryTargets, { layer }).join();\n for (let newFragment of newFragments) {\n if (e.subtree(newFragment, vanillaSelector).length) {\n return true;\n }\n }\n up.puts('up.render()', \"Will not auto-update history because fragment doesn't contain a selector from up.fragment.config.autoHistoryTargets\");\n return false;\n }\n function matches(element, selector, options = {}) {\n element = e.get(element);\n if (u.isElement(selector)) {\n let target = tryToTarget(selector);\n return target && element.matches(target);\n }\n else {\n return new up.Selector(selector, element, options).matches(element);\n }\n }\n function shouldRevalidate(request, response, options = {}) {\n return request.fromCache && u.evalAutoOption(options.revalidate, config.autoRevalidate, response);\n }\n function targetForSteps(steps) {\n let bestSteps = steps.filter((step) => !step.maybe || step.oldElement?.isConnected);\n let selectors = u.map(bestSteps, 'selector');\n return selectors.join(', ') || ':none';\n }\n function isContainedByRivalStep(steps, candidateStep) {\n return u.some(steps, function (rivalStep) {\n return (rivalStep !== candidateStep) &&\n ((rivalStep.placement === 'swap') || (rivalStep.placement === 'content')) &&\n rivalStep.oldElement.contains(candidateStep.oldElement);\n });\n }\n function compressNestedSteps(steps) {\n if (steps.length < 2)\n return steps;\n let compressed = u.uniqBy(steps, 'oldElement');\n compressed = u.reject(compressed, step => isContainedByRivalStep(compressed, step));\n return compressed;\n }\n function abort(...args) {\n let options = parseTargetAndOptions(args);\n let testFn;\n let { reason, newLayer } = options;\n let elements;\n if (options.target) {\n elements = getAll(options.target, options);\n testFn = (request) => request.isBoundToSubtrees(elements);\n reason ||= 'Aborting requests within fragment';\n }\n else {\n let layers = up.layer.getAll(options);\n elements = u.map(layers, 'element');\n testFn = (request) => request.isBoundToLayers(layers);\n reason ||= 'Aborting requests within ' + layers.join(', ');\n }\n let testFnWithAbortable = (request) => request.abortable && testFn(request);\n up.network.abort(testFnWithAbortable, { ...options, reason });\n for (let element of elements) {\n up.emit(element, 'up:fragment:aborted', { reason, newLayer, log: false });\n }\n }\n function onAborted(fragment, callback) {\n let guard = (event) => event.target.contains(fragment);\n let unsubscribe = up.on('up:fragment:aborted', { guard }, callback);\n up.destructor(fragment, unsubscribe);\n return unsubscribe;\n }\n function onFirstIntersect(element, callback, { margin = 0 } = {}) {\n if (e.isIntersectingWindow(element, { margin })) {\n callback();\n return;\n }\n function processIntersectEntries(entries) {\n for (let entry of entries) {\n if (entry.isIntersecting) {\n disconnect();\n callback();\n return;\n }\n }\n }\n let observer = new IntersectionObserver(processIntersectEntries, { rootMargin: `${margin}px` });\n let disconnect = () => observer.disconnect();\n observer.observe(element);\n up.destructor(element, disconnect);\n }\n const STARTS_WITH_SELECTOR = /^([\\w-]+|\\*)?(#|\\.|[:[][a-z-]{3,})/;\n function provideNodes(value, { origin, originLayer, data, htmlParser = e.createNodesFromHTML } = {}) {\n if (u.isString(value) && STARTS_WITH_SELECTOR.test(value)) {\n let [parsedValue, parsedData] = u.parseScalarJSONPairs(value)[0];\n data = { ...data, ...parsedData };\n value = up.fragment.get(parsedValue, { layer: 'closest', origin, originLayer }) || up.fail(`Cannot find template \"%s\"`, value);\n }\n if (u.isString(value)) {\n value = htmlParser(value);\n }\n if (isTemplate(value)) {\n value = cloneTemplate(value, data, { htmlParser });\n }\n return u.wrapList(value);\n }\n function isTemplate(value) {\n return u.isElement(value) && value.matches('template, script[type]') && !up.script.isScript(value);\n }\n function cloneTemplate(templateOrSelector, data = {}, { origin, htmlParser } = {}) {\n let template = getSmart(templateOrSelector, { origin }) || up.fail('Template not found: %o', templateOrSelector);\n let event = up.emit(template, 'up:template:clone', { data, nodes: null, log: [\"Using template %o\", templateOrSelector] });\n let nodes = event.nodes ?? defaultTemplateNodes(template, htmlParser);\n for (let node of nodes) {\n node.upTemplateData = data;\n }\n return nodes;\n }\n function defaultTemplateNodes(template, htmlParser = e.createNodesFromHTML) {\n let templateText = template.innerHTML;\n return htmlParser(templateText);\n }\n function insertTemp(...args) {\n let [reference, position = 'beforeend', tempValue] = u.args(args, 'val', u.isAdjacentPosition, 'val');\n let tempNodes = provideNodes(tempValue, { origin: reference });\n let tempElement = e.wrapIfRequired(tempNodes);\n let oldPosition = document.contains(tempElement) && e.documentPosition(tempElement);\n reference.insertAdjacentElement(position, tempElement);\n if (oldPosition) {\n return () => {\n oldPosition[0].insertAdjacentElement(oldPosition[1], tempElement);\n };\n }\n else {\n up.hello(tempElement);\n return () => up.destroy(tempElement);\n }\n }\n up.on('up:framework:boot', function () {\n const { documentElement } = document;\n documentElement.setAttribute('up-source', normalizeSource(location.href));\n up.hello(documentElement);\n if (!up.browser.canPushState()) {\n return up.warn('Cannot push history changes. Next render pass with history will load a full page.');\n }\n });\n return {\n config,\n reload,\n destroy,\n render,\n navigate,\n get: getSmart,\n getFirstDescendant,\n all: getAll,\n subtree: getSubtree,\n contains,\n closest,\n source: sourceOf,\n normalizeSource,\n visit,\n markAsDestroying: markFragmentAsDestroying,\n emitInserted: emitFragmentInserted,\n emitDestroyed: emitFragmentDestroyed,\n emitKeep: emitFragmentKeep,\n successKey,\n failKey,\n expandTargets,\n resolveOrigin,\n toTarget,\n tryToTarget,\n isTargetable,\n matches,\n hasAutoHistory,\n time: timeOf,\n etag: etagOf,\n shouldRevalidate,\n abort,\n onAborted,\n onFirstIntersect,\n splitTarget,\n parseTargetSteps,\n isAlive,\n isNotDestroying,\n targetForSteps,\n compressNestedSteps,\n containsMainPseudo,\n insertTemp,\n provideNodes,\n cloneTemplate,\n };\n})();\nup.reload = up.fragment.reload;\nup.destroy = up.fragment.destroy;\nup.render = up.fragment.render;\nup.navigate = up.fragment.navigate;\nup.visit = up.fragment.visit;\nup.template = { clone: up.fragment.cloneTemplate };\nu.delegate(up, ['context'], () => up.layer.current);\n\n\n/***/ }),\n/* 87 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 88 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(89);\nup.viewport = (function () {\n const u = up.util;\n const e = up.element;\n const f = up.fragment;\n const config = new up.Config(() => ({\n viewportSelectors: ['[up-viewport]', '[up-fixed]'],\n fixedTopSelectors: ['[up-fixed~=top]'],\n fixedBottomSelectors: ['[up-fixed~=bottom]'],\n anchoredRightSelectors: ['[up-anchored~=right]', '[up-fixed~=top]', '[up-fixed~=bottom]', '[up-fixed~=right]'],\n revealSnap: 200,\n revealPadding: 0,\n revealTop: false,\n revealMax() { return 0.5 * window.innerHeight; },\n autoFocusVisible({ element, inputDevice }) { return inputDevice === 'key' || up.form.isField(element); }\n }));\n const bodyShifter = new up.BodyShifter();\n up.compiler(config.selectorFn('anchoredRightSelectors'), function (element) {\n return bodyShifter.onAnchoredElementInserted(element);\n });\n const reveal = up.mockable(function (element, options) {\n options = u.options(options);\n element = f.get(element, options);\n if (!(options.layer = up.layer.get(element))) {\n up.fail('Cannot reveal a detached element');\n }\n if (options.peel) {\n options.layer.peel();\n }\n const motion = new up.RevealMotion(element, options);\n motion.start();\n return up.migrate.formerlyAsync?.('up.reveal()') || true;\n });\n function doFocus(element, { preventScroll, force, inputDevice, focusVisible } = {}) {\n if (force) {\n if (!element.hasAttribute('tabindex') && element.tabIndex === -1) {\n element.setAttribute('tabindex', '-1');\n }\n }\n inputDevice ??= up.event.inputDevice;\n focusVisible ??= 'auto';\n focusVisible = u.evalAutoOption(focusVisible, config.autoFocusVisible, { element, inputDevice });\n element.focus({\n preventScroll: true,\n focusVisible,\n });\n removeFocusClasses(element);\n element.classList.add(focusVisible ? 'up-focus-visible' : 'up-focus-hidden');\n if (!preventScroll) {\n return reveal(element);\n }\n }\n function removeFocusClasses(element) {\n element?.classList.remove('up-focus-hidden', 'up-focus-visible');\n }\n up.on('focusin', function ({ relatedTarget }) {\n removeFocusClasses(relatedTarget);\n });\n function tryFocus(element, options) {\n doFocus(element, options);\n return element === document.activeElement;\n }\n function revealHash(hash = location.hash, options) {\n let match = firstHashTarget(hash, options);\n if (match) {\n return reveal(match, { top: true });\n }\n }\n function allSelector() {\n return [rootSelector(), ...config.viewportSelectors].join();\n }\n function closest(target, options = {}) {\n const element = f.get(target, options);\n return element.closest(allSelector());\n }\n function getSubtree(element, options = {}) {\n element = f.get(element, options);\n return e.subtree(element, allSelector());\n }\n function getAround(element, options = {}) {\n element = f.get(element, options);\n return e.around(element, allSelector());\n }\n function getAll(options = {}) {\n return f.all(allSelector(), options);\n }\n function rootSelector() {\n return getRoot().tagName;\n }\n function getRoot() {\n return document.scrollingElement;\n }\n function rootWidth() {\n return e.root.clientWidth;\n }\n function rootHeight() {\n return e.root.clientHeight;\n }\n function isRoot(element) {\n return element === getRoot();\n }\n function rootScrollbarWidth() {\n return window.innerWidth - rootWidth();\n }\n function scrollTopKey(viewport) {\n return up.fragment.tryToTarget(viewport);\n }\n function fixedElements(root = document) {\n const queryParts = ['[up-fixed]'].concat(config.fixedTopSelectors).concat(config.fixedBottomSelectors);\n return root.querySelectorAll(queryParts.join());\n }\n function saveScroll(...args) {\n const [viewports, options] = parseOptions(args);\n const location = options.location || options.layer.location;\n if (location) {\n const tops = getScrollTopsForSave(viewports);\n options.layer.lastScrollTops.set(location, tops);\n }\n }\n function getScrollTopsForSave(viewports) {\n let tops = {};\n for (let viewport of viewports) {\n let key = scrollTopKey(viewport);\n if (key) {\n tops[key] = viewport.scrollTop;\n }\n else {\n up.warn('up.viewport.saveScroll()', 'Cannot save scroll positions for untargetable viewport %o', viewport);\n }\n }\n return tops;\n }\n function restoreScroll(...args) {\n const [viewports, options] = parseOptions(args);\n const { location } = options.layer;\n const locationScrollTops = options.layer.lastScrollTops.get(location);\n if (locationScrollTops) {\n setScrollTops(viewports, locationScrollTops);\n up.puts('up.viewport.restoreScroll()', 'Restored scroll positions to %o', locationScrollTops);\n return true;\n }\n else {\n return false;\n }\n }\n function saveFocus(options = {}) {\n const layer = up.layer.get(options);\n const location = options.location || layer.location;\n if (location) {\n const focusCapsule = up.FocusCapsule.preserve(layer);\n layer.lastFocusCapsules.set(location, focusCapsule);\n }\n }\n function restoreFocus(options = {}) {\n const layer = up.layer.get(options);\n const location = options.location || layer.location;\n const locationCapsule = options.layer.lastFocusCapsules.get(location);\n if (locationCapsule && locationCapsule.restore(layer)) {\n up.puts('up.viewport.restoreFocus()', 'Restored focus to \"%s\"', locationCapsule.target);\n return true;\n }\n else {\n return false;\n }\n }\n function newStateCache() {\n return new up.FIFOCache({ capacity: 30, normalizeKey: u.matchableURL });\n }\n function parseOptions(args) {\n const [reference, options] = u.args(args, 'val', 'options');\n options.layer = up.layer.get(options);\n let viewports;\n if (reference) {\n viewports = [closest(reference, options)];\n }\n else if (options.around) {\n viewports = getAround(options.around, options);\n }\n else {\n viewports = getAll(options);\n }\n return [viewports, options];\n }\n function resetScroll(...args) {\n const [viewports, _options] = parseOptions(args);\n setScrollTops(viewports, {});\n }\n function setScrollTops(viewports, tops) {\n for (let viewport of viewports) {\n const key = scrollTopKey(viewport);\n viewport.scrollTop = tops[key] || 0;\n }\n }\n function absolutize(element, options = {}) {\n const viewport = closest(element);\n const viewportRect = viewport.getBoundingClientRect();\n const originalRect = element.getBoundingClientRect();\n const boundsRect = new up.Rect({\n left: originalRect.left - viewportRect.left,\n top: originalRect.top - viewportRect.top,\n width: originalRect.width,\n height: originalRect.height\n });\n options.afterMeasure?.();\n e.setStyle(element, {\n position: element.style.position === 'static' ? 'static' : 'relative',\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto',\n width: '100%',\n height: '100%'\n });\n const bounds = e.createFromSelector('up-bounds');\n e.insertBefore(element, bounds);\n bounds.appendChild(element);\n const moveBounds = function (diffX, diffY) {\n boundsRect.left += diffX;\n boundsRect.top += diffY;\n return e.setStyle(bounds, boundsRect, 'px');\n };\n moveBounds(0, 0);\n const newElementRect = element.getBoundingClientRect();\n moveBounds(originalRect.left - newElementRect.left, originalRect.top - newElementRect.top);\n u.each(fixedElements(element), e.fixedToAbsolute);\n return {\n bounds,\n moveBounds\n };\n }\n function firstHashTarget(hash, options = {}) {\n if (hash = pureHash(hash)) {\n const selector = [\n e.idSelector(hash),\n 'a' + e.attrSelector('name', hash)\n ].join();\n return f.get(selector, options);\n }\n }\n function pureHash(value) {\n return value?.replace(/^#/, '');\n }\n function focusedElementWithin(scopeElement) {\n const focusedElement = document.activeElement;\n if (up.fragment.contains(scopeElement, focusedElement)) {\n return focusedElement;\n }\n }\n const CURSOR_PROPS = ['selectionStart', 'selectionEnd', 'scrollLeft', 'scrollTop'];\n function copyCursorProps(from, to = {}) {\n for (let key of CURSOR_PROPS) {\n try {\n to[key] = from[key];\n }\n catch (error) {\n }\n }\n return to;\n }\n document.addEventListener('DOMContentLoaded', function () {\n revealHash();\n u.task(revealHash);\n });\n up.on(window, 'hashchange', () => revealHash());\n up.on('up:click', 'a[href^=\"#\"]', function (event, link) {\n if (link.hash !== location.hash)\n return;\n if (up.link.isFollowable(link))\n return;\n if (revealHash(link.hash))\n up.event.halt(event);\n });\n return {\n reveal,\n revealHash,\n firstHashTarget,\n config,\n get: closest,\n subtree: getSubtree,\n around: getAround,\n get root() { return getRoot(); },\n rootWidth,\n rootHeight,\n isRoot,\n rootScrollbarWidth,\n saveScroll,\n restoreScroll,\n resetScroll,\n saveFocus,\n restoreFocus,\n absolutize,\n focus: doFocus,\n tryFocus,\n newStateCache,\n focusedElementWithin,\n copyCursorProps,\n bodyShifter,\n };\n})();\nup.focus = up.viewport.focus;\nup.reveal = up.viewport.reveal;\n\n\n/***/ }),\n/* 89 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 90 */\n/***/ (() => {\n\nup.motion = (function () {\n const u = up.util;\n const e = up.element;\n let namedAnimations = {};\n let namedTransitions = {};\n const motionController = new up.MotionController('motion');\n const config = new up.Config(() => ({\n duration: 175,\n easing: 'ease',\n enabled: !matchMedia('(prefers-reduced-motion: reduce)').matches\n }));\n function pickDefault(registry) {\n return u.pickBy(registry, 'isDefault');\n }\n function reset() {\n motionController.reset();\n namedAnimations = pickDefault(namedAnimations);\n namedTransitions = pickDefault(namedTransitions);\n }\n function isEnabled() {\n return config.enabled;\n }\n function animate(element, animation, options) {\n element = up.fragment.get(element);\n options = u.options(options);\n let animationFn = findAnimationFn(animation);\n const willRun = willAnimate(element, animation, options);\n animationFn = up.error.guardFn(animationFn);\n if (willRun) {\n const runNow = () => animationFn(element, options);\n return motionController.startFunction(element, runNow, options);\n }\n else {\n return skipAnimate(element, animation);\n }\n }\n function willAnimate(element, animationOrTransition, options) {\n applyConfig(options);\n return isEnabled() && !isNone(animationOrTransition) && (options.duration > 0) && !e.isSingleton(element);\n }\n function skipAnimate(element, animation) {\n if (u.isOptions(animation)) {\n e.setStyle(element, animation);\n }\n return Promise.resolve();\n }\n function animateNow(element, lastFrame, options) {\n if (up.migrate.loaded)\n lastFrame = up.migrate.fixStyleProps(lastFrame);\n options = { ...options, finishEvent: motionController.finishEvent };\n const cssTransition = new up.CSSTransition(element, lastFrame, options);\n return cssTransition.start();\n }\n function applyConfig(options) {\n options.easing ??= config.easing;\n options.duration ??= config.duration;\n }\n function findNamedAnimation(name) {\n return namedAnimations[name] || up.fail(\"Unknown animation %o\", name);\n }\n function finish(element) {\n return motionController.finish(element);\n }\n function morph(oldElement, newElement, transitionObject, options) {\n options = u.options(options);\n applyConfig(options);\n oldElement = up.fragment.get(oldElement);\n newElement = up.fragment.get(newElement);\n let transitionFn = findTransitionFn(transitionObject);\n const willMorph = willAnimate(oldElement, transitionFn, options);\n transitionFn = up.error.guardFn(transitionFn);\n const beforeStart = u.pluckKey(options, 'beforeStart') || u.noop;\n const afterInsert = u.pluckKey(options, 'afterInsert') || u.noop;\n const beforeDetach = u.pluckKey(options, 'beforeDetach') || u.noop;\n const afterDetach = u.pluckKey(options, 'afterDetach') || u.noop;\n const scrollNew = u.pluckKey(options, 'scrollNew') || u.noop;\n beforeStart();\n if (willMorph) {\n if (motionController.isActive(oldElement) && (options.trackMotion === false)) {\n return transitionFn(oldElement, newElement, options);\n }\n up.puts('up.morph()', 'Morphing %o to %o with transition %O over %d ms', oldElement, newElement, transitionObject, options.duration);\n const viewport = up.viewport.get(oldElement);\n const scrollTopBeforeReveal = viewport.scrollTop;\n const oldRemote = up.viewport.absolutize(oldElement, {\n afterMeasure() {\n e.insertBefore(oldElement, newElement);\n afterInsert();\n }\n });\n const trackable = async function () {\n scrollNew();\n const scrollTopAfterReveal = viewport.scrollTop;\n oldRemote.moveBounds(0, scrollTopAfterReveal - scrollTopBeforeReveal);\n await transitionFn(oldElement, newElement, options);\n beforeDetach();\n oldRemote.bounds.remove();\n afterDetach();\n };\n return motionController.startFunction([oldElement, newElement], trackable, options);\n }\n else {\n beforeDetach();\n swapElementsDirectly(oldElement, newElement);\n afterInsert();\n afterDetach();\n scrollNew();\n return Promise.resolve();\n }\n }\n function findTransitionFn(object) {\n if (isNone(object)) {\n return undefined;\n }\n else if (u.isFunction(object)) {\n return object;\n }\n else if (u.isArray(object)) {\n return composeTransitionFn(...object);\n }\n else if (u.isString(object)) {\n let namedTransition;\n if (object.indexOf('/') >= 0) {\n return composeTransitionFn(...object.split('/'));\n }\n else if (namedTransition = namedTransitions[object]) {\n return findTransitionFn(namedTransition);\n }\n }\n else {\n up.fail(\"Unknown transition %o\", object);\n }\n }\n function composeTransitionFn(oldAnimation, newAnimation) {\n if (!isNone(oldAnimation) && !isNone(newAnimation)) {\n const oldAnimationFn = findAnimationFn(oldAnimation) || u.asyncNoop;\n const newAnimationFn = findAnimationFn(newAnimation) || u.asyncNoop;\n return (oldElement, newElement, options) => Promise.all([\n oldAnimationFn(oldElement, options),\n newAnimationFn(newElement, options)\n ]);\n }\n }\n function findAnimationFn(object) {\n if (isNone(object)) {\n return undefined;\n }\n else if (u.isFunction(object)) {\n return object;\n }\n else if (u.isString(object)) {\n return findNamedAnimation(object);\n }\n else if (u.isOptions(object)) {\n return (element, options) => animateNow(element, object, options);\n }\n else {\n up.fail('Unknown animation %o', object);\n }\n }\n const swapElementsDirectly = up.mockable(function (oldElement, newElement) {\n oldElement.replaceWith(newElement);\n });\n function motionOptions(element, options, parserOptions) {\n options = u.options(options);\n let parser = new up.OptionsParser(element, options, parserOptions);\n parser.booleanOrString('animation');\n parser.booleanOrString('transition');\n parser.string('easing');\n parser.number('duration');\n return options;\n }\n function registerTransition(name, transition) {\n const fn = findTransitionFn(transition);\n fn.isDefault = up.framework.evaling;\n namedTransitions[name] = fn;\n }\n function registerAnimation(name, animation) {\n const fn = findAnimationFn(animation);\n fn.isDefault = up.framework.evaling;\n namedAnimations[name] = fn;\n }\n up.on('up:framework:boot', function () {\n if (!isEnabled()) {\n up.puts('up.motion', 'Animations are disabled');\n }\n });\n function isNone(animationOrTransition) {\n return !animationOrTransition || animationOrTransition === 'none';\n }\n function registerOpacityAnimation(name, from, to) {\n registerAnimation(name, function (element, options) {\n element.style.opacity = 0;\n e.setStyle(element, { opacity: from });\n return animateNow(element, { opacity: to }, options);\n });\n }\n registerOpacityAnimation('fade-in', 0, 1);\n registerOpacityAnimation('fade-out', 1, 0);\n function translateCSS(dx, dy) {\n return { transform: `translate(${dx}px, ${dy}px)` };\n }\n function noTranslateCSS() {\n return { transform: '' };\n }\n function untranslatedBox(element) {\n e.setStyle(element, noTranslateCSS());\n return element.getBoundingClientRect();\n }\n function registerMoveAnimations(direction, boxToTransform) {\n const animationToName = `move-to-${direction}`;\n const animationFromName = `move-from-${direction}`;\n registerAnimation(animationToName, function (element, options) {\n const box = untranslatedBox(element);\n const transform = boxToTransform(box);\n return animateNow(element, transform, options);\n });\n registerAnimation(animationFromName, function (element, options) {\n const box = untranslatedBox(element);\n const transform = boxToTransform(box);\n e.setStyle(element, transform);\n return animateNow(element, noTranslateCSS(), options);\n });\n }\n registerMoveAnimations('top', function (box) {\n const travelDistance = box.top + box.height;\n return translateCSS(0, -travelDistance);\n });\n registerMoveAnimations('bottom', function (box) {\n const travelDistance = up.viewport.rootHeight() - box.top;\n return translateCSS(0, travelDistance);\n });\n registerMoveAnimations('left', function (box) {\n const travelDistance = box.left + box.width;\n return translateCSS(-travelDistance, 0);\n });\n registerMoveAnimations('right', function (box) {\n const travelDistance = up.viewport.rootWidth() - box.left;\n return translateCSS(travelDistance, 0);\n });\n registerTransition('cross-fade', ['fade-out', 'fade-in']);\n registerTransition('move-left', ['move-to-left', 'move-from-right']);\n registerTransition('move-right', ['move-to-right', 'move-from-left']);\n registerTransition('move-up', ['move-to-top', 'move-from-bottom']);\n registerTransition('move-down', ['move-to-bottom', 'move-from-top']);\n up.on('up:framework:reset', reset);\n return {\n morph,\n animate,\n finish,\n finishCount() { return motionController.finishCount; },\n transition: registerTransition,\n animation: registerAnimation,\n config,\n isEnabled,\n isNone,\n willAnimate,\n swapElementsDirectly,\n motionOptions,\n };\n})();\nup.transition = up.motion.transition;\nup.animation = up.motion.animation;\nup.morph = up.motion.morph;\nup.animate = up.motion.animate;\n\n\n/***/ }),\n/* 91 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(92);\nconst u = up.util;\nup.network = (function () {\n const config = new up.Config(() => ({\n concurrency: 6,\n wrapMethod: true,\n cacheSize: 70,\n cacheExpireAge: 15 * 1000,\n cacheEvictAge: 90 * 60 * 1000,\n lateDelay: 400,\n fail(response) { return (response.status < 200 || response.status > 299) && response.status !== 304; },\n autoCache(request) { return request.isSafe(); },\n expireCache(request, _response) { return !request.isSafe(); },\n evictCache: false,\n progressBar: true,\n timeout: 90000,\n }));\n const queue = new up.Request.Queue();\n const cache = new up.Request.Cache();\n let progressBar = null;\n function reset() {\n abortRequests();\n queue.reset();\n cache.reset();\n progressBar?.destroy();\n progressBar = null;\n }\n function makeRequest(...args) {\n const options = parseRequestOptions(args);\n const request = new up.Request(options);\n processRequest(request);\n return request;\n }\n function parseRequestOptions(args) {\n let options = u.parseArgIntoOptions(args, 'url');\n up.migrate.handleRequestOptions?.(options);\n return options;\n }\n function processRequest(request) {\n useCachedRequest(request) || queueRequest(request);\n }\n function useCachedRequest(newRequest) {\n let cachedRequest;\n if (newRequest.willCache() && (cachedRequest = cache.get(newRequest))) {\n up.puts('up.request()', 'Re-using previous request to %s', newRequest.description);\n if (!newRequest.background) {\n queue.promoteToForeground(cachedRequest);\n }\n cachedRequest.mergeIfUnsent(newRequest);\n cache.track(cachedRequest, newRequest, { onIncompatible: processRequest });\n return true;\n }\n }\n function queueRequest(request) {\n handleCaching(request);\n queue.asap(request);\n return true;\n }\n function handleCaching(request) {\n if (request.willCache()) {\n cache.put(request);\n request.onLoading = () => cache.reindex(request);\n }\n u.always(request, function (responseOrError) {\n let expireCache = responseOrError.expireCache ?? request.expireCache ?? u.evalOption(config.expireCache, request, responseOrError);\n if (expireCache) {\n cache.expire(expireCache, { except: request });\n }\n let evictCache = responseOrError.evictCache ?? request.evictCache ?? u.evalOption(config.evictCache, request, responseOrError);\n if (evictCache) {\n cache.evict(evictCache, { except: request });\n }\n let hasCacheEntry = cache.get(request);\n let isResponse = responseOrError instanceof up.Response;\n let isNetworkError = !isResponse;\n let isSuccessResponse = isResponse && responseOrError.ok;\n let isErrorResponse = isResponse && !responseOrError.ok;\n let isEmptyResponse = isResponse && responseOrError.none;\n if (isErrorResponse) {\n cache.evict(request.url);\n }\n else if (isNetworkError || isEmptyResponse) {\n cache.evict(request);\n }\n else if (isSuccessResponse && hasCacheEntry) {\n cache.put(request);\n }\n });\n }\n function isBusy() {\n return queue.isBusy();\n }\n function loadPage(requestsAttrs) {\n new up.Request(requestsAttrs).loadPage();\n }\n function abortRequests(...args) {\n up.migrate.preprocessAbortArgs?.(args);\n queue.abort(...args);\n }\n function registerAliasForRedirect(request, response) {\n if (request.cache && response.url && request.url !== response.url) {\n const newRequest = u.variant(request, {\n method: response.method,\n url: response.url,\n cacheRoute: null,\n });\n cache.alias(request, newRequest);\n }\n }\n function isSafeMethod(method) {\n return u.contains(['GET', 'OPTIONS', 'HEAD'], u.normalizeMethod(method));\n }\n function onLate() {\n if (u.evalOption(config.progressBar)) {\n progressBar = new up.ProgressBar();\n }\n }\n function onRecover() {\n progressBar?.conclude();\n }\n up.on('up:network:late', onLate);\n up.on('up:network:recover', onRecover);\n up.on('up:framework:reset', reset);\n return {\n request: makeRequest,\n cache,\n isBusy,\n isSafeMethod,\n config,\n abort: abortRequests,\n registerAliasForRedirect,\n queue,\n loadPage,\n };\n})();\nup.request = up.network.request;\nup.cache = up.network.cache;\n\n\n/***/ }),\n/* 92 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 93 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(94);\nconst u = up.util;\nconst e = up.element;\nup.layer = (function () {\n const LAYER_CLASSES = [\n up.Layer.Root,\n up.Layer.Modal,\n up.Layer.Popup,\n up.Layer.Drawer,\n up.Layer.Cover\n ];\n const config = new up.Config(function () {\n const newConfig = {\n mode: 'modal',\n any: {\n mainTargets: [\n \"[up-main='']\",\n 'main',\n ':layer'\n ]\n },\n root: {\n mainTargets: ['[up-main~=root]'],\n history: true\n },\n overlay: {\n mainTargets: ['[up-main~=overlay]'],\n openAnimation: 'fade-in',\n closeAnimation: 'fade-out',\n dismissLabel: '×',\n dismissARIALabel: 'Dismiss dialog',\n dismissable: true,\n history: 'auto',\n trapFocus: true,\n },\n cover: {\n mainTargets: ['[up-main~=cover]']\n },\n drawer: {\n mainTargets: ['[up-main~=drawer]'],\n backdrop: true,\n position: 'left',\n size: 'medium',\n openAnimation(layer) {\n switch (layer.position) {\n case 'left': return 'move-from-left';\n case 'right': return 'move-from-right';\n }\n },\n closeAnimation(layer) {\n switch (layer.position) {\n case 'left': return 'move-to-left';\n case 'right': return 'move-to-right';\n }\n }\n },\n modal: {\n mainTargets: ['[up-main~=modal]'],\n backdrop: true,\n size: 'medium'\n },\n popup: {\n mainTargets: ['[up-main~=popup]'],\n position: 'bottom',\n size: 'medium',\n align: 'left',\n dismissable: 'outside key',\n trapFocus: false,\n },\n foreignOverlaySelectors: ['dialog']\n };\n for (let Class of LAYER_CLASSES) {\n newConfig[Class.mode].Class = Class;\n }\n return newConfig;\n });\n let stack = null;\n let handlers = [];\n function mainTargets(mode) {\n return u.flatMap(modeConfigs(mode), 'mainTargets');\n }\n function modeConfigs(mode) {\n if (mode === 'root') {\n return [config.root, config.any];\n }\n else {\n return [config[mode], config.overlay, config.any];\n }\n }\n function normalizeLayerOption(options) {\n if (options.layer instanceof up.Layer)\n return;\n up.migrate.handleLayerOptions?.(options);\n if (u.isGiven(options.layer)) {\n let match = String(options.layer).match(/^(new|shatter|swap)( (\\w+))?/);\n if (match) {\n options.layer = 'new';\n const openMethod = match[1];\n const shorthandMode = match[3];\n options.mode ||= shorthandMode || config.mode;\n if (openMethod === 'swap') {\n if (up.layer.isOverlay()) {\n options.baseLayer = 'parent';\n }\n }\n else if (openMethod === 'shatter') {\n options.baseLayer = 'root';\n }\n }\n }\n else if (u.isElementLike(options.target)) {\n options.layer = stack.get(options.target, { normalizeLayerOptions: false });\n }\n else if (options.origin) {\n options.layer = 'origin';\n }\n else {\n options.layer = 'current';\n }\n }\n function setBaseLayerOption(options) {\n if (options.baseLayer instanceof up.Layer)\n return;\n options.baseLayer = stack.get('current', { ...options, normalizeLayerOptions: false });\n }\n function normalizeOptions(options) {\n normalizeLayerOption(options);\n options.context ??= {};\n setBaseLayerOption(options);\n }\n function build(options, beforeNew) {\n const { mode } = options;\n const { Class } = config[mode];\n const configs = u.reverse(modeConfigs(mode));\n let handleDeprecatedConfig = up.migrate.handleLayerConfig;\n if (handleDeprecatedConfig) {\n configs.forEach(handleDeprecatedConfig);\n }\n options.openAnimation ??= u.pluckKey(options, 'animation');\n options = u.mergeDefined(...configs, { mode, stack }, options);\n if (beforeNew) {\n options = beforeNew(options);\n }\n return new Class(options);\n }\n function openCallbackAttr(link, attr) {\n return e.callbackAttr(link, attr, { exposedKeys: ['layer'] });\n }\n function closeCallbackAttr(link, attr) {\n return e.callbackAttr(link, attr, { exposedKeys: ['layer', 'value', 'response'] });\n }\n function reset() {\n stack.reset();\n handlers = u.filter(handlers, 'isDefault');\n }\n async function open(options) {\n options = u.options(options, {\n layer: 'new',\n defaultToEmptyContent: true,\n navigate: true\n });\n let result = await up.render(options);\n return result.layer;\n }\n function ask(options) {\n return new Promise(function (resolve, reject) {\n options = {\n ...options,\n onAccepted: (event) => resolve(event.value),\n onDismissed: (event) => reject(event.value)\n };\n open(options);\n });\n }\n function anySelector() {\n return u.map(LAYER_CLASSES, Class => Class.selector()).join();\n }\n function optionToString(option) {\n if (u.isString(option)) {\n return `layer \"${option}\"`;\n }\n else {\n return option.toString();\n }\n }\n function isWithinForeignOverlay(element) {\n let selector = config.selector('foreignOverlaySelectors');\n return !!(selector && element.closest(selector));\n }\n up.on('up:fragment:destroyed', function () {\n stack.sync();\n });\n up.on('up:framework:evaled', function () {\n stack = new up.LayerStack();\n });\n up.on('up:framework:reset', reset);\n const api = {\n config,\n mainTargets,\n open,\n build,\n ask,\n normalizeOptions,\n openCallbackAttr,\n closeCallbackAttr,\n anySelector,\n optionToString,\n get stack() { return stack.layers; },\n isWithinForeignOverlay\n };\n u.delegate(api, [\n 'get',\n 'getAll',\n 'root',\n 'overlays',\n 'current',\n 'front',\n 'sync',\n 'count',\n 'dismissOverlays'\n ], () => stack);\n u.delegate(api, [\n 'accept',\n 'dismiss',\n 'isRoot',\n 'isOverlay',\n 'isFront',\n 'on',\n 'off',\n 'emit',\n 'parent',\n 'history',\n 'location',\n 'mode',\n 'context',\n 'element',\n 'contains',\n 'size',\n 'affix'\n ], () => stack.current);\n return api;\n})();\n\n\n/***/ }),\n/* 94 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 95 */\n/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {\n\n__webpack_require__(96);\nup.link = (function () {\n const u = up.util;\n const e = up.element;\n let lastMousedownTarget = null;\n const ATTRS_WITH_LOCAL_HTML = '[up-content], [up-fragment], [up-document]';\n const ATTRS_SUGGESTING_FOLLOW = `${ATTRS_WITH_LOCAL_HTML}, [up-target], [up-layer], [up-transition], [up-preload]`;\n const DEFAULT_INTERACTIVE_ELEMENT = 'a[href], button';\n const config = new up.Config(() => ({\n followSelectors: ['[up-follow]', `a:is(${ATTRS_SUGGESTING_FOLLOW})`],\n noFollowSelectors: ['[up-follow=false]', 'a[download]', 'a[target]', 'a[href^=\"javascript:\"]', 'a[href^=\"mailto:\"]', 'a[href^=\"tel:\"]', `a[href^=\"#\"]:not(${ATTRS_WITH_LOCAL_HTML})`, e.crossOriginSelector('href'), e.crossOriginSelector('up-href')],\n instantSelectors: ['[up-instant]'],\n noInstantSelectors: ['[up-instant=false]', '[onclick]'],\n preloadSelectors: ['[up-preload]'],\n noPreloadSelectors: ['[up-preload=false]'],\n clickableSelectors: ['[up-clickable]', '[up-follow]', '[up-emit]', '[up-accept]', '[up-dismiss]', `a:is(${ATTRS_SUGGESTING_FOLLOW})`],\n noClickableSelectors: ['[up-clickable=false]', DEFAULT_INTERACTIVE_ELEMENT],\n preloadDelay: 90,\n }));\n function isPreloadDisabled(link) {\n return !up.browser.canPushState() || !isFollowable(link) || !willCache(link);\n }\n function willCache(link) {\n const options = parseRequestOptions(link);\n if (options.url) {\n if (options.cache == null) {\n options.cache = 'auto';\n }\n options.basic = true;\n const request = new up.Request(options);\n return request.willCache();\n }\n }\n function reset() {\n lastMousedownTarget = null;\n }\n const follow = up.mockable(function (link, options, parserOptions) {\n return up.render(followOptions(link, options, parserOptions));\n });\n function parseRequestOptions(link, options, parserOptions) {\n options = u.options(options);\n const parser = new up.OptionsParser(link, options, { ...parserOptions, fail: false });\n options.url = followURL(link, options);\n options.method = followMethod(link, options);\n parser.json('headers');\n parser.json('params');\n parser.booleanOrString('cache');\n parser.booleanOrString('expireCache');\n parser.booleanOrString('evictCache');\n parser.booleanOrString('revalidate');\n parser.booleanOrString('abort');\n parser.boolean('abortable');\n parser.boolean('background');\n parser.string('contentType');\n parser.booleanOrNumber('lateDelay');\n parser.number('timeout');\n return options;\n }\n function followOptions(link, options, parserOptions) {\n link = up.fragment.get(link);\n options = u.options(options);\n const parser = new up.OptionsParser(link, options, { fail: true, ...parserOptions });\n parser.include(parseRequestOptions);\n options.origin ||= link;\n parser.boolean('fail');\n parser.boolean('navigate', { default: true });\n parser.string('confirm', { attr: ['up-confirm', 'data-confirm'] });\n parser.string('target');\n parser.booleanOrString('fallback');\n parser.string('match');\n parser.string('document');\n parser.string('fragment');\n parser.string('content');\n parser.boolean('keep', { attr: 'up-use-keep' });\n parser.boolean('hungry', { attr: 'up-use-hungry' });\n parser.json('data', { attr: 'up-use-data' });\n parser.callback('onLoaded');\n parser.callback('onRendered', { mainKey: 'result' });\n parser.callback('onFinished', { mainKey: 'result' });\n parser.callback('onOffline', { mainKey: 'error' });\n parser.callback('onError', { mainKey: 'error' });\n parser.boolean('peel');\n parser.string('layer');\n parser.string('baseLayer');\n parser.json('context');\n parser.string('mode');\n parser.string('align');\n parser.string('position');\n parser.string('class');\n parser.string('size');\n parser.booleanOrString('dismissable');\n parser.parse(up.layer.openCallbackAttr, 'onOpened');\n parser.parse(up.layer.closeCallbackAttr, 'onAccepted');\n parser.parse(up.layer.closeCallbackAttr, 'onDismissed');\n parser.string('acceptEvent');\n parser.string('dismissEvent');\n parser.string('acceptLocation');\n parser.string('dismissLocation');\n parser.booleanOrString('history');\n parser.include(up.status.statusOptions);\n parser.booleanOrString('focus');\n parser.boolean('saveScroll');\n parser.boolean('saveFocus');\n parser.booleanOrString('scroll');\n parser.boolean('revealTop');\n parser.number('revealMax');\n parser.number('revealPadding');\n parser.number('revealSnap');\n parser.string('scrollBehavior');\n parser.booleanOrString('history');\n parser.booleanOrString('location');\n parser.booleanOrString('title');\n parser.boolean('metaTags');\n parser.booleanOrString('lang');\n parser.include(up.motion.motionOptions);\n options.guardEvent ??= up.event.build('up:link:follow', { log: ['Following link %o', link] });\n return options;\n }\n function preload(link, options) {\n link = up.fragment.get(link);\n let issue = preloadIssue(link);\n if (issue) {\n return Promise.reject(new up.Error(issue));\n }\n const guardEvent = up.event.build('up:link:preload', { log: ['Preloading link %o', link] });\n return follow(link, {\n abort: false,\n abortable: false,\n background: true,\n cache: true,\n ...up.RenderOptions.NO_INPUT_INTERFERENCE,\n ...up.RenderOptions.NO_PREVIEWS,\n ...options,\n guardEvent,\n preload: true,\n });\n }\n function preloadIssue(link) {\n if (!isSafe(link)) {\n return 'Will not preload an unsafe link';\n }\n }\n function followMethod(link, options = {}) {\n return u.normalizeMethod(options.method || link.getAttribute('up-method') || link.getAttribute('data-method'));\n }\n function followURL(link, options = {}) {\n const url = options.url || link.getAttribute('up-href') || link.getAttribute('href');\n if (url !== '#') {\n return url;\n }\n }\n function isFollowable(link) {\n link = up.fragment.get(link);\n return config.matches(link, 'followSelectors');\n }\n function makeFollowable(link) {\n if (!isFollowable(link)) {\n link.setAttribute('up-follow', '');\n }\n }\n function makeClickable(element) {\n let role = element.matches('a, [up-follow]') ? 'link' : 'button';\n e.setMissingAttrs(element, {\n tabindex: '0',\n role,\n 'up-clickable': ''\n });\n element.addEventListener('keydown', function (event) {\n if ((event.key === 'Enter') || (element.role === 'button' && event.key === 'Space')) {\n return forkEventAsUpClick(event);\n }\n });\n }\n up.macro(config.selectorFn('clickableSelectors'), makeClickable);\n function shouldFollowEvent(event, link) {\n if (event.defaultPrevented) {\n return false;\n }\n const betterTargetSelector = `a, [up-follow], ${up.form.fieldSelector()}`;\n const betterTarget = event.target.closest(betterTargetSelector);\n return !betterTarget || (betterTarget === link);\n }\n function isInstant(linkOrDescendant) {\n const element = linkOrDescendant.closest(config.selector('instantSelectors'));\n return element && !isInstantDisabled(element);\n }\n function isInstantDisabled(link) {\n return config.matches(link, 'noInstantSelectors') || config.matches(link, 'noFollowSelectors');\n }\n function convertClicks(layer) {\n layer.on('click', function (event, element) {\n if (!up.event.isUnmodified(event)) {\n return;\n }\n if (isInstant(element) && lastMousedownTarget) {\n up.event.halt(event);\n }\n else if (up.event.inputDevice === 'key' || up.event.isSyntheticClick(event) || (layer.wasHitByMouseEvent(event) && !didUserDragAway(event))) {\n forkEventAsUpClick(event);\n }\n return lastMousedownTarget = null;\n });\n layer.on('mousedown', function (event, element) {\n if (!up.event.isUnmodified(event)) {\n return;\n }\n lastMousedownTarget = event.target;\n if (isInstant(element)) {\n forkEventAsUpClick(event);\n }\n });\n }\n function didUserDragAway(clickEvent) {\n return lastMousedownTarget && (lastMousedownTarget !== clickEvent.target);\n }\n function forkEventAsUpClick(originalEvent) {\n let forwardedProps = ['clientX', 'clientY', 'button', ...up.event.keyModifiers];\n const newEvent = up.event.fork(originalEvent, 'up:click', forwardedProps);\n up.emit(originalEvent.target, newEvent, { log: false });\n }\n function isSafe(link) {\n const method = followMethod(link);\n return up.network.isSafeMethod(method);\n }\n function onLoadCondition(condition, link, callback) {\n switch (condition) {\n case 'insert':\n callback();\n break;\n case 'reveal': {\n let margin = e.numberAttr(link, 'up-intersect-margin');\n up.fragment.onFirstIntersect(link, callback, { margin });\n break;\n }\n case 'hover':\n new up.LinkFollowIntent(link, callback);\n break;\n case 'manual':\n break;\n }\n }\n function loadDeferred(link, options) {\n let guardEvent = up.event.build('up:deferred:load', { log: ['Loading deferred %o', link] });\n let forcedOptions = {\n navigate: false,\n guardEvent,\n ...options,\n };\n let defaults = {\n target: ':origin',\n cache: 'auto',\n revalidate: 'auto',\n feedback: true,\n };\n return follow(link, forcedOptions, { defaults });\n }\n up.attribute('up-defer', { defaultValue: 'insert' }, function (link, condition) {\n let doLoad = (options) => up.error.muteUncriticalRejection(loadDeferred(link, options));\n onLoadCondition(condition, link, doLoad);\n });\n up.on('up:click', config.selectorFn('followSelectors'), function (event, link) {\n if (shouldFollowEvent(event, link)) {\n up.event.halt(event, { log: true });\n up.focus(link, { preventScroll: true });\n up.error.muteUncriticalRejection(follow(link));\n }\n });\n up.attribute('up-expand', { defaultValue: 'a, [up-href]', macro: true }, function (area, childLinkSelector) {\n let childLink = e.get(area, childLinkSelector);\n if (childLink) {\n e.setMissingAttrs(area, {\n 'up-href': e.attr(childLink, 'href'),\n ...e.upAttrs(childLink)\n });\n e.addClasses(area, e.upClasses(childLink));\n makeFollowable(area);\n }\n });\n up.compiler(config.selectorFn('preloadSelectors'), function (link) {\n if (!isPreloadDisabled(link)) {\n let doPreload = (options) => up.error.muteUncriticalRejection(preload(link, options));\n let condition = e.booleanOrStringAttr(link, 'up-preload');\n if (condition === true || u.isUndefined(condition))\n condition = 'hover';\n onLoadCondition(condition, link, doPreload);\n }\n });\n up.on('up:framework:reset', reset);\n return {\n follow,\n followOptions,\n requestOptions: parseRequestOptions,\n preload,\n makeFollowable,\n isSafe,\n isFollowable,\n shouldFollowEvent,\n convertClicks,\n config,\n loadDeferred,\n };\n})();\nup.follow = up.link.follow;\nup.deferred = { load: up.link.loadDeferred };\n\n\n/***/ }),\n/* 96 */\n/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {\n\n\"use strict\";\n__webpack_require__.r(__webpack_exports__);\n// extracted by mini-css-extract-plugin\n\n\n/***/ }),\n/* 97 */\n/***/ (() => {\n\nup.form = (function () {\n const u = up.util;\n const e = up.element;\n const config = new up.Config(() => ({\n groupSelectors: ['[up-form-group]', 'fieldset', 'label', 'form'],\n fieldSelectors: ['select', 'input:not([type=submit], [type=image], [type=button])', 'button[type]:not([type=submit], [type=button])', 'textarea'],\n submitSelectors: ['form:is([up-submit], [up-target], [up-layer], [up-transition])'],\n noSubmitSelectors: ['[up-submit=false]', '[target]', e.crossOriginSelector('action')],\n submitButtonSelectors: ['input[type=submit]', 'input[type=image]', 'button[type=submit]', 'button:not([type])'],\n genericButtonSelectors: ['input[type=button]', 'button[type=button]'],\n watchInputEvents: ['input', 'change'],\n watchInputDelay: 0,\n watchChangeEvents: ['change'],\n }));\n function fieldSelector(suffix = '') {\n return config.fieldSelectors.map(field => field + suffix).join();\n }\n function isField(element) {\n return element.matches(fieldSelector());\n }\n function findFields(root) {\n root = e.get(root);\n let fields = e.subtree(root, fieldSelector());\n if (root.matches('form[id]')) {\n const outsideFieldSelector = fieldSelector(e.attrSelector('form', root.getAttribute('id')));\n const outsideFields = up.fragment.all(outsideFieldSelector, { layer: root });\n fields.push(...outsideFields);\n fields = u.uniq(fields);\n }\n return fields;\n }\n function findSubmitButtons(root) {\n return e.subtree(root, submitButtonSelector());\n }\n function findGenericButtons(root) {\n return e.subtree(root, config.selector('genericButtonSelectors'));\n }\n function isSubmitButton(element) {\n return element?.matches(submitButtonSelector());\n }\n function submitButtonSelector() {\n return config.selector('submitButtonSelectors');\n }\n const submit = up.mockable((form, options) => {\n return up.render(submitOptions(form, options));\n });\n function submitOptions(form, options, parserOptions) {\n form = getForm(form);\n options = u.options(options);\n let parser = new up.OptionsParser(form, options, parserOptions);\n parser.include(destinationOptions);\n parser.string('failTarget', { default: up.fragment.tryToTarget(form) });\n options.guardEvent ||= up.event.build('up:form:submit', {\n submitButton: options.submitButton,\n log: 'Submitting form',\n params: options.params,\n form,\n });\n options.origin ||= up.viewport.focusedElementWithin(form) || options.submitButton || form;\n options.activeElements = u.uniq([options.origin, options.submitButton, form].filter(u.isElement));\n parser.include(up.link.followOptions);\n return options;\n }\n function watchOptions(field, options, parserOptions = {}) {\n options = u.options(options);\n let parser = new up.OptionsParser(field, options, { ...parserOptions, closest: true, attrPrefix: 'up-watch-' });\n parser.include(up.status.statusOptions);\n parser.string('event');\n parser.number('delay');\n let config = up.form.config;\n if (options.event === 'input') {\n options.event = u.evalOption(config.watchInputEvents, field);\n options.delay ??= config.watchInputDelay;\n }\n else if (options.event === 'change') {\n options.event = u.evalOption(config.watchChangeEvents, field);\n }\n options.origin ||= field;\n return options;\n }\n function disableContainer(container) {\n let controls = [\n ...findFields(container),\n ...findSubmitButtons(container),\n ...findGenericButtons(container),\n ];\n return u.sequence(u.map(controls, disableControl));\n }\n function disableControl(control) {\n if (control.disabled)\n return;\n let focusFallback;\n if (document.activeElement === control) {\n focusFallback = findGroup(control);\n control.disabled = true;\n up.focus(focusFallback, { force: true, preventScroll: true });\n }\n else {\n control.disabled = true;\n }\n return () => { control.disabled = false; };\n }\n function getDisableContainers(disable, origin) {\n let originScope = () => getScope(origin);\n if (disable === true) {\n return [originScope()];\n }\n else if (u.isElement(disable)) {\n return [disable];\n }\n else if (u.isString(disable)) {\n return up.fragment.subtree(originScope(), disable, { origin });\n }\n else if (u.isArray(disable)) {\n return u.flatMap(disable, (d) => getDisableContainers(d, origin));\n }\n else {\n return [];\n }\n }\n function getDisablePreviewFn(disable, origin) {\n return function (preview) {\n let containers = getDisableContainers(disable, origin);\n for (let container of containers) {\n preview.disable(container);\n }\n };\n }\n function destinationOptions(form, options, parserOptions) {\n options = u.options(options);\n form = getForm(form);\n const parser = new up.OptionsParser(form, options, parserOptions);\n parser.string('contentType', { attr: 'enctype' });\n parser.json('headers');\n const params = up.Params.fromForm(form);\n const submitButton = (options.submitButton ??= findSubmitButtons(form)[0]);\n if (submitButton) {\n params.addField(submitButton);\n options.method ||= submitButton.getAttribute('formmethod');\n options.url ||= submitButton.getAttribute('formaction');\n }\n params.addAll(options.params);\n options.params = params;\n parser.string('url', { attr: 'action', default: up.fragment.source(form) });\n parser.string('method', {\n attr: ['up-method', 'data-method', 'method'],\n default: 'GET',\n normalize: u.normalizeMethod\n });\n if (options.method === 'GET') {\n options.url = up.Params.stripURL(options.url);\n }\n return options;\n }\n function watch(...args) {\n let [root, options, callback] = u.args(args, 'val', 'options', 'callback');\n root = up.element.get(root);\n callback ||= watchCallbackFromElement(root) || up.fail('No callback given for up.watch()');\n const watcher = new up.FieldWatcher(root, options, callback);\n watcher.start();\n return () => watcher.stop();\n }\n function watchCallbackFromElement(element) {\n let rawCallback = element.getAttribute('up-watch');\n if (rawCallback) {\n return up.NonceableCallback.fromString(rawCallback).toFunction('value', 'name', 'options').bind(element);\n }\n }\n function autosubmit(target, options = {}) {\n const onChange = (_diff, renderOptions) => submit(target, renderOptions);\n return watch(target, { ...options, batch: true }, onChange);\n }\n function getGroupSelectors() {\n return up.migrate.migratedFormGroupSelectors?.() || config.groupSelectors;\n }\n function findGroup(field) {\n return findGroupSolution(field).element;\n }\n function findGroupSolution(field) {\n return u.findResult(getGroupSelectors(), function (groupSelector) {\n let group = field.closest(groupSelector);\n if (group) {\n let strongDerivedGroupTarget = up.fragment.tryToTarget(group, { strong: true });\n let goodDerivedFieldTarget = up.fragment.tryToTarget(field);\n let groupHasFieldTarget = goodDerivedFieldTarget && (group !== field) && `${groupSelector}:has(${goodDerivedFieldTarget})`;\n let target = strongDerivedGroupTarget || groupHasFieldTarget;\n if (target) {\n return {\n target,\n element: group,\n origin: field\n };\n }\n }\n });\n }\n function validate(...args) {\n let options = parseValidateArgs(...args);\n let validator = up.FormValidator.forElement(options.origin);\n return validator.validate(options);\n }\n function parseValidateArgs(originOrTarget, ...args) {\n const options = u.extractOptions(args);\n if (options.origin) {\n options.target ||= up.fragment.toTarget(originOrTarget);\n }\n else {\n options.origin ||= up.fragment.get(originOrTarget);\n }\n return options;\n }\n function switcherValues(field) {\n let value;\n let meta;\n if (field.matches('input[type=checkbox]')) {\n if (field.checked) {\n value = field.value;\n meta = ':checked';\n }\n else {\n meta = ':unchecked';\n }\n }\n else if (field.matches('input[type=radio]')) {\n const form = getScope(field);\n const groupName = field.getAttribute('name');\n const checkedButton = form.querySelector(`input[type=radio]${e.attrSelector('name', groupName)}:checked`);\n if (checkedButton) {\n meta = ':checked';\n value = checkedButton.value;\n }\n else {\n meta = ':unchecked';\n }\n }\n else {\n value = field.value;\n }\n const values = [];\n if (u.isPresent(value)) {\n values.push(value);\n values.push(':present');\n }\n else {\n values.push(':blank');\n }\n if (u.isPresent(meta)) {\n values.push(meta);\n }\n return values;\n }\n function switchTargets(switcher, options = {}) {\n const targetSelector = options.target || options.target || switcher.getAttribute('up-switch');\n const form = getScope(switcher);\n targetSelector || up.fail(\"No switch target given for %o\", switcher);\n const fieldValues = switcherValues(switcher);\n for (let target of up.fragment.all(form, targetSelector)) {\n switchTarget(target, fieldValues);\n }\n }\n const switchTarget = up.mockable(function (target, fieldValues) {\n let show;\n fieldValues ||= switcherValues(findSwitcherForTarget(target));\n let hideValues = target.getAttribute('up-hide-for');\n if (hideValues) {\n hideValues = parseSwitchTokens(hideValues);\n show = u.intersect(fieldValues, hideValues).length === 0;\n }\n else {\n let showValues = target.getAttribute('up-show-for');\n showValues = showValues ? parseSwitchTokens(showValues) : [':present', ':checked'];\n show = u.intersect(fieldValues, showValues).length > 0;\n }\n e.toggle(target, show);\n target.classList.add('up-switched');\n });\n function parseSwitchTokens(str) {\n return u.getSimpleTokens(str, { json: true });\n }\n function findSwitcherForTarget(target) {\n const form = getScope(target);\n const switchers = form.querySelectorAll('[up-switch]');\n const switcher = u.find(switchers, function (switcher) {\n const targetSelector = switcher.getAttribute('up-switch');\n return target.matches(targetSelector);\n });\n return switcher || up.fail('Could not find [up-switch] field for %o', target);\n }\n function getForm(elementOrSelector, options = {}) {\n const element = up.fragment.get(elementOrSelector, options);\n return element.form || element.closest('form');\n }\n function getScope(origin, options) {\n if (origin) {\n return getForm(origin, options) || up.layer.get(origin).element;\n }\n else {\n return up.layer.current.element;\n }\n }\n function focusedField() {\n return u.presence(document.activeElement, isField);\n }\n function isSubmittable(form) {\n form = up.fragment.get(form);\n return config.matches(form, 'submitSelectors');\n }\n up.on('submit', config.selectorFn('submitSelectors'), function (event, form) {\n if (event.defaultPrevented)\n return;\n const submitButton = u.presence(event.submitter, isSubmitButton);\n up.event.halt(event, { log: true });\n up.error.muteUncriticalRejection(submit(form, { submitButton }));\n });\n up.compiler(validatingFieldSelector, function (fieldOrForm) {\n let validator = up.FormValidator.forElement(fieldOrForm);\n validator.watchContainer(fieldOrForm);\n });\n function validatingFieldSelector() {\n let includes = config.fieldSelectors.map((selector) => `${selector}[up-validate], [up-validate] ${selector}`);\n let excludes = ['[up-validate=false]'];\n return e.unionSelector(includes, excludes);\n }\n up.compiler('[up-switch]', (switcher) => {\n switchTargets(switcher);\n });\n up.on('change', '[up-switch]', (_event, switcher) => {\n switchTargets(switcher);\n });\n up.compiler('[up-show-for]:not(.up-switched), [up-hide-for]:not(.up-switched)', (element) => {\n switchTarget(element);\n });\n up.attribute('up-watch', (formOrField) => watch(formOrField));\n up.attribute('up-autosubmit', (formOrField) => autosubmit(formOrField));\n return {\n config,\n submit,\n submitOptions,\n destinationOptions,\n watchOptions,\n isSubmittable,\n watch,\n validate,\n autosubmit,\n fieldSelector,\n fields: findFields,\n isField,\n submitButtons: findSubmitButtons,\n focusedField,\n switchTarget,\n disable: disableContainer,\n getDisablePreviewFn,\n group: findGroup,\n groupSolution: findGroupSolution,\n groupSelectors: getGroupSelectors,\n get: getForm,\n getScope,\n };\n})();\nup.submit = up.form.submit;\nup.watch = up.form.watch;\nup.autosubmit = up.form.autosubmit;\nup.validate = up.form.validate;\n\n\n/***/ }),\n/* 98 */\n/***/ (() => {\n\nup.status = (function () {\n const u = up.util;\n const e = up.element;\n let namedPreviewFns = {};\n const config = new up.Config(() => ({\n currentClasses: ['up-current'],\n activeClasses: ['up-active'],\n loadingClasses: ['up-loading'],\n navSelectors: ['[up-nav]', 'nav'],\n noNavSelectors: ['[up-nav=false]'],\n }));\n function reset() {\n up.layer.root.feedbackLocation = null;\n namedPreviewFns = u.pickBy(namedPreviewFns, 'isDefault');\n }\n const SELECTOR_LINK = 'a, [up-href]';\n function linkCurrentURLs(link) {\n return link.upCurrentURLs ||= new up.LinkCurrentURLs(link);\n }\n function updateFragment(fragment, { layer } = {}) {\n layer ||= up.layer.get(fragment);\n let layerLocation = getMatchableLayerLocation(layer);\n const navSelector = config.selector('navSelectors');\n const navLinkSelector = `${navSelector} :is(${SELECTOR_LINK}), ${navSelector}:is(${SELECTOR_LINK})`;\n const links = up.fragment.all(navLinkSelector, { layer });\n for (let link of links) {\n const isCurrent = linkCurrentURLs(link).isCurrent(layerLocation);\n for (let currentClass of config.currentClasses) {\n link.classList.toggle(currentClass, isCurrent);\n }\n e.setAttrPresence(link, 'aria-current', 'page', isCurrent);\n }\n }\n function getMatchableLayerLocation(layer) {\n return layer.feedbackLocation || u.matchableURL(layer.location);\n }\n function findActivatableArea(element) {\n return e.ancestor(element, SELECTOR_LINK) || element;\n }\n function runPreviews(request, renderOptions) {\n let { bindLayer } = request;\n let focusCapsule = up.FocusCapsule.preserve(bindLayer);\n let applyPreviews = () => doRunPreviews(request, renderOptions);\n let revertPreviews = bindLayer.asCurrent(applyPreviews);\n focusCapsule?.autoVoid();\n return () => {\n bindLayer.asCurrent(revertPreviews);\n focusCapsule?.restore(bindLayer, { preventScroll: true });\n };\n }\n function doRunPreviews(request, renderOptions) {\n let { fragment, fragments, origin } = request;\n let cleaner = u.cleaner();\n let previewForFragment = (fragment) => new up.Preview({ fragment, request, renderOptions, cleaner });\n let singlePreview = previewForFragment(fragment);\n singlePreview.run(resolvePreviewFns(renderOptions.preview));\n singlePreview.run(getPlaceholderPreviewFn(renderOptions.placeholder));\n singlePreview.run(getFeedbackClassesPreviewFn(renderOptions.feedback, fragments));\n singlePreview.run(up.form.getDisablePreviewFn(renderOptions.disable, origin));\n for (let fragment of fragments) {\n let eachPreview = previewForFragment(fragment);\n eachPreview.run(e.matchSelectorMap(renderOptions.previewMap, fragment));\n eachPreview.run(e.matchSelectorMap(renderOptions.placeholderMap, fragment).flatMap(getPlaceholderPreviewFn));\n }\n return cleaner.clean;\n }\n function getPlaceholderPreviewFn(placeholder) {\n if (!placeholder)\n return;\n return function (preview) {\n preview.showPlaceholder(placeholder);\n };\n }\n function resolvePreviewFns(value) {\n if (u.isFunction(value)) {\n return [value];\n }\n else if (u.isString(value)) {\n return resolvePreviewString(value);\n }\n else if (u.isArray(value)) {\n return value.flatMap(resolvePreviewFns);\n }\n else {\n return [];\n }\n }\n function resolvePreviewString(str) {\n return u.map(u.parseScalarJSONPairs(str), ([name, parsedOptions]) => {\n let previewFn = namedPreviewFns[name] || up.fail('Unknown preview \"%s\"', name);\n return function (preview, runOptions) {\n up.puts('[up-preview]', 'Showing preview %o', name);\n return previewFn(preview, parsedOptions || runOptions);\n };\n });\n }\n function getActiveElements({ origin, activeElements }) {\n activeElements ||= u.wrapList(origin);\n return activeElements.map(findActivatableArea);\n }\n function registerPreview(name, previewFn) {\n previewFn.isDefault = up.framework.evaling;\n namedPreviewFns[name] = previewFn;\n }\n function getFeedbackClassesPreviewFn(feedbackOption, fragments) {\n if (!feedbackOption)\n return;\n return function (preview) {\n preview.addClassBatch(getActiveElements(preview.renderOptions), config.activeClasses);\n preview.addClassBatch(fragments, config.loadingClasses);\n };\n }\n function statusOptions(element, options, parserOptions) {\n options = u.options(options);\n const parser = new up.OptionsParser(element, options, parserOptions);\n parser.booleanOrString('disable');\n parser.boolean('feedback');\n parser.string('preview');\n parser.booleanOrString('revalidatePreview');\n parser.string('placeholder');\n return options;\n }\n function updateLayerIfLocationChanged(layer) {\n const processedLocation = layer.feedbackLocation;\n const layerLocation = getMatchableLayerLocation(layer.location);\n if (!processedLocation || (processedLocation !== layerLocation)) {\n layer.feedbackLocation = layerLocation;\n updateFragment(layer.element, { layer });\n }\n }\n function onBrowserLocationChanged() {\n const frontLayer = up.layer.front;\n if (frontLayer.showsLiveHistory()) {\n updateLayerIfLocationChanged(frontLayer);\n }\n }\n up.on('up:location:changed', (_event) => {\n onBrowserLocationChanged();\n });\n up.on('up:fragment:compile', (_event, newFragment) => {\n updateFragment(newFragment);\n });\n up.on('up:layer:location:changed', (event) => {\n updateLayerIfLocationChanged(event.layer);\n });\n up.on('up:framework:reset', reset);\n return {\n config,\n preview: registerPreview,\n resolvePreviewFns,\n runPreviews,\n statusOptions,\n };\n})();\nup.preview = up.status.preview;\n\n\n/***/ }),\n/* 99 */\n/***/ (() => {\n\nup.radio = (function () {\n const e = up.element;\n const config = new up.Config(() => ({\n hungrySelectors: ['[up-hungry]'],\n noHungrySelectors: ['[up-hungry=false]'],\n pollInterval: 30000,\n }));\n function hungrySteps(renderOptions) {\n let { hungry, origin, layer: renderLayer, meta } = renderOptions;\n let steps = { current: [], other: [] };\n if (!hungry)\n return steps;\n let hungrySelector = config.selector('hungrySelectors');\n const layerPreference = [renderLayer, ...renderLayer.ancestors, ...renderLayer.descendants];\n for (let elementLayer of layerPreference) {\n let hungries = up.fragment.all(elementLayer.element, hungrySelector, { layer: elementLayer });\n for (let element of hungries) {\n let selector = up.fragment.tryToTarget(element, { origin });\n if (!selector) {\n up.warn('[up-hungry]', 'Ignoring untargetable fragment %o', element);\n continue;\n }\n let ifLayer = e.attr(element, 'up-if-layer');\n let applicableLayers = ifLayer ? up.layer.getAll(ifLayer, { baseLayer: elementLayer }) : [elementLayer];\n let motionOptions = up.motion.motionOptions(element);\n let selectEvent = up.event.build('up:fragment:hungry', { log: false });\n let selectCallback = e.callbackAttr(element, 'up-on-hungry', { exposedKeys: ['newFragment', 'renderOptions'] });\n let step = {\n selector,\n oldElement: element,\n layer: elementLayer,\n origin,\n ...motionOptions,\n placement: 'swap',\n keep: true,\n maybe: true,\n meta,\n selectEvent,\n selectCallback,\n originalRenderOptions: renderOptions,\n };\n if (applicableLayers.includes(renderLayer)) {\n let list = renderLayer === elementLayer ? steps.current : steps.other;\n list.push(step);\n }\n }\n }\n steps.other = up.fragment.compressNestedSteps(steps.other);\n return steps;\n }\n function startPolling(fragment, options = {}) {\n up.FragmentPolling.forFragment(fragment).forceStart(options);\n }\n function stopPolling(element) {\n up.FragmentPolling.forFragment(element).forceStop();\n }\n function pollOptions(fragment, options = {}) {\n const defaults = { background: true };\n const parser = new up.OptionsParser(fragment, options, { defaults });\n parser.number('interval', { default: config.pollInterval });\n parser.string('ifLayer', { default: 'front' });\n parser.include(up.link.requestOptions);\n parser.include(up.status.statusOptions);\n return options;\n }\n up.attribute('up-poll', function (fragment) {\n up.FragmentPolling.forFragment(fragment).onPollAttributeObserved();\n });\n up.macro('[up-flashes]', function (fragment) {\n e.setMissingAttrs(fragment, {\n 'up-hungry': '',\n 'up-if-layer': 'subtree',\n 'up-keep': '',\n 'role': 'alert',\n });\n fragment.addEventListener('up:fragment:keep', function (event) {\n if (!e.isEmpty(event.newFragment))\n event.preventDefault();\n });\n });\n return {\n config,\n hungrySteps,\n startPolling,\n stopPolling,\n pollOptions,\n };\n})();\n\n\n/***/ }),\n/* 100 */\n/***/ (() => {\n\n(function () {\n const e = up.element;\n function isRails() {\n return window.Rails ||\n window.jQuery?.rails;\n }\n for (let feature of ['method', 'confirm']) {\n const upAttribute = `up-${feature}`;\n const dataAttribute = `data-${feature}`;\n up.macro(`a[${dataAttribute}]`, function (link) {\n if (isRails() && up.link.isFollowable(link)) {\n e.setMissingAttr(link, upAttribute, link.getAttribute(dataAttribute));\n link.removeAttribute(dataAttribute);\n }\n });\n }\n})();\n\n\n/***/ })\n/******/ \t]);\n/************************************************************************/\n/******/ \t// The module cache\n/******/ \tvar __webpack_module_cache__ = {};\n/******/ \t\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/ \t\t// Check if module is in cache\n/******/ \t\tvar cachedModule = __webpack_module_cache__[moduleId];\n/******/ \t\tif (cachedModule !== undefined) {\n/******/ \t\t\treturn cachedModule.exports;\n/******/ \t\t}\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = __webpack_module_cache__[moduleId] = {\n/******/ \t\t\t// no module.id needed\n/******/ \t\t\t// no module.loaded needed\n/******/ \t\t\texports: {}\n/******/ \t\t};\n/******/ \t\n/******/ \t\t// Execute the module function\n/******/ \t\t__webpack_modules__[moduleId](module, module.exports, __webpack_require__);\n/******/ \t\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/ \t\n/************************************************************************/\n/******/ \t/* webpack/runtime/make namespace object */\n/******/ \t(() => {\n/******/ \t\t// define __esModule on exports\n/******/ \t\t__webpack_require__.r = (exports) => {\n/******/ \t\t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n/******/ \t\t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n/******/ \t\t\t}\n/******/ \t\t\tObject.defineProperty(exports, '__esModule', { value: true });\n/******/ \t\t};\n/******/ \t})();\n/******/ \t\n/************************************************************************/\nvar __webpack_exports__ = {};\n// This entry need to be wrapped in an IIFE because it need to be isolated against other modules in the chunk.\n(() => {\n__webpack_require__(1);\n__webpack_require__(2);\n__webpack_require__(3);\n__webpack_require__(4);\n__webpack_require__(5);\n__webpack_require__(6);\n__webpack_require__(7);\n__webpack_require__(9);\n__webpack_require__(10);\n__webpack_require__(11);\n__webpack_require__(12);\n__webpack_require__(13);\n__webpack_require__(14);\n__webpack_require__(15);\n__webpack_require__(16);\n__webpack_require__(17);\n__webpack_require__(18);\n__webpack_require__(19);\n__webpack_require__(20);\n__webpack_require__(21);\n__webpack_require__(22);\n__webpack_require__(23);\n__webpack_require__(24);\n__webpack_require__(25);\n__webpack_require__(26);\n__webpack_require__(27);\n__webpack_require__(28);\n__webpack_require__(29);\n__webpack_require__(30);\n__webpack_require__(31);\n__webpack_require__(32);\n__webpack_require__(33);\n__webpack_require__(34);\n__webpack_require__(35);\n__webpack_require__(36);\n__webpack_require__(37);\n__webpack_require__(38);\n__webpack_require__(39);\n__webpack_require__(40);\n__webpack_require__(41);\n__webpack_require__(42);\n__webpack_require__(43);\n__webpack_require__(44);\n__webpack_require__(45);\n__webpack_require__(46);\n__webpack_require__(47);\n__webpack_require__(48);\n__webpack_require__(49);\n__webpack_require__(50);\n__webpack_require__(51);\n__webpack_require__(52);\n__webpack_require__(53);\n__webpack_require__(54);\n__webpack_require__(55);\n__webpack_require__(56);\n__webpack_require__(57);\n__webpack_require__(58);\n__webpack_require__(59);\n__webpack_require__(60);\n__webpack_require__(61);\n__webpack_require__(62);\n__webpack_require__(63);\n__webpack_require__(64);\n__webpack_require__(65);\n__webpack_require__(66);\n__webpack_require__(67);\n__webpack_require__(68);\n__webpack_require__(69);\n__webpack_require__(70);\n__webpack_require__(71);\n__webpack_require__(72);\n__webpack_require__(73);\n__webpack_require__(74);\n__webpack_require__(75);\n__webpack_require__(76);\n__webpack_require__(77);\n__webpack_require__(78);\n__webpack_require__(79);\n__webpack_require__(80);\n__webpack_require__(81);\n__webpack_require__(82);\n__webpack_require__(83);\n__webpack_require__(84);\n__webpack_require__(85);\n__webpack_require__(86);\n__webpack_require__(88);\n__webpack_require__(90);\n__webpack_require__(91);\n__webpack_require__(93);\n__webpack_require__(95);\n__webpack_require__(97);\n__webpack_require__(98);\n__webpack_require__(99);\n__webpack_require__(100);\nup.framework.onEvaled();\n\n})();\n\n/******/ })()\n;","/*! choices.js v11.0.2 | © 2024 Josh Johnson | https://github.com/jshjohnson/Choices#readme */\n\n/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\n/* global Reflect, Promise, SuppressedError, Symbol */\n\nvar extendStatics = function (d, b) {\n extendStatics = Object.setPrototypeOf || {\n __proto__: []\n } instanceof Array && function (d, b) {\n d.__proto__ = b;\n } || function (d, b) {\n for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p];\n };\n return extendStatics(d, b);\n};\nfunction __extends(d, b) {\n if (typeof b !== \"function\" && b !== null) throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\n extendStatics(d, b);\n function __() {\n this.constructor = d;\n }\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\n}\nvar __assign = function () {\n __assign = Object.assign || function __assign(t) {\n for (var s, i = 1, n = arguments.length; i < n; i++) {\n s = arguments[i];\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\n }\n return t;\n };\n return __assign.apply(this, arguments);\n};\nfunction __spreadArray(to, from, pack) {\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\n if (ar || !(i in from)) {\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\n ar[i] = from[i];\n }\n }\n return to.concat(ar || Array.prototype.slice.call(from));\n}\ntypeof SuppressedError === \"function\" ? SuppressedError : function (error, suppressed, message) {\n var e = new Error(message);\n return e.name = \"SuppressedError\", e.error = error, e.suppressed = suppressed, e;\n};\n\nvar ActionType = {\n ADD_CHOICE: 'ADD_CHOICE',\n REMOVE_CHOICE: 'REMOVE_CHOICE',\n FILTER_CHOICES: 'FILTER_CHOICES',\n ACTIVATE_CHOICES: 'ACTIVATE_CHOICES',\n CLEAR_CHOICES: 'CLEAR_CHOICES',\n ADD_GROUP: 'ADD_GROUP',\n ADD_ITEM: 'ADD_ITEM',\n REMOVE_ITEM: 'REMOVE_ITEM',\n HIGHLIGHT_ITEM: 'HIGHLIGHT_ITEM',\n};\n\nvar EventType = {\n showDropdown: 'showDropdown',\n hideDropdown: 'hideDropdown',\n change: 'change',\n choice: 'choice',\n search: 'search',\n addItem: 'addItem',\n removeItem: 'removeItem',\n highlightItem: 'highlightItem',\n highlightChoice: 'highlightChoice',\n unhighlightItem: 'unhighlightItem',\n};\n\nvar ObjectsInConfig = ['fuseOptions', 'classNames'];\n\nvar PassedElementTypes = {\n Text: 'text',\n SelectOne: 'select-one',\n SelectMultiple: 'select-multiple',\n};\n\nvar addChoice = function (choice) { return ({\n type: ActionType.ADD_CHOICE,\n choice: choice,\n}); };\nvar removeChoice = function (choice) { return ({\n type: ActionType.REMOVE_CHOICE,\n choice: choice,\n}); };\nvar filterChoices = function (results) { return ({\n type: ActionType.FILTER_CHOICES,\n results: results,\n}); };\nvar activateChoices = function (active) {\n return ({\n type: ActionType.ACTIVATE_CHOICES,\n active: active,\n });\n};\n\nvar addGroup = function (group) { return ({\n type: ActionType.ADD_GROUP,\n group: group,\n}); };\n\nvar addItem = function (item) { return ({\n type: ActionType.ADD_ITEM,\n item: item,\n}); };\nvar removeItem$1 = function (item) { return ({\n type: ActionType.REMOVE_ITEM,\n item: item,\n}); };\nvar highlightItem = function (item, highlighted) { return ({\n type: ActionType.HIGHLIGHT_ITEM,\n item: item,\n highlighted: highlighted,\n}); };\n\nvar getRandomNumber = function (min, max) { return Math.floor(Math.random() * (max - min) + min); };\nvar generateChars = function (length) {\n return Array.from({ length: length }, function () { return getRandomNumber(0, 36).toString(36); }).join('');\n};\nvar generateId = function (element, prefix) {\n var id = element.id || (element.name && \"\".concat(element.name, \"-\").concat(generateChars(2))) || generateChars(4);\n id = id.replace(/(:|\\.|\\[|\\]|,)/g, '');\n id = \"\".concat(prefix, \"-\").concat(id);\n return id;\n};\nvar getAdjacentEl = function (startEl, selector, direction) {\n if (direction === void 0) { direction = 1; }\n var prop = \"\".concat(direction > 0 ? 'next' : 'previous', \"ElementSibling\");\n var sibling = startEl[prop];\n while (sibling) {\n if (sibling.matches(selector)) {\n return sibling;\n }\n sibling = sibling[prop];\n }\n return null;\n};\nvar isScrolledIntoView = function (element, parent, direction) {\n if (direction === void 0) { direction = 1; }\n var isVisible;\n if (direction > 0) {\n // In view from bottom\n isVisible = parent.scrollTop + parent.offsetHeight >= element.offsetTop + element.offsetHeight;\n }\n else {\n // In view from top\n isVisible = element.offsetTop >= parent.scrollTop;\n }\n return isVisible;\n};\nvar sanitise = function (value) {\n if (typeof value !== 'string') {\n if (value === null || value === undefined) {\n return '';\n }\n if (typeof value === 'object') {\n if ('raw' in value) {\n return sanitise(value.raw);\n }\n if ('trusted' in value) {\n return value.trusted;\n }\n }\n return value;\n }\n return value\n .replace(/&/g, '&')\n .replace(/>/g, '>')\n .replace(/= 0 &&\n !window.matchMedia(\"(min-height: \".concat(dropdownPos + 1, \"px)\")).matches;\n }\n else if (this.position === 'top') {\n shouldFlip = true;\n }\n return shouldFlip;\n };\n Container.prototype.setActiveDescendant = function (activeDescendantID) {\n this.element.setAttribute('aria-activedescendant', activeDescendantID);\n };\n Container.prototype.removeActiveDescendant = function () {\n this.element.removeAttribute('aria-activedescendant');\n };\n Container.prototype.open = function (dropdownPos, dropdownHeight) {\n addClassesToElement(this.element, this.classNames.openState);\n this.element.setAttribute('aria-expanded', 'true');\n this.isOpen = true;\n if (this.shouldFlip(dropdownPos, dropdownHeight)) {\n addClassesToElement(this.element, this.classNames.flippedState);\n this.isFlipped = true;\n }\n };\n Container.prototype.close = function () {\n removeClassesFromElement(this.element, this.classNames.openState);\n this.element.setAttribute('aria-expanded', 'false');\n this.removeActiveDescendant();\n this.isOpen = false;\n // A dropdown flips if it does not have space within the page\n if (this.isFlipped) {\n removeClassesFromElement(this.element, this.classNames.flippedState);\n this.isFlipped = false;\n }\n };\n Container.prototype.addFocusState = function () {\n addClassesToElement(this.element, this.classNames.focusState);\n };\n Container.prototype.removeFocusState = function () {\n removeClassesFromElement(this.element, this.classNames.focusState);\n };\n Container.prototype.enable = function () {\n removeClassesFromElement(this.element, this.classNames.disabledState);\n this.element.removeAttribute('aria-disabled');\n if (this.type === PassedElementTypes.SelectOne) {\n this.element.setAttribute('tabindex', '0');\n }\n this.isDisabled = false;\n };\n Container.prototype.disable = function () {\n addClassesToElement(this.element, this.classNames.disabledState);\n this.element.setAttribute('aria-disabled', 'true');\n if (this.type === PassedElementTypes.SelectOne) {\n this.element.setAttribute('tabindex', '-1');\n }\n this.isDisabled = true;\n };\n Container.prototype.wrap = function (element) {\n var el = this.element;\n var parentNode = element.parentNode;\n if (parentNode) {\n if (element.nextSibling) {\n parentNode.insertBefore(el, element.nextSibling);\n }\n else {\n parentNode.appendChild(el);\n }\n }\n el.appendChild(element);\n };\n Container.prototype.unwrap = function (element) {\n var el = this.element;\n var parentNode = el.parentNode;\n if (parentNode) {\n // Move passed element outside this element\n parentNode.insertBefore(element, el);\n // Remove this element\n parentNode.removeChild(el);\n }\n };\n Container.prototype.addLoadingState = function () {\n addClassesToElement(this.element, this.classNames.loadingState);\n this.element.setAttribute('aria-busy', 'true');\n this.isLoading = true;\n };\n Container.prototype.removeLoadingState = function () {\n removeClassesFromElement(this.element, this.classNames.loadingState);\n this.element.removeAttribute('aria-busy');\n this.isLoading = false;\n };\n return Container;\n}());\n\nvar Input = /** @class */ (function () {\n function Input(_a) {\n var element = _a.element, type = _a.type, classNames = _a.classNames, preventPaste = _a.preventPaste;\n this.element = element;\n this.type = type;\n this.classNames = classNames;\n this.preventPaste = preventPaste;\n this.isFocussed = this.element.isEqualNode(document.activeElement);\n this.isDisabled = element.disabled;\n this._onPaste = this._onPaste.bind(this);\n this._onInput = this._onInput.bind(this);\n this._onFocus = this._onFocus.bind(this);\n this._onBlur = this._onBlur.bind(this);\n }\n Object.defineProperty(Input.prototype, \"placeholder\", {\n set: function (placeholder) {\n this.element.placeholder = placeholder;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Input.prototype, \"value\", {\n get: function () {\n return this.element.value;\n },\n set: function (value) {\n this.element.value = value;\n },\n enumerable: false,\n configurable: true\n });\n Input.prototype.addEventListeners = function () {\n var el = this.element;\n el.addEventListener('paste', this._onPaste);\n el.addEventListener('input', this._onInput, {\n passive: true,\n });\n el.addEventListener('focus', this._onFocus, {\n passive: true,\n });\n el.addEventListener('blur', this._onBlur, {\n passive: true,\n });\n };\n Input.prototype.removeEventListeners = function () {\n var el = this.element;\n el.removeEventListener('input', this._onInput);\n el.removeEventListener('paste', this._onPaste);\n el.removeEventListener('focus', this._onFocus);\n el.removeEventListener('blur', this._onBlur);\n };\n Input.prototype.enable = function () {\n var el = this.element;\n el.removeAttribute('disabled');\n this.isDisabled = false;\n };\n Input.prototype.disable = function () {\n var el = this.element;\n el.setAttribute('disabled', '');\n this.isDisabled = true;\n };\n Input.prototype.focus = function () {\n if (!this.isFocussed) {\n this.element.focus();\n }\n };\n Input.prototype.blur = function () {\n if (this.isFocussed) {\n this.element.blur();\n }\n };\n Input.prototype.clear = function (setWidth) {\n if (setWidth === void 0) { setWidth = true; }\n this.element.value = '';\n if (setWidth) {\n this.setWidth();\n }\n return this;\n };\n /**\n * Set the correct input width based on placeholder\n * value or input value\n */\n Input.prototype.setWidth = function () {\n // Resize input to contents or placeholder\n var element = this.element;\n element.style.minWidth = \"\".concat(element.placeholder.length + 1, \"ch\");\n element.style.width = \"\".concat(element.value.length + 1, \"ch\");\n };\n Input.prototype.setActiveDescendant = function (activeDescendantID) {\n this.element.setAttribute('aria-activedescendant', activeDescendantID);\n };\n Input.prototype.removeActiveDescendant = function () {\n this.element.removeAttribute('aria-activedescendant');\n };\n Input.prototype._onInput = function () {\n if (this.type !== PassedElementTypes.SelectOne) {\n this.setWidth();\n }\n };\n Input.prototype._onPaste = function (event) {\n if (this.preventPaste) {\n event.preventDefault();\n }\n };\n Input.prototype._onFocus = function () {\n this.isFocussed = true;\n };\n Input.prototype._onBlur = function () {\n this.isFocussed = false;\n };\n return Input;\n}());\n\nvar SCROLLING_SPEED = 4;\n\nvar List = /** @class */ (function () {\n function List(_a) {\n var element = _a.element;\n this.element = element;\n this.scrollPos = this.element.scrollTop;\n this.height = this.element.offsetHeight;\n }\n List.prototype.prepend = function (node) {\n var child = this.element.firstElementChild;\n if (child) {\n this.element.insertBefore(node, child);\n }\n else {\n this.element.append(node);\n }\n };\n List.prototype.scrollToTop = function () {\n this.element.scrollTop = 0;\n };\n List.prototype.scrollToChildElement = function (element, direction) {\n var _this = this;\n if (!element) {\n return;\n }\n var listHeight = this.element.offsetHeight;\n // Scroll position of dropdown\n var listScrollPosition = this.element.scrollTop + listHeight;\n var elementHeight = element.offsetHeight;\n // Distance from bottom of element to top of parent\n var elementPos = element.offsetTop + elementHeight;\n // Difference between the element and scroll position\n var destination = direction > 0 ? this.element.scrollTop + elementPos - listScrollPosition : element.offsetTop;\n requestAnimationFrame(function () {\n _this._animateScroll(destination, direction);\n });\n };\n List.prototype._scrollDown = function (scrollPos, strength, destination) {\n var easing = (destination - scrollPos) / strength;\n var distance = easing > 1 ? easing : 1;\n this.element.scrollTop = scrollPos + distance;\n };\n List.prototype._scrollUp = function (scrollPos, strength, destination) {\n var easing = (scrollPos - destination) / strength;\n var distance = easing > 1 ? easing : 1;\n this.element.scrollTop = scrollPos - distance;\n };\n List.prototype._animateScroll = function (destination, direction) {\n var _this = this;\n var strength = SCROLLING_SPEED;\n var choiceListScrollTop = this.element.scrollTop;\n var continueAnimation = false;\n if (direction > 0) {\n this._scrollDown(choiceListScrollTop, strength, destination);\n if (choiceListScrollTop < destination) {\n continueAnimation = true;\n }\n }\n else {\n this._scrollUp(choiceListScrollTop, strength, destination);\n if (choiceListScrollTop > destination) {\n continueAnimation = true;\n }\n }\n if (continueAnimation) {\n requestAnimationFrame(function () {\n _this._animateScroll(destination, direction);\n });\n }\n };\n return List;\n}());\n\nvar WrappedElement = /** @class */ (function () {\n function WrappedElement(_a) {\n var element = _a.element, classNames = _a.classNames;\n this.element = element;\n this.classNames = classNames;\n this.isDisabled = false;\n }\n Object.defineProperty(WrappedElement.prototype, \"isActive\", {\n get: function () {\n return this.element.dataset.choice === 'active';\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(WrappedElement.prototype, \"dir\", {\n get: function () {\n return this.element.dir;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(WrappedElement.prototype, \"value\", {\n get: function () {\n return this.element.value;\n },\n set: function (value) {\n this.element.setAttribute('value', value);\n this.element.value = value;\n },\n enumerable: false,\n configurable: true\n });\n WrappedElement.prototype.conceal = function () {\n var el = this.element;\n // Hide passed input\n addClassesToElement(el, this.classNames.input);\n el.hidden = true;\n // Remove element from tab index\n el.tabIndex = -1;\n // Backup original styles if any\n var origStyle = el.getAttribute('style');\n if (origStyle) {\n el.setAttribute('data-choice-orig-style', origStyle);\n }\n el.setAttribute('data-choice', 'active');\n };\n WrappedElement.prototype.reveal = function () {\n var el = this.element;\n // Reinstate passed element\n removeClassesFromElement(el, this.classNames.input);\n el.hidden = false;\n el.removeAttribute('tabindex');\n // Recover original styles if any\n var origStyle = el.getAttribute('data-choice-orig-style');\n if (origStyle) {\n el.removeAttribute('data-choice-orig-style');\n el.setAttribute('style', origStyle);\n }\n else {\n el.removeAttribute('style');\n }\n el.removeAttribute('data-choice');\n };\n WrappedElement.prototype.enable = function () {\n this.element.removeAttribute('disabled');\n this.element.disabled = false;\n this.isDisabled = false;\n };\n WrappedElement.prototype.disable = function () {\n this.element.setAttribute('disabled', '');\n this.element.disabled = true;\n this.isDisabled = true;\n };\n WrappedElement.prototype.triggerEvent = function (eventType, data) {\n dispatchEvent(this.element, eventType, data || {});\n };\n return WrappedElement;\n}());\n\nvar WrappedInput = /** @class */ (function (_super) {\n __extends(WrappedInput, _super);\n function WrappedInput() {\n return _super !== null && _super.apply(this, arguments) || this;\n }\n return WrappedInput;\n}(WrappedElement));\n\nvar coerceBool = function (arg, defaultValue) {\n if (defaultValue === void 0) { defaultValue = true; }\n return typeof arg === 'undefined' ? defaultValue : !!arg;\n};\nvar stringToHtmlClass = function (input) {\n if (typeof input === 'string') {\n // eslint-disable-next-line no-param-reassign\n input = input.split(' ').filter(function (s) { return s.length; });\n }\n if (Array.isArray(input) && input.length) {\n return input;\n }\n return undefined;\n};\nvar mapInputToChoice = function (value, allowGroup) {\n if (typeof value === 'string') {\n var result_1 = mapInputToChoice({\n value: value,\n label: value,\n }, false);\n return result_1;\n }\n var groupOrChoice = value;\n if ('choices' in groupOrChoice) {\n if (!allowGroup) {\n // https://developer.mozilla.org/en-US/docs/Web/HTML/Element/optgroup\n throw new TypeError(\"optGroup is not allowed\");\n }\n var group = groupOrChoice;\n var choices = group.choices.map(function (e) { return mapInputToChoice(e, false); });\n var result_2 = {\n id: 0, // actual ID will be assigned during _addGroup\n label: unwrapStringForRaw(group.label) || group.value,\n active: !!choices.length,\n disabled: !!group.disabled,\n choices: choices,\n };\n return result_2;\n }\n var choice = groupOrChoice;\n var result = {\n id: 0, // actual ID will be assigned during _addChoice\n group: null, // actual group will be assigned during _addGroup but before _addChoice\n score: 0, // used in search\n rank: 0, // used in search, stable sort order\n value: choice.value,\n label: choice.label || choice.value,\n active: coerceBool(choice.active),\n selected: coerceBool(choice.selected, false),\n disabled: coerceBool(choice.disabled, false),\n placeholder: coerceBool(choice.placeholder, false),\n highlighted: false,\n labelClass: stringToHtmlClass(choice.labelClass),\n labelDescription: choice.labelDescription,\n customProperties: choice.customProperties,\n };\n return result;\n};\n\nvar isHtmlInputElement = function (e) { return e.tagName === 'INPUT'; };\nvar isHtmlSelectElement = function (e) { return e.tagName === 'SELECT'; };\nvar isHtmlOption = function (e) { return e.tagName === 'OPTION'; };\nvar isHtmlOptgroup = function (e) { return e.tagName === 'OPTGROUP'; };\n\nvar WrappedSelect = /** @class */ (function (_super) {\n __extends(WrappedSelect, _super);\n function WrappedSelect(_a) {\n var element = _a.element, classNames = _a.classNames, template = _a.template, extractPlaceholder = _a.extractPlaceholder;\n var _this = _super.call(this, { element: element, classNames: classNames }) || this;\n _this.template = template;\n _this.extractPlaceholder = extractPlaceholder;\n return _this;\n }\n Object.defineProperty(WrappedSelect.prototype, \"placeholderOption\", {\n get: function () {\n return (this.element.querySelector('option[value=\"\"]') ||\n // Backward compatibility layer for the non-standard placeholder attribute supported in older versions.\n this.element.querySelector('option[placeholder]'));\n },\n enumerable: false,\n configurable: true\n });\n WrappedSelect.prototype.addOptions = function (choices) {\n var _this = this;\n var fragment = document.createDocumentFragment();\n choices.forEach(function (obj) {\n var choice = obj;\n if (choice.element) {\n return;\n }\n var option = _this.template(choice);\n fragment.appendChild(option);\n choice.element = option;\n });\n this.element.appendChild(fragment);\n };\n WrappedSelect.prototype.optionsAsChoices = function () {\n var _this = this;\n var choices = [];\n this.element.querySelectorAll(':scope > option, :scope > optgroup').forEach(function (e) {\n if (isHtmlOption(e)) {\n choices.push(_this._optionToChoice(e));\n }\n else if (isHtmlOptgroup(e)) {\n choices.push(_this._optgroupToChoice(e));\n }\n // todo: hr as empty optgroup, requires displaying empty opt-groups to be useful\n });\n return choices;\n };\n // eslint-disable-next-line class-methods-use-this\n WrappedSelect.prototype._optionToChoice = function (option) {\n // option.value returns the label if there is no value attribute, which can break legacy placeholder attribute support\n if (!option.hasAttribute('value') && option.hasAttribute('placeholder')) {\n option.setAttribute('value', '');\n option.value = '';\n }\n return {\n id: 0,\n group: null,\n score: 0,\n rank: 0,\n value: option.value,\n label: option.innerHTML,\n element: option,\n active: true,\n // this returns true if nothing is selected on initial load, which will break placeholder support\n selected: this.extractPlaceholder ? option.selected : option.hasAttribute('selected'),\n disabled: option.disabled,\n highlighted: false,\n placeholder: this.extractPlaceholder && (!option.value || option.hasAttribute('placeholder')),\n labelClass: typeof option.dataset.labelClass !== 'undefined' ? stringToHtmlClass(option.dataset.labelClass) : undefined,\n labelDescription: typeof option.dataset.labelDescription !== 'undefined' ? option.dataset.labelDescription : undefined,\n customProperties: parseCustomProperties(option.dataset.customProperties),\n };\n };\n WrappedSelect.prototype._optgroupToChoice = function (optgroup) {\n var _this = this;\n var options = optgroup.querySelectorAll('option');\n var choices = Array.from(options).map(function (option) { return _this._optionToChoice(option); });\n return {\n id: 0,\n label: optgroup.label || '',\n element: optgroup,\n active: !!choices.length,\n disabled: optgroup.disabled,\n choices: choices,\n };\n };\n return WrappedSelect;\n}(WrappedElement));\n\nvar DEFAULT_CLASSNAMES = {\n containerOuter: ['choices'],\n containerInner: ['choices__inner'],\n input: ['choices__input'],\n inputCloned: ['choices__input--cloned'],\n list: ['choices__list'],\n listItems: ['choices__list--multiple'],\n listSingle: ['choices__list--single'],\n listDropdown: ['choices__list--dropdown'],\n item: ['choices__item'],\n itemSelectable: ['choices__item--selectable'],\n itemDisabled: ['choices__item--disabled'],\n itemChoice: ['choices__item--choice'],\n description: ['choices__description'],\n placeholder: ['choices__placeholder'],\n group: ['choices__group'],\n groupHeading: ['choices__heading'],\n button: ['choices__button'],\n activeState: ['is-active'],\n focusState: ['is-focused'],\n openState: ['is-open'],\n disabledState: ['is-disabled'],\n highlightedState: ['is-highlighted'],\n selectedState: ['is-selected'],\n flippedState: ['is-flipped'],\n loadingState: ['is-loading'],\n notice: ['choices__notice'],\n addChoice: ['choices__item--selectable', 'add-choice'],\n noResults: ['has-no-results'],\n noChoices: ['has-no-choices'],\n};\nvar DEFAULT_CONFIG = {\n items: [],\n choices: [],\n silent: false,\n renderChoiceLimit: -1,\n maxItemCount: -1,\n closeDropdownOnSelect: 'auto',\n singleModeForMultiSelect: false,\n addChoices: false,\n addItems: true,\n addItemFilter: function (value) { return !!value && value !== ''; },\n removeItems: true,\n removeItemButton: false,\n removeItemButtonAlignLeft: false,\n editItems: false,\n allowHTML: false,\n allowHtmlUserInput: false,\n duplicateItemsAllowed: true,\n delimiter: ',',\n paste: true,\n searchEnabled: true,\n searchChoices: true,\n searchFloor: 1,\n searchResultLimit: 4,\n searchFields: ['label', 'value'],\n position: 'auto',\n resetScrollPosition: true,\n shouldSort: true,\n shouldSortItems: false,\n sorter: sortByAlpha,\n shadowRoot: null,\n placeholder: true,\n placeholderValue: null,\n searchPlaceholderValue: null,\n prependValue: null,\n appendValue: null,\n renderSelectedChoices: 'auto',\n loadingText: 'Loading...',\n noResultsText: 'No results found',\n noChoicesText: 'No choices to choose from',\n itemSelectText: 'Press to select',\n uniqueItemText: 'Only unique values can be added',\n customAddItemText: 'Only values matching specific conditions can be added',\n addItemText: function (value) { return \"Press Enter to add \\\"\".concat(value, \"\\\"\"); },\n removeItemIconText: function () { return \"Remove item\"; },\n removeItemLabelText: function (value) { return \"Remove item: \".concat(value); },\n maxItemText: function (maxItemCount) { return \"Only \".concat(maxItemCount, \" values can be added\"); },\n valueComparer: function (value1, value2) { return value1 === value2; },\n fuseOptions: {\n includeScore: true,\n },\n labelId: '',\n callbackOnInit: null,\n callbackOnCreateTemplates: null,\n classNames: DEFAULT_CLASSNAMES,\n appendGroupInSearch: false,\n};\n\nvar removeItem = function (item) {\n var itemEl = item.itemEl;\n if (itemEl) {\n itemEl.remove();\n item.itemEl = undefined;\n }\n};\nfunction items(s, action, context) {\n var state = s;\n var update = true;\n switch (action.type) {\n case ActionType.ADD_ITEM: {\n action.item.selected = true;\n var el = action.item.element;\n if (el) {\n el.selected = true;\n el.setAttribute('selected', '');\n }\n state.push(action.item);\n break;\n }\n case ActionType.REMOVE_ITEM: {\n action.item.selected = false;\n var el = action.item.element;\n if (el) {\n el.selected = false;\n el.removeAttribute('selected');\n // For a select-one, if all options are deselected, the first item is selected. To set a black value, select.value needs to be set\n var select = el.parentElement;\n if (select && isHtmlSelectElement(select) && select.type === PassedElementTypes.SelectOne) {\n select.value = '';\n }\n }\n // this is mixing concerns, but this is *so much faster*\n removeItem(action.item);\n state = state.filter(function (choice) { return choice.id !== action.item.id; });\n break;\n }\n case ActionType.REMOVE_CHOICE: {\n removeItem(action.choice);\n state = state.filter(function (item) { return item.id !== action.choice.id; });\n break;\n }\n case ActionType.HIGHLIGHT_ITEM: {\n var highlighted = action.highlighted;\n var item = state.find(function (obj) { return obj.id === action.item.id; });\n if (item && item.highlighted !== highlighted) {\n item.highlighted = highlighted;\n if (context) {\n updateClassList(item, highlighted ? context.classNames.highlightedState : context.classNames.selectedState, highlighted ? context.classNames.selectedState : context.classNames.highlightedState);\n }\n }\n break;\n }\n default: {\n update = false;\n break;\n }\n }\n return { state: state, update: update };\n}\n\nfunction groups(s, action) {\n var state = s;\n var update = true;\n switch (action.type) {\n case ActionType.ADD_GROUP: {\n state.push(action.group);\n break;\n }\n case ActionType.CLEAR_CHOICES: {\n state = [];\n break;\n }\n default: {\n update = false;\n break;\n }\n }\n return { state: state, update: update };\n}\n\n/* eslint-disable */\nfunction choices(s, action, context) {\n var state = s;\n var update = true;\n switch (action.type) {\n case ActionType.ADD_CHOICE: {\n state.push(action.choice);\n break;\n }\n case ActionType.REMOVE_CHOICE: {\n action.choice.choiceEl = undefined;\n if (action.choice.group) {\n action.choice.group.choices = action.choice.group.choices.filter(function (obj) { return obj.id !== action.choice.id; });\n }\n state = state.filter(function (obj) { return obj.id !== action.choice.id; });\n break;\n }\n case ActionType.ADD_ITEM:\n case ActionType.REMOVE_ITEM: {\n action.item.choiceEl = undefined;\n break;\n }\n case ActionType.FILTER_CHOICES: {\n // avoid O(n^2) algorithm complexity when searching/filtering choices\n var scoreLookup_1 = [];\n action.results.forEach(function (result) {\n scoreLookup_1[result.item.id] = result;\n });\n state.forEach(function (choice) {\n var result = scoreLookup_1[choice.id];\n if (result !== undefined) {\n choice.score = result.score;\n choice.rank = result.rank;\n choice.active = true;\n }\n else {\n choice.score = 0;\n choice.rank = 0;\n choice.active = false;\n }\n if (context && context.appendGroupInSearch) {\n choice.choiceEl = undefined;\n }\n });\n break;\n }\n case ActionType.ACTIVATE_CHOICES: {\n state.forEach(function (choice) {\n choice.active = action.active;\n if (context && context.appendGroupInSearch) {\n choice.choiceEl = undefined;\n }\n });\n break;\n }\n case ActionType.CLEAR_CHOICES: {\n state = [];\n break;\n }\n default: {\n update = false;\n break;\n }\n }\n return { state: state, update: update };\n}\n\nvar reducers = {\n groups: groups,\n items: items,\n choices: choices,\n};\nvar Store = /** @class */ (function () {\n function Store(context) {\n this._state = this.defaultState;\n this._listeners = [];\n this._txn = 0;\n this._context = context;\n }\n Object.defineProperty(Store.prototype, \"defaultState\", {\n // eslint-disable-next-line class-methods-use-this\n get: function () {\n return {\n groups: [],\n items: [],\n choices: [],\n };\n },\n enumerable: false,\n configurable: true\n });\n // eslint-disable-next-line class-methods-use-this\n Store.prototype.changeSet = function (init) {\n return {\n groups: init,\n items: init,\n choices: init,\n };\n };\n Store.prototype.reset = function () {\n this._state = this.defaultState;\n var changes = this.changeSet(true);\n if (this._txn) {\n this._changeSet = changes;\n }\n else {\n this._listeners.forEach(function (l) { return l(changes); });\n }\n };\n Store.prototype.subscribe = function (onChange) {\n this._listeners.push(onChange);\n return this;\n };\n Store.prototype.dispatch = function (action) {\n var _this = this;\n var state = this._state;\n var hasChanges = false;\n var changes = this._changeSet || this.changeSet(false);\n Object.keys(reducers).forEach(function (key) {\n var stateUpdate = reducers[key](state[key], action, _this._context);\n if (stateUpdate.update) {\n hasChanges = true;\n changes[key] = true;\n state[key] = stateUpdate.state;\n }\n });\n if (hasChanges) {\n if (this._txn) {\n this._changeSet = changes;\n }\n else {\n this._listeners.forEach(function (l) { return l(changes); });\n }\n }\n };\n Store.prototype.withTxn = function (func) {\n this._txn++;\n try {\n func();\n }\n finally {\n this._txn = Math.max(0, this._txn - 1);\n if (!this._txn) {\n var changeSet_1 = this._changeSet;\n if (changeSet_1) {\n this._changeSet = undefined;\n this._listeners.forEach(function (l) { return l(changeSet_1); });\n }\n }\n }\n };\n Object.defineProperty(Store.prototype, \"state\", {\n /**\n * Get store object\n */\n get: function () {\n return this._state;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"items\", {\n /**\n * Get items from store\n */\n get: function () {\n return this.state.items;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"highlightedActiveItems\", {\n /**\n * Get highlighted items from store\n */\n get: function () {\n return this.items.filter(function (item) { return !item.disabled && item.active && item.highlighted; });\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"choices\", {\n /**\n * Get choices from store\n */\n get: function () {\n return this.state.choices;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"activeChoices\", {\n /**\n * Get active choices from store\n */\n get: function () {\n return this.choices.filter(function (choice) { return choice.active; });\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"searchableChoices\", {\n /**\n * Get choices that can be searched (excluding placeholders)\n */\n get: function () {\n return this.choices.filter(function (choice) { return !choice.disabled && !choice.placeholder; });\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"groups\", {\n /**\n * Get groups from store\n */\n get: function () {\n return this.state.groups;\n },\n enumerable: false,\n configurable: true\n });\n Object.defineProperty(Store.prototype, \"activeGroups\", {\n /**\n * Get active groups from store\n */\n get: function () {\n var _this = this;\n return this.state.groups.filter(function (group) {\n var isActive = group.active && !group.disabled;\n var hasActiveOptions = _this.state.choices.some(function (choice) { return choice.active && !choice.disabled; });\n return isActive && hasActiveOptions;\n }, []);\n },\n enumerable: false,\n configurable: true\n });\n Store.prototype.inTxn = function () {\n return this._txn > 0;\n };\n /**\n * Get single choice by it's ID\n */\n Store.prototype.getChoiceById = function (id) {\n return this.activeChoices.find(function (choice) { return choice.id === id; });\n };\n /**\n * Get group by group id\n */\n Store.prototype.getGroupById = function (id) {\n return this.groups.find(function (group) { return group.id === id; });\n };\n return Store;\n}());\n\nvar NoticeTypes = {\n noChoices: 'no-choices',\n noResults: 'no-results',\n addChoice: 'add-choice',\n generic: '',\n};\n\nfunction _defineProperty(e, r, t) {\n return (r = _toPropertyKey(r)) in e ? Object.defineProperty(e, r, {\n value: t,\n enumerable: !0,\n configurable: !0,\n writable: !0\n }) : e[r] = t, e;\n}\nfunction ownKeys(e, r) {\n var t = Object.keys(e);\n if (Object.getOwnPropertySymbols) {\n var o = Object.getOwnPropertySymbols(e);\n r && (o = o.filter(function (r) {\n return Object.getOwnPropertyDescriptor(e, r).enumerable;\n })), t.push.apply(t, o);\n }\n return t;\n}\nfunction _objectSpread2(e) {\n for (var r = 1; r < arguments.length; r++) {\n var t = null != arguments[r] ? arguments[r] : {};\n r % 2 ? ownKeys(Object(t), !0).forEach(function (r) {\n _defineProperty(e, r, t[r]);\n }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(t)) : ownKeys(Object(t)).forEach(function (r) {\n Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(t, r));\n });\n }\n return e;\n}\nfunction _toPrimitive(t, r) {\n if (\"object\" != typeof t || !t) return t;\n var e = t[Symbol.toPrimitive];\n if (void 0 !== e) {\n var i = e.call(t, r || \"default\");\n if (\"object\" != typeof i) return i;\n throw new TypeError(\"@@toPrimitive must return a primitive value.\");\n }\n return (\"string\" === r ? String : Number)(t);\n}\nfunction _toPropertyKey(t) {\n var i = _toPrimitive(t, \"string\");\n return \"symbol\" == typeof i ? i : i + \"\";\n}\n\n/**\n * Fuse.js v7.0.0 - Lightweight fuzzy-search (http://fusejs.io)\n *\n * Copyright (c) 2023 Kiro Risk (http://kiro.me)\n * All Rights Reserved. Apache Software License 2.0\n *\n * http://www.apache.org/licenses/LICENSE-2.0\n */\n\nfunction isArray(value) {\n return !Array.isArray ? getTag(value) === '[object Array]' : Array.isArray(value);\n}\n\n// Adapted from: https://github.com/lodash/lodash/blob/master/.internal/baseToString.js\nconst INFINITY = 1 / 0;\nfunction baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n let result = value + '';\n return result == '0' && 1 / value == -INFINITY ? '-0' : result;\n}\nfunction toString(value) {\n return value == null ? '' : baseToString(value);\n}\nfunction isString(value) {\n return typeof value === 'string';\n}\nfunction isNumber(value) {\n return typeof value === 'number';\n}\n\n// Adapted from: https://github.com/lodash/lodash/blob/master/isBoolean.js\nfunction isBoolean(value) {\n return value === true || value === false || isObjectLike(value) && getTag(value) == '[object Boolean]';\n}\nfunction isObject(value) {\n return typeof value === 'object';\n}\n\n// Checks if `value` is object-like.\nfunction isObjectLike(value) {\n return isObject(value) && value !== null;\n}\nfunction isDefined(value) {\n return value !== undefined && value !== null;\n}\nfunction isBlank(value) {\n return !value.trim().length;\n}\n\n// Gets the `toStringTag` of `value`.\n// Adapted from: https://github.com/lodash/lodash/blob/master/.internal/getTag.js\nfunction getTag(value) {\n return value == null ? value === undefined ? '[object Undefined]' : '[object Null]' : Object.prototype.toString.call(value);\n}\nconst EXTENDED_SEARCH_UNAVAILABLE = 'Extended search is not available';\nconst INCORRECT_INDEX_TYPE = \"Incorrect 'index' type\";\nconst LOGICAL_SEARCH_INVALID_QUERY_FOR_KEY = key => `Invalid value for key ${key}`;\nconst PATTERN_LENGTH_TOO_LARGE = max => `Pattern length exceeds max of ${max}.`;\nconst MISSING_KEY_PROPERTY = name => `Missing ${name} property in key`;\nconst INVALID_KEY_WEIGHT_VALUE = key => `Property 'weight' in key '${key}' must be a positive integer`;\nconst hasOwn = Object.prototype.hasOwnProperty;\nclass KeyStore {\n constructor(keys) {\n this._keys = [];\n this._keyMap = {};\n let totalWeight = 0;\n keys.forEach(key => {\n let obj = createKey(key);\n this._keys.push(obj);\n this._keyMap[obj.id] = obj;\n totalWeight += obj.weight;\n });\n\n // Normalize weights so that their sum is equal to 1\n this._keys.forEach(key => {\n key.weight /= totalWeight;\n });\n }\n get(keyId) {\n return this._keyMap[keyId];\n }\n keys() {\n return this._keys;\n }\n toJSON() {\n return JSON.stringify(this._keys);\n }\n}\nfunction createKey(key) {\n let path = null;\n let id = null;\n let src = null;\n let weight = 1;\n let getFn = null;\n if (isString(key) || isArray(key)) {\n src = key;\n path = createKeyPath(key);\n id = createKeyId(key);\n } else {\n if (!hasOwn.call(key, 'name')) {\n throw new Error(MISSING_KEY_PROPERTY('name'));\n }\n const name = key.name;\n src = name;\n if (hasOwn.call(key, 'weight')) {\n weight = key.weight;\n if (weight <= 0) {\n throw new Error(INVALID_KEY_WEIGHT_VALUE(name));\n }\n }\n path = createKeyPath(name);\n id = createKeyId(name);\n getFn = key.getFn;\n }\n return {\n path,\n id,\n weight,\n src,\n getFn\n };\n}\nfunction createKeyPath(key) {\n return isArray(key) ? key : key.split('.');\n}\nfunction createKeyId(key) {\n return isArray(key) ? key.join('.') : key;\n}\nfunction get(obj, path) {\n let list = [];\n let arr = false;\n const deepGet = (obj, path, index) => {\n if (!isDefined(obj)) {\n return;\n }\n if (!path[index]) {\n // If there's no path left, we've arrived at the object we care about.\n list.push(obj);\n } else {\n let key = path[index];\n const value = obj[key];\n if (!isDefined(value)) {\n return;\n }\n\n // If we're at the last value in the path, and if it's a string/number/bool,\n // add it to the list\n if (index === path.length - 1 && (isString(value) || isNumber(value) || isBoolean(value))) {\n list.push(toString(value));\n } else if (isArray(value)) {\n arr = true;\n // Search each item in the array.\n for (let i = 0, len = value.length; i < len; i += 1) {\n deepGet(value[i], path, index + 1);\n }\n } else if (path.length) {\n // An object. Recurse further.\n deepGet(value, path, index + 1);\n }\n }\n };\n\n // Backwards compatibility (since path used to be a string)\n deepGet(obj, isString(path) ? path.split('.') : path, 0);\n return arr ? list : list[0];\n}\nconst MatchOptions = {\n // Whether the matches should be included in the result set. When `true`, each record in the result\n // set will include the indices of the matched characters.\n // These can consequently be used for highlighting purposes.\n includeMatches: false,\n // When `true`, the matching function will continue to the end of a search pattern even if\n // a perfect match has already been located in the string.\n findAllMatches: false,\n // Minimum number of characters that must be matched before a result is considered a match\n minMatchCharLength: 1\n};\nconst BasicOptions = {\n // When `true`, the algorithm continues searching to the end of the input even if a perfect\n // match is found before the end of the same input.\n isCaseSensitive: false,\n // When true, the matching function will continue to the end of a search pattern even if\n includeScore: false,\n // List of properties that will be searched. This also supports nested properties.\n keys: [],\n // Whether to sort the result list, by score\n shouldSort: true,\n // Default sort function: sort by ascending score, ascending index\n sortFn: (a, b) => a.score === b.score ? a.idx < b.idx ? -1 : 1 : a.score < b.score ? -1 : 1\n};\nconst FuzzyOptions = {\n // Approximately where in the text is the pattern expected to be found?\n location: 0,\n // At what point does the match algorithm give up. A threshold of '0.0' requires a perfect match\n // (of both letters and location), a threshold of '1.0' would match anything.\n threshold: 0.6,\n // Determines how close the match must be to the fuzzy location (specified above).\n // An exact letter match which is 'distance' characters away from the fuzzy location\n // would score as a complete mismatch. A distance of '0' requires the match be at\n // the exact location specified, a threshold of '1000' would require a perfect match\n // to be within 800 characters of the fuzzy location to be found using a 0.8 threshold.\n distance: 100\n};\nconst AdvancedOptions = {\n // When `true`, it enables the use of unix-like search commands\n useExtendedSearch: false,\n // The get function to use when fetching an object's properties.\n // The default will search nested paths *ie foo.bar.baz*\n getFn: get,\n // When `true`, search will ignore `location` and `distance`, so it won't matter\n // where in the string the pattern appears.\n // More info: https://fusejs.io/concepts/scoring-theory.html#fuzziness-score\n ignoreLocation: false,\n // When `true`, the calculation for the relevance score (used for sorting) will\n // ignore the field-length norm.\n // More info: https://fusejs.io/concepts/scoring-theory.html#field-length-norm\n ignoreFieldNorm: false,\n // The weight to determine how much field length norm effects scoring.\n fieldNormWeight: 1\n};\nvar Config = _objectSpread2(_objectSpread2(_objectSpread2(_objectSpread2({}, BasicOptions), MatchOptions), FuzzyOptions), AdvancedOptions);\nconst SPACE = /[^ ]+/g;\n\n// Field-length norm: the shorter the field, the higher the weight.\n// Set to 3 decimals to reduce index size.\nfunction norm(weight = 1, mantissa = 3) {\n const cache = new Map();\n const m = Math.pow(10, mantissa);\n return {\n get(value) {\n const numTokens = value.match(SPACE).length;\n if (cache.has(numTokens)) {\n return cache.get(numTokens);\n }\n\n // Default function is 1/sqrt(x), weight makes that variable\n const norm = 1 / Math.pow(numTokens, 0.5 * weight);\n\n // In place of `toFixed(mantissa)`, for faster computation\n const n = parseFloat(Math.round(norm * m) / m);\n cache.set(numTokens, n);\n return n;\n },\n clear() {\n cache.clear();\n }\n };\n}\nclass FuseIndex {\n constructor({\n getFn = Config.getFn,\n fieldNormWeight = Config.fieldNormWeight\n } = {}) {\n this.norm = norm(fieldNormWeight, 3);\n this.getFn = getFn;\n this.isCreated = false;\n this.setIndexRecords();\n }\n setSources(docs = []) {\n this.docs = docs;\n }\n setIndexRecords(records = []) {\n this.records = records;\n }\n setKeys(keys = []) {\n this.keys = keys;\n this._keysMap = {};\n keys.forEach((key, idx) => {\n this._keysMap[key.id] = idx;\n });\n }\n create() {\n if (this.isCreated || !this.docs.length) {\n return;\n }\n this.isCreated = true;\n\n // List is Array\n if (isString(this.docs[0])) {\n this.docs.forEach((doc, docIndex) => {\n this._addString(doc, docIndex);\n });\n } else {\n // List is Array